![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[VID]](/icons/movie.gif) | Grammar - Giving Advice - SHOULD, OUGHT TO, HAD BETTER.mp4 | 2015-12-01 02:21 | 62M | |
![[ ]](/icons/unknown.gif) | vocabulary unit 9.docx | 2014-12-03 00:53 | 38M | |
![[VID]](/icons/movie.gif) | Regular Verbs.mp4 | 2015-10-06 02:18 | 34M | |
![[VID]](/icons/movie.gif) | George Carlin on Euphemisms.mp4 | 2014-04-30 03:45 | 30M | |
![[VID]](/icons/movie.gif) | The Hidden Costs of Hamburgers.mp4 | 2015-01-14 18:34 | 27M | |
![[VID]](/icons/movie.gif) | Friends - HD - The Mugger.mp4 | 2014-11-10 15:29 | 26M | |
![[VID]](/icons/movie.gif) | Countable and Uncountable Nouns.mp4 | 2015-10-02 01:21 | 25M | |
![[VID]](/icons/movie.gif) | gi_Unit02a_the_man_with_no_past.mp4 | 2014-06-26 23:05 | 21M | |
![[VID]](/icons/movie.gif) | Delirium Tremens 2.mp4 | 2014-06-12 23:02 | 20M | |
![[VID]](/icons/movie.gif) | Stative Verbs, Action Verbs, and Verbs that can be both.mp4 | 2016-01-12 23:00 | 20M | |
![[ ]](/icons/layout.gif) | Present Continuous.pdf | 2017-10-14 00:48 | 19M | |
![[ ]](/icons/unknown.gif) | food vocabulary.docx | 2016-03-05 22:49 | 19M | |
![[VID]](/icons/movie.gif) | gi_Unit02c_striking_gold.mp4 | 2014-06-27 01:01 | 19M | |
![[VID]](/icons/movie.gif) | Verbs with Infinitives of Purpose.mp4 | 2015-10-01 23:29 | 19M | |
![[ ]](/icons/unknown.gif) | UNIT 5.pptx | 2017-08-04 00:59 | 17M | |
![[VID]](/icons/movie.gif) | gi_Unit02b_gold.mp4 | 2014-06-27 00:59 | 17M | |
![[ ]](/icons/layout.gif) | Life 3 Units 1,2.pdf | 2016-04-10 19:11 | 17M | |
![[ ]](/icons/unknown.gif) | mygrammarlab_elem_samples.pdf.crdownload | 2018-10-13 00:43 | 16M | |
![[VID]](/icons/movie.gif) | Gary Snyder on Ecology and Poetry - part 1.mp4 | 2014-11-15 00:45 | 15M | |
![[ ]](/icons/unknown.gif) | Possessives ´s.ppt | 2022-01-29 02:53 | 15M | |
![[ ]](/icons/layout.gif) | English-Vocabulary-in-Use-Advanced-with-Answers.pdf | 2017-10-11 23:10 | 15M | |
![[ ]](/icons/unknown.gif) | All About me Amelia.pptx | 2024-04-13 16:56 | 13M | |
![[ ]](/icons/unknown.gif) | Questions in past.pptx | 2015-05-23 18:05 | 12M | |
![[ ]](/icons/unknown.gif) | food vocabulary 3.docx | 2017-02-06 23:49 | 12M | |
![[ ]](/icons/unknown.gif) | food vocabulary 1.docx | 2017-02-06 23:46 | 12M | |
![[ ]](/icons/unknown.gif) | health vocabulary.docx | 2016-01-16 17:52 | 11M | |
![[VID]](/icons/movie.gif) | Mystery Story - Narrative Tenses.mp4 | 2015-07-25 15:46 | 11M | |
![[ ]](/icons/unknown.gif) | food vocabulary 2.docx | 2017-02-06 23:47 | 11M | |
![[VID]](/icons/movie.gif) | Active and Passive English Grammar.mp4 | 2015-08-06 00:52 | 10M | |
![[ ]](/icons/unknown.gif) | Say hello (step by step 1).pptx | 2020-05-27 02:36 | 9.9M | |
![[ ]](/icons/unknown.gif) | CLOTHING.pptx | 2019-02-09 16:42 | 9.8M | |
![[VID]](/icons/movie.gif) | THE KINKS - Lola (lyrics).flv | 2015-02-07 16:20 | 9.4M | |
![[ ]](/icons/unknown.gif) | HOBBIES.ppt | 2018-07-03 02:26 | 9.3M | |
![[VID]](/icons/movie.gif) | Aprende Ingles - el abecedario en Ingles - The Alphabet - En.mp4 | 2014-04-23 20:04 | 9.3M | |
![[ ]](/icons/unknown.gif) | OTHER FUTURE FORMS.pptx | 2024-05-14 02:51 | 8.4M | |
![[ ]](/icons/layout.gif) | B1_Grammar_book_Unit3.pdf | 2018-09-01 20:36 | 7.7M | |
![[ ]](/icons/layout.gif) | PICTURE DICTIONARY.pdf | 2015-09-23 02:53 | 7.6M | |
![[ ]](/icons/layout.gif) | OxfordPictureDictionary.pdf | 2018-09-28 02:48 | 7.5M | |
![[ ]](/icons/layout.gif) | grammar-goals-using-past-tense.pdf | 2018-07-13 01:00 | 7.5M | |
![[ ]](/icons/layout.gif) | prepositions of place (1).pdf | 2017-01-20 02:44 | 7.5M | |
![[ ]](/icons/layout.gif) | 400 WORDS TOEFL.pdf | 2017-01-21 02:36 | 7.4M | |
![[ ]](/icons/unknown.gif) | MOVIES.ppt | 2024-05-11 18:03 | 7.1M | |
![[ ]](/icons/layout.gif) | Simple Past Tense.pdf | 2014-03-05 01:38 | 6.8M | |
![[ ]](/icons/unknown.gif) | CELEBRATIONS.ppt | 2023-10-26 03:26 | 6.6M | |
![[ ]](/icons/compressed.gif) | Grammar_Elem_Unit6.zip | 2016-06-04 21:37 | 6.3M | |
![[ ]](/icons/compressed.gif) | Grammar_Elem_Unit6 (2).zip | 2016-12-10 02:06 | 6.3M | |
![[ ]](/icons/unknown.gif) | Prepositions-ESL-PowerPoint-Presentation.pptx | 2022-02-02 00:41 | 6.3M | |
![[ ]](/icons/unknown.gif) | X-TREME SPORTS.pptx | 2021-05-18 01:40 | 6.3M | |
![[ ]](/icons/unknown.gif) | Presentation-about a song.pptx | 2014-10-18 00:25 | 6.2M | |
![[VID]](/icons/movie.gif) | What a wonderful world - LOUIS ARMSTRONG..mp4 | 2014-10-14 06:25 | 5.9M | |
![[ ]](/icons/layout.gif) | in_context_1_su.pdf | 2019-04-27 20:26 | 5.9M | |
![[ ]](/icons/unknown.gif) | LEVEL 6 PHRASAL VERBS.docx | 2020-03-04 22:56 | 5.8M | |
![[ ]](/icons/layout.gif) | grex1_su3- SIMPLE PRESENT TENSE.pdf | 2018-04-14 01:43 | 5.7M | |
![[ ]](/icons/unknown.gif) | adjectives unit 8 (life2).docx | 2016-11-09 01:34 | 5.6M | |
![[ ]](/icons/unknown.gif) | 17 people who accomplished incredible things at a shockingly young age.docx | 2017-10-31 23:31 | 5.5M | |
![[IMG]](/icons/image2.gif) | 14644462635871186749410.jpg | 2016-05-28 14:38 | 5.5M | |
![[ ]](/icons/layout.gif) | Adverbs of Frequency.pdf | 2016-02-08 04:34 | 5.3M | |
![[ ]](/icons/unknown.gif) | PAST PERFECT 3 (2).ppt | 2023-03-22 02:58 | 5.3M | |
![[ ]](/icons/layout.gif) | grex2_su8COMPARATIVE AND SUPERLATIVE ADJECTIVES.pdf | 2018-04-14 22:54 | 5.2M | |
![[ ]](/icons/layout.gif) | grex2_su8.pdf | 2018-09-29 20:23 | 5.2M | |
![[ ]](/icons/layout.gif) | comparative and superlative adjective.pdf | 2018-05-05 18:00 | 5.2M | |
![[ ]](/icons/unknown.gif) | Comparatives and Superlatives.pptx | 2020-08-27 02:45 | 5.2M | |
![[ ]](/icons/layout.gif) | Intermediate Unit 3b.pdf | 2016-06-07 20:31 | 5.1M | |
![[ ]](/icons/compressed.gif) | Grammar_Elem_Unit5.zip | 2016-08-13 22:10 | 5.1M | |
![[ ]](/icons/compressed.gif) | Grammar_Elem_Unit5 (2).zip | 2016-08-20 22:47 | 5.1M | |
![[ ]](/icons/unknown.gif) | VOCABULARY2.pptx | 2023-12-07 02:56 | 5.0M | |
![[ ]](/icons/unknown.gif) | VOCABULARY2 (1).pptx | 2022-09-03 02:58 | 5.0M | |
![[ ]](/icons/layout.gif) | possessive-nouns-multiple-ws.pdf | 2020-01-18 00:41 | 4.9M | |
![[ ]](/icons/unknown.gif) | present continuous spelling rules chart.docx | 2014-08-22 05:47 | 4.7M | |
![[ ]](/icons/layout.gif) | CK3_GB_Unit3.pdf | 2018-11-03 21:05 | 4.7M | |
![[ ]](/icons/unknown.gif) | Means of transportation2 (1).pptx | 2023-07-21 02:54 | 4.7M | |
![[ ]](/icons/unknown.gif) | Physical_Description (1).ppt | 2024-04-27 17:10 | 4.7M | |
![[ ]](/icons/layout.gif) | grammar_dim_1_su.pdf | 2017-05-20 02:11 | 4.6M | |
![[ ]](/icons/unknown.gif) | Unit 10 VOCABULARY (2).pptx | 2023-12-16 03:06 | 4.6M | |
![[ ]](/icons/unknown.gif) | CELEBRATIONS (6).ppt | 2023-08-17 02:55 | 4.5M | |
![[ ]](/icons/unknown.gif) | Means of transportation2.pptx | 2023-02-08 02:19 | 4.5M | |
![[ ]](/icons/unknown.gif) | Unit 10 VOCABULARY.pptx | 2020-02-29 16:38 | 4.5M | |
![[ ]](/icons/layout.gif) | m02_lpd_wks_glb_5650_drt.pdf | 2014-02-19 00:28 | 4.5M | |
![[ ]](/icons/compressed.gif) | Grammar_Elem_Unit11.zip | 2016-06-11 22:32 | 4.4M | |
![[ ]](/icons/unknown.gif) | ARTS.pptx | 2024-05-07 17:04 | 4.4M | |
![[ ]](/icons/unknown.gif) | ARTS (1).pptx | 2022-10-20 03:01 | 4.4M | |
![[VID]](/icons/movie.gif) | Learn English Kitchen-Cooking Verbs.mp4 | 2015-07-25 14:18 | 4.4M | |
![[ ]](/icons/unknown.gif) | ECONOMY.ppt | 2023-12-12 02:55 | 4.3M | |
![[ ]](/icons/compressed.gif) | Grammar_Elem_Unit2.zip | 2016-07-16 21:23 | 4.3M | |
![[ ]](/icons/unknown.gif) | describing people.ppt | 2015-07-11 18:06 | 4.2M | |
![[ ]](/icons/unknown.gif) | describing people (1).ppt | 2016-04-30 18:22 | 4.2M | |
![[ ]](/icons/unknown.gif) | physical apperance.ppt | 2015-01-22 05:20 | 4.2M | |
![[ ]](/icons/unknown.gif) | CELEBRATIONS (2).ppt | 2023-03-03 02:53 | 4.2M | |
![[ ]](/icons/unknown.gif) | PLACES TO GO.ppt | 2019-05-20 20:55 | 4.2M | |
![[ ]](/icons/unknown.gif) | CLOTHING.ppt | 2023-07-29 17:28 | 4.2M | |
![[ ]](/icons/unknown.gif) | extreme_sports.ppt | 2023-10-26 02:58 | 4.1M | |
![[ ]](/icons/unknown.gif) | review verb to be.pptx | 2020-05-28 03:02 | 4.1M | |
![[ ]](/icons/unknown.gif) | UNIT 11 VOCABULARY.ppt | 2020-01-29 01:31 | 4.1M | |
![[ ]](/icons/unknown.gif) | Nationalities and Countries.ppt | 2018-08-16 02:03 | 4.0M | |
![[IMG]](/icons/image2.gif) | 20201130_090918.jpg | 2020-11-30 15:33 | 3.9M | |
![[ ]](/icons/unknown.gif) | future perfect.pps | 2019-04-12 00:51 | 3.9M | |
![[ ]](/icons/unknown.gif) | Vocabulary Unit 7.pptx | 2023-07-29 17:22 | 3.9M | |
![[ ]](/icons/unknown.gif) | Vocabulary Unit 7 (1).pptx | 2022-12-02 02:56 | 3.9M | |
![[ ]](/icons/unknown.gif) | vocabuly unit 7 elementary.docx | 2015-08-13 00:08 | 3.8M | |
![[ ]](/icons/unknown.gif) | parts of the body.docx | 2017-02-04 20:23 | 3.7M | |
![[ ]](/icons/unknown.gif) | UNIT 5 LESSON D..ppt | 2017-10-31 00:54 | 3.6M | |
![[ ]](/icons/layout.gif) | Prepositions-of-Place-Teacher-Copy.pdf | 2019-04-27 22:16 | 3.5M | |
![[ ]](/icons/unknown.gif) | PAST_PROGRESSIVE.ppt | 2024-05-07 16:45 | 3.5M | |
![[ ]](/icons/unknown.gif) | PAST_PROGRESSIVE (3).ppt | 2023-05-20 03:01 | 3.5M | |
![[ ]](/icons/unknown.gif) | HOUSE AND FURNITURE (1).ppt | 2018-04-14 18:00 | 3.5M | |
![[ ]](/icons/unknown.gif) | TECHNOLOGY..ppt | 2020-03-07 16:41 | 3.5M | |
![[ ]](/icons/unknown.gif) | UNIT 9 LESSON A.ppt | 2016-10-29 17:52 | 3.5M | |
![[ ]](/icons/unknown.gif) | USED TO.pptx | 2016-10-21 02:20 | 3.4M | |
![[ ]](/icons/unknown.gif) | PRESENTPERFECT1.ppt | 2024-02-06 02:55 | 3.4M | |
![[ ]](/icons/unknown.gif) | PRONUNCIATION RULES ED.ppt | 2021-06-12 03:03 | 3.4M | |
![[ ]](/icons/unknown.gif) | VOCABULARY (1).pptx | 2020-01-23 01:45 | 3.3M | |
![[ ]](/icons/unknown.gif) | Telling The Time.pptx | 2021-05-06 02:56 | 3.3M | |
![[ ]](/icons/unknown.gif) | MUSIC.ppt | 2024-05-07 17:14 | 3.3M | |
![[ ]](/icons/unknown.gif) | MUSIC (1).ppt | 2022-10-21 02:54 | 3.3M | |
![[ ]](/icons/unknown.gif) | Injuries.pptx | 2022-04-06 02:55 | 3.3M | |
![[ ]](/icons/unknown.gif) | FREE TIME ACTIVITIES2.pptx | 2020-02-06 02:07 | 3.3M | |
![[ ]](/icons/layout.gif) | in_context_2_su.pdf | 2018-02-24 01:48 | 3.3M | |
![[ ]](/icons/unknown.gif) | GERUNDS AND INFINITIVES.ppt | 2023-12-02 02:57 | 3.2M | |
![[ ]](/icons/unknown.gif) | GERUNDS.ppt | 2020-01-31 23:37 | 3.2M | |
![[ ]](/icons/unknown.gif) | Vocabulary Unit 10.pptx | 2018-01-18 00:27 | 3.2M | |
![[SND]](/icons/sound2.gif) | Return_River_Town_Pre-int-Int.mp3 | 2016-04-14 02:49 | 3.2M | |
![[ ]](/icons/unknown.gif) | CAR PARTS.pptx | 2018-02-23 00:54 | 3.2M | |
![[ ]](/icons/unknown.gif) | questions ppt.ppt | 2015-09-22 02:33 | 3.2M | |
![[ ]](/icons/unknown.gif) | FEELINGS AND PERSONAL STATES.pptx | 2024-01-26 02:56 | 3.2M | |
![[ ]](/icons/unknown.gif) | SUPERLATIVES. (1).ppt | 2023-02-09 02:50 | 3.2M | |
![[ ]](/icons/unknown.gif) | SUPERLATIVES. (2).ppt | 2022-12-06 02:58 | 3.2M | |
![[ ]](/icons/unknown.gif) | VOCABULARY unit 9.pptx | 2023-11-11 18:10 | 3.2M | |
![[ ]](/icons/unknown.gif) | VOCABULARY unit 9 (1).pptx | 2023-03-22 02:53 | 3.2M | |
![[ ]](/icons/unknown.gif) | COOKING_METHODS.pptx | 2018-07-17 02:09 | 3.1M | |
![[ ]](/icons/unknown.gif) | SUPERLATIVES. (3).ppt | 2023-01-28 18:07 | 3.1M | |
![[ ]](/icons/unknown.gif) | GERUNDS AND INFINITIVES (1).ppt | 2022-12-09 03:01 | 3.1M | |
![[ ]](/icons/unknown.gif) | Numbers GB 1. 2.ppt | 2015-02-19 02:19 | 3.1M | |
![[ ]](/icons/unknown.gif) | Numbers G 1. 2.ppt | 2014-10-02 02:44 | 3.1M | |
![[ ]](/icons/unknown.gif) | Numbers G 1. 2 PPP.ppt | 2015-08-03 22:47 | 3.1M | |
![[ ]](/icons/unknown.gif) | FEELINGS AND PERSONAL STATES (1).pptx | 2022-10-14 03:01 | 3.1M | |
![[ ]](/icons/unknown.gif) | Restaurants.pptx | 2024-03-02 03:18 | 3.1M | |
![[ ]](/icons/unknown.gif) | Restaurants (1).pptx | 2022-11-18 02:54 | 3.1M | |
![[ ]](/icons/unknown.gif) | SUPERLATIVES..ppt | 2024-04-14 03:47 | 3.1M | |
![[ ]](/icons/unknown.gif) | MATERIALS (1).ppt | 2019-03-01 00:14 | 3.1M | |
![[ ]](/icons/unknown.gif) | presentperfectrules-.ppt | 2016-05-05 02:57 | 3.1M | |
![[ ]](/icons/unknown.gif) | Impersonal Passive UP INTER 4.2.pptx | 2015-05-17 23:59 | 3.0M | |
![[ ]](/icons/unknown.gif) | FEELINGS2.ppt | 2017-02-28 01:50 | 3.0M | |
![[ ]](/icons/unknown.gif) | PLACES.ppt | 2021-04-21 03:03 | 3.0M | |
![[ ]](/icons/layout.gif) | CLOTHES VOCABULARY PICTIONARY AST.pdf | 2022-03-03 01:09 | 3.0M | |
![[ ]](/icons/unknown.gif) | TECHNOLOGY.ppt | 2018-06-09 18:03 | 2.9M | |
![[ ]](/icons/unknown.gif) | reported-speech-ppt.ppt | 2017-06-21 00:16 | 2.9M | |
![[ ]](/icons/layout.gif) | Modal Verbs.pdf | 2016-02-08 04:35 | 2.9M | |
![[ ]](/icons/unknown.gif) | CARS.pptx | 2020-01-28 01:58 | 2.9M | |
![[SND]](/icons/sound2.gif) | Wild Weather 2.mp3 | 2016-04-22 00:06 | 2.9M | |
![[ ]](/icons/unknown.gif) | FOOD TYPES.ppt | 2024-02-27 02:54 | 2.9M | |
![[ ]](/icons/compressed.gif) | Grammar_Elem_Unit1.zip | 2016-07-02 21:18 | 2.8M | |
![[ ]](/icons/layout.gif) | presentperfect.pdf | 2018-11-03 21:05 | 2.8M | |
![[ ]](/icons/layout.gif) | presentperfect (1).pdf | 2017-08-12 02:06 | 2.8M | |
![[ ]](/icons/unknown.gif) | DESCRIBING PEOPLE.pptx | 2019-10-30 02:25 | 2.8M | |
![[IMG]](/icons/image2.gif) | 20201130_091108.jpg | 2020-11-30 15:35 | 2.8M | |
![[ ]](/icons/unknown.gif) | VOCABULARY UNIT 8..pptx | 2017-06-01 00:55 | 2.8M | |
![[ ]](/icons/compressed.gif) | Beginner Unit 7.zip | 2019-01-19 02:23 | 2.8M | |
![[ ]](/icons/unknown.gif) | TECHNOLOGY. (1).ppt | 2022-04-07 02:56 | 2.8M | |
![[ ]](/icons/unknown.gif) | Comparative-Adjectives-PowerPoint-Lesson.pptx | 2021-08-11 01:55 | 2.8M | |
![[ ]](/icons/unknown.gif) | Verbs followed by -ing U.I. 9.4.pptx | 2015-06-25 14:43 | 2.8M | |
![[ ]](/icons/layout.gif) | Gerunds - ing forms.pdf | 2016-02-08 04:36 | 2.8M | |
![[ ]](/icons/unknown.gif) | UNIT 8 VOCABULARY 2.pptx | 2019-07-20 15:54 | 2.8M | |
![[ ]](/icons/unknown.gif) | UNIT 4 LESSON A.ppt | 2017-02-03 01:38 | 2.8M | |
![[ ]](/icons/unknown.gif) | Injuries (1).pptx | 2016-12-03 18:07 | 2.7M | |
![[IMG]](/icons/image2.gif) | 20201130_091311.jpg | 2020-11-30 15:35 | 2.7M | |
![[ ]](/icons/unknown.gif) | Superlative-Adjectives-PowerPoint-Lesson.pptx | 2021-08-11 01:56 | 2.7M | |
![[ ]](/icons/unknown.gif) | FREQUENCY ADVERBS NEW.docx | 2020-02-13 01:26 | 2.7M | |
![[IMG]](/icons/image2.gif) | 20201130_095503.jpg | 2020-11-30 16:41 | 2.7M | |
![[ ]](/icons/unknown.gif) | fruit.ppt | 2015-04-29 23:43 | 2.7M | |
![[IMG]](/icons/image2.gif) | 20201130_095450.jpg | 2020-11-30 16:40 | 2.7M | |
![[ ]](/icons/unknown.gif) | SYMPTOMS_AND_FEELINGS.ppt | 2019-06-06 02:08 | 2.7M | |
![[ ]](/icons/unknown.gif) | MATERIALS.ppt | 2023-08-05 02:56 | 2.7M | |
![[ ]](/icons/unknown.gif) | Who am I AST.pptx | 2022-03-04 02:45 | 2.7M | |
![[ ]](/icons/unknown.gif) | SPECULATING.NEW.ppt | 2024-03-07 02:58 | 2.7M | |
![[IMG]](/icons/image2.gif) | 20201130_095516.jpg | 2020-11-30 16:42 | 2.6M | |
![[ ]](/icons/unknown.gif) | UNIT 12 CAMPING.ppt | 2020-03-04 02:20 | 2.5M | |
![[ ]](/icons/unknown.gif) | PRONOUNS EXERCISE..docx | 2018-08-16 02:23 | 2.5M | |
![[ ]](/icons/unknown.gif) | Countable and uncountable nouns.pptx | 2022-02-17 02:12 | 2.5M | |
![[ ]](/icons/unknown.gif) | house2.ppt | 2015-05-19 02:55 | 2.5M | |
![[ ]](/icons/unknown.gif) | DEMONSTRATIVE PRONOUNS.pptx | 2021-05-05 02:33 | 2.5M | |
![[ ]](/icons/unknown.gif) | SPECULATING..ppt | 2019-07-20 15:53 | 2.4M | |
![[ ]](/icons/layout.gif) | AM IS ARE-.pdf | 2018-07-14 02:17 | 2.4M | |
![[ ]](/icons/unknown.gif) | UNIT 12 VOCABULARY.pptx | 2018-08-03 01:39 | 2.4M | |
![[ ]](/icons/layout.gif) | Upper Intermediate Unit 7b.pdf | 2016-08-10 20:09 | 2.4M | |
![[ ]](/icons/unknown.gif) | HOUSE AND FURNITURE.ppt | 2021-06-02 02:58 | 2.4M | |
![[ ]](/icons/unknown.gif) | people3.ppt | 2015-04-22 01:24 | 2.4M | |
![[ ]](/icons/unknown.gif) | extreme sports.ppt | 2023-01-31 02:51 | 2.4M | |
![[ ]](/icons/unknown.gif) | UNIT 8 VOCABULARY.ppt | 2020-02-01 17:59 | 2.4M | |
![[ ]](/icons/unknown.gif) | vegetables1.ppt | 2015-04-29 23:42 | 2.3M | |
![[ ]](/icons/unknown.gif) | ECONOMY 2.pptx | 2022-03-31 02:54 | 2.3M | |
![[ ]](/icons/unknown.gif) | Subject_and_Verb_Agreement_ppt.ppt | 2021-12-06 19:36 | 2.3M | |
![[ ]](/icons/unknown.gif) | CONDITIONALS 2 AND 3 SATURDAY 8-12.docx | 2014-11-27 00:12 | 2.3M | |
![[ ]](/icons/unknown.gif) | Quantifiers (2).ppt | 2023-02-23 02:36 | 2.3M | |
![[ ]](/icons/unknown.gif) | Quantifiers.ppt | 2023-12-13 02:56 | 2.3M | |
![[ ]](/icons/unknown.gif) | mixed conditionals exercises.docx | 2020-09-02 23:45 | 2.3M | |
![[ ]](/icons/unknown.gif) | Quantifiers (1).ppt | 2022-12-17 02:54 | 2.3M | |
![[ ]](/icons/unknown.gif) | narrativetenses.ppt | 2015-07-21 02:29 | 2.3M | |
![[ ]](/icons/unknown.gif) | NUMBERS AND COLORS.ppt | 2021-04-23 03:09 | 2.3M | |
![[ ]](/icons/unknown.gif) | PREPOSTIONS OF TIME.ppt | 2017-03-03 23:08 | 2.3M | |
![[ ]](/icons/unknown.gif) | level seven unit 1 test.docx | 2015-02-08 00:42 | 2.3M | |
![[ ]](/icons/unknown.gif) | Shrek.pptx | 2014-07-30 19:18 | 2.3M | |
![[ ]](/icons/unknown.gif) | countable-uncountable-nouns.ppt | 2019-02-13 01:29 | 2.2M | |
![[ ]](/icons/unknown.gif) | future presentation unit 1.pptx | 2014-04-11 00:59 | 2.2M | |
![[ ]](/icons/unknown.gif) | PRONUNCIATION RULES -ED.ppt | 2023-05-19 02:57 | 2.2M | |
![[ ]](/icons/unknown.gif) | future tenses level 5.pptx | 2014-04-11 01:45 | 2.2M | |
![[ ]](/icons/unknown.gif) | VOCABULARY UNIT 4.ppt | 2024-02-22 02:58 | 2.2M | |
![[ ]](/icons/unknown.gif) | countable-uncountable-nouns (1).ppt | 2015-08-04 02:26 | 2.2M | |
![[ ]](/icons/unknown.gif) | Containers.ppt | 2020-02-25 01:38 | 2.2M | |
![[ ]](/icons/unknown.gif) | ABC's.ppt | 2018-08-14 00:10 | 2.1M | |
![[ ]](/icons/unknown.gif) | stepbystep 2 class.pptx | 2020-05-27 02:58 | 2.1M | |
![[ ]](/icons/unknown.gif) | UNIT 6 LESSON A.ppt | 2018-10-03 02:30 | 2.1M | |
![[ ]](/icons/unknown.gif) | STAGES.pptx | 2023-08-12 02:57 | 2.1M | |
![[ ]](/icons/unknown.gif) | Travel Verbs.pptx | 2023-07-29 02:54 | 2.0M | |
![[ ]](/icons/unknown.gif) | WEEKEND ACTIVITIES.pptx | 2019-07-18 00:30 | 2.0M | |
![[ ]](/icons/unknown.gif) | QUESTIONS EXERCISE.docx | 2024-01-30 02:59 | 2.0M | |
![[ ]](/icons/layout.gif) | worksheets prepositions.pdf | 2017-08-16 02:10 | 2.0M | |
![[ ]](/icons/unknown.gif) | vocabulary unit 6.pptx | 2023-11-21 03:05 | 2.0M | |
![[ ]](/icons/unknown.gif) | vocabulary unit 6 (2).pptx | 2022-11-24 02:58 | 2.0M | |
![[ ]](/icons/unknown.gif) | vocabulary unit 6 (1).pptx | 2022-08-20 02:53 | 2.0M | |
![[ ]](/icons/unknown.gif) | UNIT 11.ppt | 2023-09-09 18:22 | 2.0M | |
![[ ]](/icons/unknown.gif) | classroom.ppt | 2015-04-22 01:29 | 2.0M | |
![[ ]](/icons/unknown.gif) | Conditionals,wishes practice 6 to 14 (3).docx | 2018-11-09 00:58 | 1.9M | |
![[ ]](/icons/unknown.gif) | verbs4.ppt | 2015-06-09 03:12 | 1.9M | |
![[ ]](/icons/layout.gif) | American Idioms- 1.pdf | 2017-11-03 04:20 | 1.9M | |
![[ ]](/icons/unknown.gif) | UNIT 6 VOCABULARY.pptx | 2019-03-08 01:01 | 1.9M | |
![[ ]](/icons/unknown.gif) | CAN EXERCISE.docx | 2020-02-18 02:19 | 1.9M | |
![[ ]](/icons/unknown.gif) | food.ppt | 2015-04-29 23:41 | 1.9M | |
![[ ]](/icons/unknown.gif) | verbs3.ppt | 2015-06-09 03:12 | 1.9M | |
![[ ]](/icons/unknown.gif) | PHYSICAL APPEARANCE VOCABULARY.docx | 2021-05-15 18:05 | 1.9M | |
![[ ]](/icons/unknown.gif) | MEASUREMENTS UNIT 12.ppt | 2019-12-06 01:15 | 1.9M | |
![[ ]](/icons/unknown.gif) | DAILY_ROUTINES.ppt | 2023-01-25 03:01 | 1.9M | |
![[ ]](/icons/unknown.gif) | DAILY_ROUTINES (1).ppt | 2024-01-23 02:53 | 1.8M | |
![[ ]](/icons/unknown.gif) | The Weather.pptx | 2021-05-22 02:54 | 1.8M | |
![[ ]](/icons/compressed.gif) | Grammar_Elem_Unit4.zip | 2016-11-12 20:46 | 1.8M | |
![[ ]](/icons/layout.gif) | Intermediate Unit 5b.pdf | 2016-06-07 20:41 | 1.8M | |
![[ ]](/icons/layout.gif) | Intermediate Unit 2a.pdf | 2016-06-07 20:22 | 1.8M | |
![[ ]](/icons/unknown.gif) | WHAT_S_THIS SINGULAR AND PLURALS.ppt | 2021-04-23 03:08 | 1.8M | |
![[ ]](/icons/unknown.gif) | Infinitives of Purpose.pptx | 2023-08-26 18:06 | 1.8M | |
![[ ]](/icons/unknown.gif) | Book 4-3.pps | 2018-04-24 22:58 | 1.8M | |
![[ ]](/icons/unknown.gif) | VERB TO BE NEGATIVE SENTENCES..docx | 2019-06-07 00:41 | 1.8M | |
![[ ]](/icons/layout.gif) | 08-stage_3_17_past_simple_affirm_neg_questions_short.pdf | 2014-05-07 00:30 | 1.8M | |
![[ ]](/icons/unknown.gif) | Containers Exercise.docx | 2020-02-25 01:39 | 1.8M | |
![[ ]](/icons/unknown.gif) | sports_go.ppt | 2015-05-25 17:01 | 1.8M | |
![[ ]](/icons/layout.gif) | Intermediate Unit 4a.pdf | 2016-06-07 20:34 | 1.8M | |
![[ ]](/icons/unknown.gif) | quantifiers.pptx | 2016-03-19 02:48 | 1.8M | |
![[ ]](/icons/unknown.gif) | quantifiers (1).pptx | 2015-08-04 02:18 | 1.8M | |
![[ ]](/icons/layout.gif) | Present-perfect-tense.pdf | 2019-07-08 23:39 | 1.7M | |
![[ ]](/icons/layout.gif) | test level 2.pdf | 2017-12-19 23:35 | 1.7M | |
![[ ]](/icons/layout.gif) | Life_Intermediate_Wordlist.pdf | 2016-06-07 20:51 | 1.7M | |
![[ ]](/icons/unknown.gif) | talk for a minute (1).ppt | 2019-03-02 17:33 | 1.7M | |
![[ ]](/icons/unknown.gif) | people2.ppt | 2015-04-22 01:24 | 1.7M | |
![[ ]](/icons/unknown.gif) | PRESENT PROGRESSIVE EXERCISE 1.docx | 2023-07-13 02:56 | 1.7M | |
![[ ]](/icons/layout.gif) | personal care products vocabulary AST.pdf | 2022-02-03 00:18 | 1.7M | |
![[ ]](/icons/layout.gif) | EnglishAcademyGuiadeUsoMyELT (1) (1).pdf | 2016-07-14 19:17 | 1.6M | |
![[ ]](/icons/unknown.gif) | When, as soon as, unless,.pptx | 2018-10-10 00:59 | 1.6M | |
![[ ]](/icons/unknown.gif) | Professions Exercise.docx | 2022-08-04 02:58 | 1.6M | |
![[ ]](/icons/unknown.gif) | kitchen2.ppt | 2015-10-30 02:03 | 1.6M | |
![[ ]](/icons/unknown.gif) | UNIT 3 - BOOK 2 GRAMMAR.docx | 2021-05-15 18:02 | 1.6M | |
![[ ]](/icons/unknown.gif) | ADJECTIVES.pptx | 2021-04-28 02:59 | 1.6M | |
![[ ]](/icons/unknown.gif) | ACTIVITIES.pptx | 2019-06-04 01:44 | 1.6M | |
![[ ]](/icons/unknown.gif) | WHAT_S_THIS (2).ppt | 2020-01-23 02:28 | 1.6M | |
![[ ]](/icons/unknown.gif) | FIRST CONDITIONAL EXERCISE 3.docx | 2022-11-17 02:59 | 1.6M | |
![[ ]](/icons/unknown.gif) | COMPARATIVE AND SUPERLATIVE new2.docx | 2020-01-18 15:16 | 1.6M | |
![[ ]](/icons/unknown.gif) | CONDITIONALS.ppt | 2023-12-16 18:17 | 1.6M | |
![[ ]](/icons/unknown.gif) | Used to Exercise 2.docx | 2023-12-02 18:10 | 1.6M | |
![[ ]](/icons/unknown.gif) | will-going to (1).ppt | 2024-05-11 18:06 | 1.6M | |
![[ ]](/icons/unknown.gif) | will-going to (1) (1).ppt | 2023-03-03 02:55 | 1.6M | |
![[ ]](/icons/unknown.gif) | UNIT 4 LESSON B.ppt | 2018-03-09 15:33 | 1.6M | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT EXERCISE 2.docx | 2024-01-27 18:08 | 1.6M | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT EXERCISE 2 (1).docx | 2022-10-22 03:06 | 1.6M | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT EXERCISE 2 (2).docx | 2023-03-09 02:11 | 1.6M | |
![[ ]](/icons/unknown.gif) | Like and Don’t Like.pptx | 2019-10-19 15:40 | 1.6M | |
![[ ]](/icons/layout.gif) | Wishes and regrets(1).pdf | 2015-02-20 05:20 | 1.6M | |
![[ ]](/icons/unknown.gif) | preposition of place AA 2017.pps | 2017-02-11 15:42 | 1.6M | |
![[ ]](/icons/unknown.gif) | Auxiliary Verbs Up. Inter. 1.1.pptx | 2015-04-21 01:34 | 1.5M | |
![[ ]](/icons/unknown.gif) | classroom2.ppt | 2015-04-22 01:31 | 1.5M | |
![[ ]](/icons/unknown.gif) | MEANS_OF_TRANSPORTATION.ppt | 2018-11-07 01:59 | 1.5M | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT PROGRESSIVE.pptx | 2018-09-28 01:17 | 1.5M | |
![[ ]](/icons/unknown.gif) | MY CHILHOOD MEMORIES USED TO NEW.ppt | 2022-06-17 03:53 | 1.5M | |
![[ ]](/icons/unknown.gif) | Unit 6 book 2.docx | 2021-06-05 16:33 | 1.5M | |
![[ ]](/icons/unknown.gif) | GOING TO EXERCISE.docx | 2019-11-06 00:22 | 1.5M | |
![[ ]](/icons/unknown.gif) | PASSIVE VOICE EXTENDED EXERCISE.docx | 2022-09-09 03:28 | 1.5M | |
![[ ]](/icons/unknown.gif) | UNIT 8 book 3 grammar.docx | 2021-05-29 17:20 | 1.5M | |
![[ ]](/icons/unknown.gif) | PAST PROGRESSIVE EX.docx | 2023-10-27 02:15 | 1.5M | |
![[ ]](/icons/unknown.gif) | preposition of place.pptx | 2016-07-30 18:01 | 1.5M | |
![[ ]](/icons/unknown.gif) | Possessives.ppt | 2018-02-01 17:38 | 1.5M | |
![[ ]](/icons/unknown.gif) | sports_do.ppt | 2015-05-25 16:59 | 1.5M | |
![[ ]](/icons/unknown.gif) | Future Continuous.ppt | 2015-07-07 03:08 | 1.5M | |
![[ ]](/icons/unknown.gif) | USED TO.ppt | 2023-12-02 18:09 | 1.5M | |
![[ ]](/icons/unknown.gif) | FREQUENCY_ADVERBS_2.ppt | 2023-07-12 02:57 | 1.5M | |
![[ ]](/icons/unknown.gif) | PRESENT PROGRESSIVE REVIEW.docx | 2021-06-22 19:44 | 1.5M | |
![[ ]](/icons/layout.gif) | Advanced Unit 03b(1).pdf | 2016-08-10 20:04 | 1.5M | |
![[ ]](/icons/unknown.gif) | Saturday, May 2nd, 2020 (unit 8 book 2).pptx | 2020-05-05 20:52 | 1.5M | |
![[ ]](/icons/unknown.gif) | VOCABULARY.pptx | 2023-12-16 16:18 | 1.5M | |
![[ ]](/icons/unknown.gif) | TV_SHOWS.ppt | 2024-05-18 18:00 | 1.4M | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT EXERCISE 3.docx | 2023-10-21 02:56 | 1.4M | |
![[ ]](/icons/unknown.gif) | unit 6 book 3 grammar.docx | 2023-06-17 01:35 | 1.4M | |
![[ ]](/icons/unknown.gif) | SIMPLE_PRESENT 2 (1).ppt | 2022-01-26 03:04 | 1.4M | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST EXERCISE 3.docx | 2023-02-16 04:10 | 1.4M | |
![[ ]](/icons/unknown.gif) | sports_go1.ppt | 2015-05-25 17:02 | 1.4M | |
![[ ]](/icons/unknown.gif) | comparatives and superlatives.docx | 2014-08-28 02:05 | 1.4M | |
![[ ]](/icons/layout.gif) | playgodo.pdf | 2017-05-20 02:10 | 1.4M | |
![[ ]](/icons/unknown.gif) | WHEN & WHILE EXERCISE..docx | 2019-02-20 02:31 | 1.4M | |
![[ ]](/icons/layout.gif) | Intermediate Unit 4b.pdf | 2016-06-07 20:35 | 1.4M | |
![[ ]](/icons/unknown.gif) | FREE TIME AND HOBBIES.docx | 2020-02-11 00:36 | 1.4M | |
![[ ]](/icons/unknown.gif) | VACATIONS -ING -ED ADJECTIVES (1).pptx | 2023-03-24 02:54 | 1.4M | |
![[ ]](/icons/unknown.gif) | VACATIONS -ING -ED ADJECTIVES.pptx | 2024-02-24 18:05 | 1.4M | |
![[ ]](/icons/unknown.gif) | SUBJECT PRONOUNS.ppt | 2018-08-15 23:53 | 1.4M | |
![[ ]](/icons/unknown.gif) | ACCESSORIES.ppt | 2018-05-24 23:26 | 1.4M | |
![[ ]](/icons/unknown.gif) | Conditionals,wishes practice 6 to 14.docx | 2019-05-06 16:52 | 1.4M | |
![[ ]](/icons/unknown.gif) | INDEFINITE_PRONOUNS.ppt | 2023-09-23 20:04 | 1.4M | |
![[ ]](/icons/unknown.gif) | SPECULATIONS IN PRESENT EXERCISE 1.docx | 2019-07-20 16:50 | 1.4M | |
![[ ]](/icons/layout.gif) | Gabriel_Garcia_Marquez-Chronicle_of_a_Death_Foretold.pdf | 2014-04-11 00:27 | 1.3M | |
![[ ]](/icons/unknown.gif) | Unit 8 book 4.docx | 2021-08-25 00:41 | 1.3M | |
![[ ]](/icons/layout.gif) | Intermediate Unit 2b.pdf | 2016-06-07 20:25 | 1.3M | |
![[ ]](/icons/layout.gif) | Advanced Unit 05b.pdf | 2016-09-06 02:44 | 1.3M | |
![[ ]](/icons/layout.gif) | present perfect exercises.pdf | 2020-01-22 00:23 | 1.3M | |
![[ ]](/icons/layout.gif) | present perfect exercise.pdf | 2018-02-17 02:11 | 1.3M | |
![[ ]](/icons/unknown.gif) | going to.ppt | 2019-11-06 00:21 | 1.3M | |
![[ ]](/icons/unknown.gif) | COMPARATIVES EXERCISE NEW.docx | 2019-01-12 17:34 | 1.3M | |
![[ ]](/icons/layout.gif) | Intermediate Unit 3a.pdf | 2016-06-07 20:29 | 1.3M | |
![[ ]](/icons/layout.gif) | Connectors and useful expressions.pdf | 2017-02-28 01:33 | 1.3M | |
![[ ]](/icons/unknown.gif) | SIMPLEPAST (1).ppt | 2024-02-07 16:08 | 1.3M | |
![[ ]](/icons/unknown.gif) | Physical_Description (1) (1).ppt | 2023-02-18 18:06 | 1.3M | |
![[ ]](/icons/layout.gif) | GRB_Unit_18 PRESENT PERFECT VS SIMPLE PAST.pdf | 2017-08-12 02:03 | 1.3M | |
![[ ]](/icons/layout.gif) | GRB_Unit_18.pdf | 2018-02-24 00:28 | 1.3M | |
![[ ]](/icons/layout.gif) | Elementary Unit 3a.pdf | 2016-07-30 22:58 | 1.3M | |
![[ ]](/icons/unknown.gif) | people1.ppt | 2015-04-22 01:23 | 1.3M | |
![[ ]](/icons/unknown.gif) | There is There are 3.docx | 2021-06-03 03:05 | 1.3M | |
![[ ]](/icons/unknown.gif) | HOMEWORK ABOUT WASHING MACHINES.docx | 2020-09-12 22:09 | 1.3M | |
![[ ]](/icons/unknown.gif) | Regular Nouns GB 1.1.pptx | 2015-03-18 00:25 | 1.3M | |
![[ ]](/icons/unknown.gif) | kitchen3.ppt | 2015-10-30 02:04 | 1.3M | |
![[ ]](/icons/layout.gif) | Intermediate Unit 6a.pdf | 2016-06-07 20:43 | 1.3M | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT PROGRESSIVE EXERCISE 2.docx | 2021-11-23 02:19 | 1.2M | |
![[ ]](/icons/unknown.gif) | COMPARATIVES.ppt | 2021-04-27 17:01 | 1.2M | |
![[ ]](/icons/unknown.gif) | house1.ppt | 2015-05-19 02:54 | 1.2M | |
![[ ]](/icons/unknown.gif) | PREPOSITIONS_OF_PLACE.ppt | 2024-01-27 18:12 | 1.2M | |
![[ ]](/icons/unknown.gif) | FOOD TYPES 2.docx | 2017-02-08 01:46 | 1.2M | |
![[ ]](/icons/unknown.gif) | verbs5.ppt | 2015-06-09 03:13 | 1.2M | |
![[ ]](/icons/unknown.gif) | Unit 8 Assessment.docx | 2023-07-22 01:52 | 1.2M | |
![[ ]](/icons/unknown.gif) | Unit 8 Assessment (1).docx | 2022-02-10 21:20 | 1.2M | |
![[ ]](/icons/unknown.gif) | Past Modals.ppt | 2017-07-28 00:07 | 1.2M | |
![[ ]](/icons/unknown.gif) | Furniture Exercise 1.docx | 2020-01-21 01:42 | 1.2M | |
![[ ]](/icons/unknown.gif) | POSSESSIVE NOUNS.ppt | 2021-04-29 02:59 | 1.2M | |
![[ ]](/icons/unknown.gif) | List of gerunds and infinitives.docx | 2020-01-24 00:45 | 1.2M | |
![[ ]](/icons/unknown.gif) | DAVID AND MONA..pptx | 2017-09-02 18:04 | 1.2M | |
![[ ]](/icons/unknown.gif) | THERE IS THERE ARE EXERCISE 1.docx | 2019-04-05 01:31 | 1.2M | |
![[ ]](/icons/unknown.gif) | CAN CAN'T.pptx | 2021-05-08 03:07 | 1.2M | |
![[ ]](/icons/unknown.gif) | UNIT 5 grammar book 3.docx | 2021-08-28 16:33 | 1.2M | |
![[ ]](/icons/layout.gif) | AST L-2 UNIT 6, ASSIGNMENT SCHEDULE, LIFE 1, JAN-FEB, 2021.pdf | 2022-01-28 16:20 | 1.2M | |
![[ ]](/icons/unknown.gif) | SINGULAR AND PLURAL.docx | 2020-01-23 02:32 | 1.2M | |
![[ ]](/icons/unknown.gif) | verbs2.ppt | 2015-06-09 03:11 | 1.1M | |
![[ ]](/icons/unknown.gif) | _was and were practice.ppt | 2016-01-27 01:16 | 1.1M | |
![[ ]](/icons/unknown.gif) | IN ON AT.ppt | 2018-12-03 04:28 | 1.1M | |
![[ ]](/icons/unknown.gif) | should or should't exercise 3.docx | 2019-11-27 00:32 | 1.1M | |
![[ ]](/icons/unknown.gif) | SHOULD SHOULDN'T EXERCISE.docx | 2024-02-28 03:02 | 1.1M | |
![[ ]](/icons/unknown.gif) | SHOULD SHOULDN'T EXERCISE (1).docx | 2023-02-01 02:43 | 1.1M | |
![[ ]](/icons/unknown.gif) | UNIT 10 grammar book 3.docx | 2021-06-10 01:37 | 1.1M | |
![[ ]](/icons/unknown.gif) | SPECULATION IN PAST EXERCISE 2.docx | 2019-07-20 17:43 | 1.1M | |
![[ ]](/icons/unknown.gif) | verbs1.ppt | 2015-06-09 03:11 | 1.1M | |
![[ ]](/icons/unknown.gif) | Used to, Would and Simple Past UI 5.3.pptx | 2015-05-25 03:28 | 1.1M | |
![[ ]](/icons/layout.gif) | Advanced Unit 04a(1).pdf | 2016-08-10 20:20 | 1.1M | |
![[ ]](/icons/unknown.gif) | EXERCISE CAN & CAN'T.docx | 2018-09-20 01:53 | 1.1M | |
![[ ]](/icons/layout.gif) | Advanced Unit 02a.pdf | 2016-08-10 20:00 | 1.1M | |
![[ ]](/icons/unknown.gif) | EMOTICONS.pptx | 2016-08-25 00:28 | 1.1M | |
![[ ]](/icons/unknown.gif) | Present perfect new.docx | 2019-11-15 01:37 | 1.1M | |
![[IMG]](/icons/image2.gif) | Monsters Inc.jpg | 2018-07-21 16:24 | 1.1M | |
![[ ]](/icons/unknown.gif) | health_have.ppt | 2016-02-08 04:39 | 1.1M | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT EXERCISE 4.docx | 2023-07-12 03:08 | 1.1M | |
![[ ]](/icons/unknown.gif) | phrasal-verbs1 (1).ppt | 2017-06-20 01:05 | 1.1M | |
![[ ]](/icons/unknown.gif) | The-Past-Perfect-Tense.ppt | 2019-09-06 23:21 | 1.1M | |
![[ ]](/icons/unknown.gif) | USED TO EXERCISE 1.docx | 2020-01-17 23:43 | 1.1M | |
![[ ]](/icons/layout.gif) | Intermediate Unit 5a.pdf | 2016-06-07 20:36 | 1.1M | |
![[ ]](/icons/layout.gif) | cooking verbs vocabulary AST.pdf | 2022-02-18 01:11 | 1.1M | |
![[ ]](/icons/unknown.gif) | Unit 1 - book 2.docx | 2021-04-17 17:55 | 1.1M | |
![[ ]](/icons/unknown.gif) | SIMPLEPAST.ppt | 2023-02-16 21:41 | 1.1M | |
![[ ]](/icons/unknown.gif) | IN ON AT PREPOSITIONS OF TIME.ppt | 2019-06-13 00:37 | 1.1M | |
![[ ]](/icons/unknown.gif) | thereis-thereare.pptx | 2014-05-24 15:57 | 1.1M | |
![[ ]](/icons/layout.gif) | Intermediate Unit 6b.pdf | 2016-06-07 20:46 | 1.1M | |
![[ ]](/icons/unknown.gif) | STATIVE VERBS.ppt | 2024-01-25 02:53 | 1.1M | |
![[ ]](/icons/unknown.gif) | PRESENT_PROGRESSIVE_OR_CONTINUOUS (2).ppt | 2024-01-25 02:51 | 1.1M | |
![[ ]](/icons/unknown.gif) | PAST PERFECT EXERCISE 2.docx | 2024-02-17 02:55 | 1.1M | |
![[ ]](/icons/layout.gif) | Advanced Unit 05a.pdf | 2016-09-06 02:42 | 1.1M | |
![[ ]](/icons/layout.gif) | SIMPLE PRESENT VS. PRESENT CONTINUOUS.pdf | 2017-07-29 22:22 | 1.1M | |
![[ ]](/icons/layout.gif) | HAVE-HAS TO AST.pdf | 2021-12-14 00:09 | 1.0M | |
![[ ]](/icons/unknown.gif) | AT THE HOSPITAL.docx | 2023-04-29 02:53 | 1.0M | |
![[ ]](/icons/layout.gif) | juv 2.pdf | 2017-12-16 02:11 | 1.0M | |
![[ ]](/icons/unknown.gif) | health_feel.ppt | 2016-02-08 04:38 | 1.0M | |
![[ ]](/icons/unknown.gif) | VERBT TO BE PRACTICE.docx | 2019-01-15 02:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | VERB TO BE PRACTICE (2).docx | 2020-01-16 02:15 | 1.0M | |
![[ ]](/icons/layout.gif) | Call Me Maybe AST.pdf | 2021-08-04 00:47 | 1.0M | |
![[ ]](/icons/layout.gif) | olg_ele_dwnlds_pv.pdf | 2018-09-01 02:26 | 1.0M | |
![[ ]](/icons/unknown.gif) | SIMPLE_PAST_VERB_TO_BE.ppt | 2021-06-05 02:52 | 1.0M | |
![[ ]](/icons/unknown.gif) | professions and occupations exercise.docx | 2021-07-28 14:54 | 1.0M | |
![[ ]](/icons/unknown.gif) | Unit 9 saturday book 2.pptx | 2020-05-19 19:34 | 1.0M | |
![[ ]](/icons/unknown.gif) | Pictionary (irregular verbs).docx | 2020-07-06 21:49 | 1.0M | |
![[ ]](/icons/layout.gif) | Advanced Unit 01a(1).pdf | 2016-07-04 20:08 | 1.0M | |
![[ ]](/icons/unknown.gif) | PAST PERFECT EXS.pptx | 2024-02-16 18:01 | 1.0M | |
![[ ]](/icons/unknown.gif) | CONNECTORS.docx | 2022-05-17 02:58 | 1.0M | |
![[ ]](/icons/unknown.gif) | Unit 5 (grammar book 2) sat..docx | 2020-03-12 00:14 | 1.0M | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT WORKSHEET.docx | 2020-02-04 01:17 | 1.0M | |
![[ ]](/icons/unknown.gif) | All about me.pptx | 2024-01-20 16:15 | 1.0M | |
![[ ]](/icons/layout.gif) | DescribingPeople AST.pdf | 2022-02-28 19:38 | 1.0M | |
![[ ]](/icons/unknown.gif) | UNIT 11 LESSON A.ppt | 2017-10-14 17:10 | 1.0M | |
![[ ]](/icons/unknown.gif) | UNIT 8 LESSON A.ppt | 2017-11-15 00:00 | 1.0M | |
![[ ]](/icons/layout.gif) | Advanced Unit 03a.pdf | 2016-08-10 20:03 | 1.0M | |
![[ ]](/icons/unknown.gif) | UNIT 5 LESSON C Corrected.pptx | 2021-05-12 02:56 | 1.0M | |
![[ ]](/icons/unknown.gif) | QUESTIONS SIMPLE PAST EXERCISE 3.docx | 2017-03-22 01:09 | 1.0M | |
![[ ]](/icons/unknown.gif) | PROFESSIONS AND OCCUPATIONS EXERCISE 3.docx | 2024-02-22 03:02 | 1.0M | |
![[ ]](/icons/unknown.gif) | sports_play.ppt | 2015-05-25 17:04 | 1.0M | |
![[ ]](/icons/unknown.gif) | present-simple-.ppt | 2014-07-26 15:33 | 1.0M | |
![[ ]](/icons/unknown.gif) | adjectives1.ppt | 2015-04-22 01:26 | 1.0M | |
![[ ]](/icons/layout.gif) | AdvOFREQUENCY.pdf | 2019-02-16 19:23 | 1.0M | |
![[ ]](/icons/layout.gif) | Adv.pdf | 2019-08-10 02:43 | 1.0M | |
![[ ]](/icons/layout.gif) | FoodQuantities.pdf | 2019-02-28 00:48 | 1.0M | |
![[ ]](/icons/unknown.gif) | COMPARATIVES AND SUPERLATIVES EXERCISE 3.docx | 2023-02-07 18:10 | 1.0M | |
![[ ]](/icons/unknown.gif) | COMPARATIVES AND SUPERLATIVES EXERCISE 4.docx | 2023-11-30 03:01 | 1.0M | |
![[ ]](/icons/unknown.gif) | SPECULATING IN PAST.docx | 2022-08-19 03:02 | 1.0M | |
![[ ]](/icons/layout.gif) | Homework March 29.pdf | 2022-03-28 13:40 | 1.0M | |
![[ ]](/icons/unknown.gif) | HOBBIES.pptx | 2021-05-21 02:54 | 1.0M | |
![[ ]](/icons/layout.gif) | LifeGramResources_36_L2.pdf | 2017-12-04 23:14 | 1.0M | |
![[ ]](/icons/layout.gif) | Intermediate Unit 1a.pdf | 2016-06-07 20:19 | 1.0M | |
![[ ]](/icons/layout.gif) | Reporting Verbs 7.4.pdf | 2015-06-08 01:02 | 1.0M | |
![[ ]](/icons/unknown.gif) | Regular Verbs (-ed ) Past.doc | 2017-03-17 01:50 | 1.0M | |
![[ ]](/icons/layout.gif) | DEMONSTRATIVE ADJECTIVES.pdf | 2018-07-28 02:20 | 972K | |
![[ ]](/icons/unknown.gif) | Human body Illustrated Vocabulary.docx | 2015-04-11 00:15 | 972K | |
![[ ]](/icons/unknown.gif) | Professions_and_occupations.ppt | 2022-11-05 02:59 | 967K | |
![[ ]](/icons/unknown.gif) | COMPARATIVES AND SUPERLATIVES EXERCISES..docx | 2017-01-26 06:34 | 966K | |
![[ ]](/icons/layout.gif) | Change sentences to Information Questions..pdf | 2020-01-18 16:55 | 963K | |
![[ ]](/icons/layout.gif) | Advanced Unit 03b(2).pdf | 2016-08-10 20:05 | 961K | |
![[ ]](/icons/unknown.gif) | power point past simple (1).ppt | 2016-10-04 00:44 | 958K | |
![[ ]](/icons/unknown.gif) | Body PPP (1).pptx | 2023-02-18 18:07 | 956K | |
![[ ]](/icons/unknown.gif) | SYMPTOMS_AND_ENJURIES.ppt | 2023-07-15 02:55 | 955K | |
![[ ]](/icons/unknown.gif) | PASSIVE EXERCISE 2.docx | 2023-12-12 02:54 | 952K | |
![[ ]](/icons/unknown.gif) | PASSIVE EXERCISE 2 (1).docx | 2022-12-16 02:51 | 952K | |
![[ ]](/icons/unknown.gif) | SIMPLEPAST GRAMMAR.ppt | 2018-11-21 01:24 | 951K | |
![[ ]](/icons/layout.gif) | Advanced Unit 01a(2).pdf | 2016-07-04 20:10 | 950K | |
![[ ]](/icons/unknown.gif) | Body PPP.pptx | 2023-08-05 18:11 | 949K | |
![[ ]](/icons/unknown.gif) | THE BODY.pptx | 2018-05-24 23:13 | 949K | |
![[ ]](/icons/layout.gif) | EXPLANATION ADVERBS OF FREQUENCY.pdf | 2015-09-26 00:22 | 944K | |
![[ ]](/icons/layout.gif) | Advanced Unit 04a(2).pdf | 2016-08-10 20:21 | 944K | |
![[ ]](/icons/layout.gif) | Advanced Unit 01b.pdf | 2016-07-04 20:11 | 936K | |
![[ ]](/icons/unknown.gif) | SIMPLEPAST (1) (3).ppt | 2023-05-18 02:14 | 933K | |
![[ ]](/icons/unknown.gif) | perfect modals crime.pptx | 2018-05-05 21:29 | 932K | |
![[ ]](/icons/unknown.gif) | UUEG_Chapter09-10_Modals.pps | 2017-03-14 00:35 | 931K | |
![[ ]](/icons/unknown.gif) | UUEG_Chapter09-10_Modals (4).pps | 2017-05-30 02:29 | 931K | |
![[ ]](/icons/layout.gif) | Advanced Unit 02b.pdf | 2016-08-10 20:01 | 926K | |
![[ ]](/icons/layout.gif) | Advanced Unit 03b(3).pdf | 2016-08-10 20:07 | 926K | |
![[ ]](/icons/layout.gif) | AST L-2 UNIT 7, ASSIGNMENT SCHEDULE, LIFE 1, JAN-FEB, 2021.pdf | 2022-02-10 00:22 | 919K | |
![[ ]](/icons/unknown.gif) | ADJECTIVES LEVEL 1.docx | 2017-04-29 18:23 | 918K | |
![[ ]](/icons/unknown.gif) | GERUNDS AND INFINITIVES EXERCISE.docx | 2022-03-20 00:47 | 918K | |
![[ ]](/icons/unknown.gif) | UNIT 8 LESSON A LIFE.ppt | 2016-10-25 02:19 | 917K | |
![[ ]](/icons/layout.gif) | LifeGramResources_19_L1-2past tense.pdf | 2017-12-04 23:45 | 916K | |
![[ ]](/icons/unknown.gif) | First Conditional Exercise.docx | 2024-02-10 18:02 | 915K | |
![[ ]](/icons/unknown.gif) | Past Tense and Past Continuous Verbs.ppt | 2014-10-03 23:55 | 915K | |
![[ ]](/icons/unknown.gif) | Professions_and_occupations (3).ppt | 2024-02-21 02:53 | 914K | |
![[ ]](/icons/unknown.gif) | all future tenses.ppt | 2018-11-30 02:31 | 911K | |
![[ ]](/icons/unknown.gif) | EXERCISES STATIVE AND DYNAMIC VERBS (2).pptx | 2022-10-15 02:59 | 909K | |
![[ ]](/icons/unknown.gif) | Unit 11 grammar book 3.docx | 2021-06-17 00:50 | 907K | |
![[ ]](/icons/unknown.gif) | USED TO (2).ppt | 2023-03-31 03:37 | 906K | |
![[ ]](/icons/layout.gif) | LifeGramResources_06_L1 fun2.pdf | 2017-12-04 23:36 | 904K | |
![[ ]](/icons/unknown.gif) | Simple present unit 7 book 1.docx | 2020-07-13 20:10 | 903K | |
![[ ]](/icons/unknown.gif) | POSSESSIVE EX 3.docx | 2021-04-28 03:00 | 896K | |
![[ ]](/icons/unknown.gif) | verb to be exercise.docx | 2021-06-04 03:01 | 885K | |
![[ ]](/icons/layout.gif) | practice present simple.pdf | 2018-02-03 14:31 | 883K | |
![[ ]](/icons/layout.gif) | LifeGramResources_14_L1-2 present simple.pdf | 2017-12-04 23:57 | 883K | |
![[ ]](/icons/layout.gif) | LifeGramResources_14_L1-2present act.pdf | 2017-12-05 00:33 | 883K | |
![[ ]](/icons/unknown.gif) | PASSIVE_VOICE_2.ppt | 2015-01-17 15:56 | 881K | |
![[ ]](/icons/unknown.gif) | PASSIVE_VOICE 2.ppt | 2024-03-09 18:01 | 881K | |
![[ ]](/icons/unknown.gif) | PASSIVE_VOICE 2 (3).ppt | 2023-03-28 02:54 | 881K | |
![[ ]](/icons/unknown.gif) | PASSIVE_VOICE 2 (2).ppt | 2022-12-15 02:54 | 881K | |
![[ ]](/icons/unknown.gif) | FUTURE EXERCISE.docx | 2019-09-26 02:02 | 879K | |
![[ ]](/icons/unknown.gif) | FLAGS.ppt | 2018-02-23 01:42 | 877K | |
![[ ]](/icons/unknown.gif) | COUNTRIES AND NATIONALITIES..ppt | 2017-01-17 02:23 | 877K | |
![[ ]](/icons/unknown.gif) | POSSESSIVE NOUNS EXERCISE 2.docx | 2021-04-29 03:05 | 871K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST EXERCISE 2.docx | 2020-03-04 00:33 | 871K | |
![[ ]](/icons/layout.gif) | present-continuous-exercises.pdf | 2018-10-13 20:55 | 870K | |
![[ ]](/icons/unknown.gif) | Professions and occupations.ppt | 2018-08-14 01:16 | 863K | |
![[ ]](/icons/layout.gif) | countries and nationalities vocabulary esl word search puzzle worksheet for kids.pdf | 2019-04-27 22:17 | 857K | |
![[ ]](/icons/layout.gif) | LifeGramResources_17_L1-2 was were.pdf | 2017-12-04 23:42 | 857K | |
![[ ]](/icons/layout.gif) | LifeGramResources_17_L1-2.pdf | 2017-12-04 22:08 | 857K | |
![[ ]](/icons/unknown.gif) | THE.ppt | 2016-09-29 01:43 | 857K | |
![[ ]](/icons/unknown.gif) | SIMPLE_PRESENT (1).ppt | 2024-01-24 03:08 | 855K | |
![[ ]](/icons/unknown.gif) | -ED AND -ING ADJECTIVES EXERCISE.docx | 2024-02-24 18:07 | 844K | |
![[ ]](/icons/unknown.gif) | -ED AND -ING ADJECTIVES EXERCISE (1).docx | 2023-03-23 02:03 | 844K | |
![[ ]](/icons/unknown.gif) | LIKE.ppt | 2021-05-15 02:12 | 843K | |
![[ ]](/icons/unknown.gif) | types-of-the-films.doc | 2023-08-19 18:10 | 840K | |
![[ ]](/icons/unknown.gif) | PASSIVE VOICE.ppt | 2017-08-12 15:07 | 840K | |
![[ ]](/icons/unknown.gif) | GRAMMAR UNIT 11 BOOK 4.docx | 2020-03-13 00:50 | 836K | |
![[ ]](/icons/unknown.gif) | REPORTED SPEECH (book 4, grammar unit 11).docx | 2019-12-11 01:04 | 836K | |
![[ ]](/icons/unknown.gif) | SHOULD SHOULDN'T.ppt | 2024-02-28 03:02 | 836K | |
![[ ]](/icons/unknown.gif) | SIMPLE_PRESENT.ppt | 2023-07-12 02:56 | 834K | |
![[ ]](/icons/unknown.gif) | SECOND CONDITIONAL EX 2.docx | 2022-09-20 02:55 | 833K | |
![[ ]](/icons/unknown.gif) | SIMPLE_PRESENT 2.ppt | 2023-02-11 17:23 | 831K | |
![[ ]](/icons/unknown.gif) | UNIT 8 VOCABULARY (1).pptx | 2023-03-16 03:28 | 830K | |
![[ ]](/icons/unknown.gif) | UNIT 8 VOCABULARY.pptx | 2024-02-17 18:04 | 830K | |
![[ ]](/icons/unknown.gif) | UNIT 8 VOCABULARY (3)A.pptx | 2023-08-29 02:58 | 830K | |
![[ ]](/icons/unknown.gif) | powerpoint-active-passive-voice.ppt | 2015-11-11 14:56 | 828K | |
![[ ]](/icons/layout.gif) | everyone someone.pdf | 2018-02-03 14:57 | 827K | |
![[ ]](/icons/layout.gif) | LifeGramResources_32_L2 someone.pdf | 2017-12-04 23:23 | 827K | |
![[ ]](/icons/unknown.gif) | UNIT 11 BOOK 4.docx | 2021-09-07 00:36 | 826K | |
![[ ]](/icons/unknown.gif) | Comparatives Exercise 2.doc | 2019-07-16 02:05 | 826K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT.ppt | 2022-10-12 02:59 | 824K | |
![[ ]](/icons/unknown.gif) | GIVING DIRECTIONS.docx | 2018-03-17 16:26 | 821K | |
![[ ]](/icons/unknown.gif) | gerunds and infinitives.pptx | 2016-05-05 02:56 | 817K | |
![[ ]](/icons/unknown.gif) | MY FAVORITE COLOR IS... Level 5 01.09.20.pptx | 2022-11-30 02:58 | 814K | |
![[ ]](/icons/unknown.gif) | CAN CAN'T EXERCISE.docx | 2019-02-19 20:46 | 814K | |
![[ ]](/icons/unknown.gif) | MOVIE GENRES CROSSWORD.docx | 2024-05-11 18:05 | 809K | |
![[ ]](/icons/unknown.gif) | UNIT 7 GRAMMAR BOOK 3.docx | 2021-05-29 00:32 | 807K | |
![[ ]](/icons/unknown.gif) | Hello 1.1.pptx | 2015-01-14 02:31 | 799K | |
![[ ]](/icons/unknown.gif) | ZERO CONDITIONAL EXERCISE.docx | 2022-10-29 18:07 | 798K | |
![[ ]](/icons/unknown.gif) | APPEARANCE VOCABULARY.ppt | 2018-05-16 17:58 | 798K | |
![[ ]](/icons/layout.gif) | Advanced Unit 04b.pdf | 2016-08-10 20:22 | 797K | |
![[ ]](/icons/unknown.gif) | study guide.docx | 2014-03-05 23:53 | 797K | |
![[ ]](/icons/layout.gif) | POSSESSIVE ADJECTIVES.pdf | 2017-04-08 02:07 | 796K | |
![[ ]](/icons/unknown.gif) | UNIT 1 BOOK 3 GRAMMAR.docx | 2021-09-25 17:37 | 795K | |
![[ ]](/icons/unknown.gif) | Present Continuous.ppt | 2014-08-22 05:17 | 792K | |
![[ ]](/icons/unknown.gif) | VERB TO BE PRACTICE.docx | 2021-04-21 03:02 | 792K | |
![[ ]](/icons/binary.gif) | Global Digital - Elementary.exe | 2014-10-04 19:58 | 791K | |
![[ ]](/icons/unknown.gif) | FIRST CONDITIONAL EXERCISE 4.docx | 2024-02-29 02:55 | 791K | |
![[ ]](/icons/unknown.gif) | power point past simple.ppt | 2018-09-22 17:18 | 789K | |
![[IMG]](/icons/image2.gif) | FOOD1count and noncount.png | 2015-02-20 04:44 | 787K | |
![[ ]](/icons/unknown.gif) | Unit 7 book 4.docx | 2021-08-17 00:40 | 787K | |
![[ ]](/icons/unknown.gif) | READING COMPREHENSION COMPARATIVE.docx | 2019-06-08 17:23 | 786K | |
![[ ]](/icons/layout.gif) | CAN-CAN´T AST.pdf | 2021-12-14 00:13 | 783K | |
![[ ]](/icons/unknown.gif) | 3. Conditionals.ppt | 2015-02-26 02:55 | 782K | |
![[ ]](/icons/layout.gif) | Reported-Speech-2-Medio(2).pdf | 2016-03-02 00:38 | 781K | |
![[ ]](/icons/layout.gif) | Reported-Speech-2-Medio(1).pdf | 2016-03-02 01:18 | 781K | |
![[ ]](/icons/layout.gif) | the-passive-voice1.pdf | 2013-11-26 00:56 | 778K | |
![[ ]](/icons/layout.gif) | the-passive-voice.pdf | 2015-08-07 01:50 | 778K | |
![[ ]](/icons/layout.gif) | the-passive-voice (1).pdf | 2015-03-11 01:20 | 778K | |
![[ ]](/icons/unknown.gif) | UNIT 7 LESSON B SIMPLE PRESENT.ppt | 2021-05-20 02:56 | 774K | |
![[ ]](/icons/unknown.gif) | PAST PERFECT EXERCISE 1.docx | 2024-02-24 18:05 | 772K | |
![[ ]](/icons/unknown.gif) | PAST PERFECT EXERCISE 1 (2).docx | 2023-03-23 02:02 | 772K | |
![[ ]](/icons/unknown.gif) | PAST PERFECT EXERCISE 1 (1).docx | 2022-11-02 02:58 | 772K | |
![[ ]](/icons/unknown.gif) | PAST PERFECT EXERCISE 1 (1) (1).docx | 2022-11-12 18:09 | 772K | |
![[ ]](/icons/unknown.gif) | Unit 10 book 4.docx | 2021-06-10 01:38 | 770K | |
![[ ]](/icons/unknown.gif) | FOOD NAMES.docx | 2017-08-09 00:04 | 770K | |
![[ ]](/icons/layout.gif) | LifeGramResources_18_L1-2 past regulars.pdf | 2017-12-05 00:16 | 769K | |
![[ ]](/icons/layout.gif) | LifeGramResources_18_L1-2.pdf | 2017-12-04 22:04 | 769K | |
![[ ]](/icons/unknown.gif) | CAN OR CAN'T EXERCISE.docx | 2021-05-11 03:08 | 767K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST EXERCISE 5.docx | 2024-02-08 02:54 | 764K | |
![[IMG]](/icons/image2.gif) | FOOD3.png | 2015-08-05 23:13 | 764K | |
![[IMG]](/icons/image2.gif) | FOOD3 (2).png | 2015-02-14 18:09 | 764K | |
![[IMG]](/icons/image2.gif) | FOOD3 (1).png | 2015-08-04 02:19 | 764K | |
![[ ]](/icons/unknown.gif) | SPECULATING IN PRESENT EXERCISE.docx | 2022-08-19 03:02 | 763K | |
![[ ]](/icons/unknown.gif) | preposition2.docx | 2020-01-21 01:39 | 762K | |
![[ ]](/icons/unknown.gif) | extra work on wishes.docx | 2019-01-22 18:59 | 761K | |
![[ ]](/icons/unknown.gif) | LIKES AND DISLIKES EXERCISE.docx | 2021-05-18 21:18 | 755K | |
![[ ]](/icons/unknown.gif) | HAVE HAS EXERCISE2.docx | 2021-05-13 02:52 | 754K | |
![[ ]](/icons/unknown.gif) | past perfect.docx | 2019-08-10 00:09 | 741K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT review.docx | 2017-08-12 16:35 | 740K | |
![[ ]](/icons/unknown.gif) | verb to be.docx | 2016-01-26 00:51 | 737K | |
![[ ]](/icons/layout.gif) | reportingverbsss-121026021206-phpapp01.pdf | 2019-07-27 00:57 | 733K | |
![[ ]](/icons/unknown.gif) | UNIT 4 book 3 grammar.docx | 2021-08-14 17:04 | 732K | |
![[ ]](/icons/layout.gif) | AEG-Lesson-02.pdf | 2018-05-19 22:06 | 730K | |
![[ ]](/icons/unknown.gif) | simple past vrs past continuous.ppt | 2016-03-05 02:45 | 730K | |
![[ ]](/icons/unknown.gif) | EXERCISEusedto.doc | 2023-11-28 02:55 | 725K | |
![[ ]](/icons/layout.gif) | Exercises - Unit 5 and 6.pdf | 2017-06-16 18:21 | 725K | |
![[ ]](/icons/unknown.gif) | Xtreme Sports Exercise.docx | 2023-10-26 02:59 | 722K | |
![[SND]](/icons/sound2.gif) | Audio Elem 3a.mp3 | 2016-07-30 22:59 | 722K | |
![[IMG]](/icons/image2.gif) | HW Famous Exhibition.PNG | 2021-02-27 17:48 | 719K | |
![[ ]](/icons/layout.gif) | containers and quantities matching exercises esl worksheet.pdf | 2018-11-17 00:36 | 716K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT PROGRESSIVE (1).ppt | 2022-12-10 03:38 | 716K | |
![[ ]](/icons/layout.gif) | LifeGramResources_15_L1-2 present simple 2.pdf | 2017-12-04 23:59 | 715K | |
![[ ]](/icons/layout.gif) | countables and uncountables #1.pdf | 2022-02-16 18:27 | 713K | |
![[ ]](/icons/unknown.gif) | HOMEWORK NOVEMBER 3RD..docx | 2018-10-27 18:04 | 713K | |
![[ ]](/icons/layout.gif) | Ele_U12_ExtraPractice.pdf | 2016-06-11 22:31 | 711K | |
![[ ]](/icons/unknown.gif) | WAS AND WERE EXERCISE.docx | 2019-06-27 01:39 | 708K | |
![[ ]](/icons/unknown.gif) | GOING TO EXERCISE 2.docx | 2019-08-30 00:38 | 707K | |
![[ ]](/icons/unknown.gif) | The article the book 2-unit 12.docx | 2020-06-17 17:27 | 706K | |
![[ ]](/icons/layout.gif) | efl10_teacher.pdf | 2016-06-04 21:44 | 705K | |
![[ ]](/icons/unknown.gif) | Future continuous & Future perfect 1.4.pptx | 2015-04-30 15:14 | 701K | |
![[ ]](/icons/layout.gif) | 1107091010014247_13101512123153.pdf | 2018-09-22 21:23 | 700K | |
![[ ]](/icons/unknown.gif) | majorstair_adverbs_frequency_jinny.pps | 2016-08-10 02:06 | 699K | |
![[ ]](/icons/unknown.gif) | UNIT 4 LESSON D.ppt | 2016-12-06 02:04 | 698K | |
![[ ]](/icons/unknown.gif) | reported speech ppt.pptx | 2016-06-11 00:07 | 698K | |
![[ ]](/icons/layout.gif) | atg-worksh-thereisare.pdf | 2019-04-27 22:15 | 697K | |
![[ ]](/icons/layout.gif) | Present Perfect and Conditionals.pdf | 2015-03-13 00:11 | 694K | |
![[ ]](/icons/unknown.gif) | DAILY ROUTINES EXERCISE.docx | 2023-01-25 03:02 | 689K | |
![[ ]](/icons/unknown.gif) | PERSONALITIES.ppt | 2023-06-10 18:09 | 686K | |
![[ ]](/icons/layout.gif) | Expressing possibility, probability and certainty.pdf | 2017-05-10 23:51 | 679K | |
![[ ]](/icons/layout.gif) | AEG-Lesson-07-UNREAL CONDITIONALS.pdf | 2017-04-08 21:51 | 678K | |
![[ ]](/icons/layout.gif) | Quantifiers Some or Any Worksheet.pdf | 2018-11-17 00:39 | 677K | |
![[ ]](/icons/unknown.gif) | prepositions of place.docx | 2019-07-20 16:45 | 677K | |
![[ ]](/icons/layout.gif) | comparative-and-superlative-practice.pdf | 2019-01-22 23:31 | 672K | |
![[ ]](/icons/unknown.gif) | HAVE TO HAS TO.pptx | 2024-02-28 03:00 | 672K | |
![[ ]](/icons/unknown.gif) | Adjective Order UI 3.4.pptx | 2015-05-14 16:03 | 670K | |
![[ ]](/icons/unknown.gif) | Present Tenses.ppt | 2015-07-07 03:01 | 669K | |
![[ ]](/icons/layout.gif) | Intermediate Unit 5a(2).pdf | 2016-06-07 20:38 | 666K | |
![[ ]](/icons/layout.gif) | Pronunciation of -ed.pdf | 2015-06-10 00:19 | 666K | |
![[ ]](/icons/unknown.gif) | SHOULD SHOULDN'T (1).ppt | 2017-03-18 17:04 | 665K | |
![[ ]](/icons/layout.gif) | Review Exercises.pdf | 2017-05-26 16:25 | 663K | |
![[IMG]](/icons/image2.gif) | HW, unit 11.PNG | 2023-06-28 03:18 | 662K | |
![[ ]](/icons/unknown.gif) | COUNTIRES AND NATIONALITIES EXERCISE 1..docx | 2018-02-23 01:41 | 661K | |
![[ ]](/icons/layout.gif) | SECOND CONDITIONAL EXERCISE.pdf | 2019-06-15 18:09 | 661K | |
![[ ]](/icons/unknown.gif) | can,can't, have, has.docx | 2020-06-30 20:29 | 659K | |
![[ ]](/icons/unknown.gif) | VERB TO BE.pptx | 2015-04-22 01:28 | 656K | |
![[ ]](/icons/layout.gif) | Past Continuous Exercise.pdf | 2015-07-30 00:37 | 656K | |
![[ ]](/icons/unknown.gif) | reportedspeech L8 unit 2.ppt | 2016-04-26 03:01 | 656K | |
![[ ]](/icons/layout.gif) | Have to or don´t have to AST.pdf | 2021-12-13 23:59 | 652K | |
![[ ]](/icons/layout.gif) | CAN´T STOP THE FEELING AST.pdf | 2021-06-16 03:07 | 650K | |
![[ ]](/icons/layout.gif) | Unit 4 Exercises.pdf | 2016-08-14 20:24 | 646K | |
![[ ]](/icons/unknown.gif) | PAST PERFECT.ppt | 2021-08-07 18:11 | 646K | |
![[ ]](/icons/unknown.gif) | PAST PERFECT2.ppt | 2024-05-07 16:08 | 644K | |
![[ ]](/icons/layout.gif) | atg-worksheet-indefpron.pdf | 2018-11-17 22:25 | 643K | |
![[ ]](/icons/layout.gif) | atg-worksheet-indefpron (2).pdf | 2017-11-18 21:22 | 643K | |
![[ ]](/icons/layout.gif) | Like + -ing 'd like to.pdf | 2016-02-08 04:37 | 642K | |
![[ ]](/icons/unknown.gif) | PAST PERFECT1.ppt | 2023-11-11 18:08 | 642K | |
![[ ]](/icons/unknown.gif) | Can and can´t for ability PPP.pptx | 2015-05-28 03:18 | 641K | |
![[ ]](/icons/unknown.gif) | Can and can´t for ability G 6.1.pptx | 2015-10-16 00:08 | 641K | |
![[ ]](/icons/layout.gif) | Simple Past Exercises - Elementary.pdf | 2016-04-09 17:53 | 638K | |
![[ ]](/icons/layout.gif) | Grammar-EXTRA_Inspired_1_Unit_2_can_and_cant.pdf | 2019-05-17 23:09 | 636K | |
![[ ]](/icons/unknown.gif) | THE BODY.docx | 2021-05-08 18:52 | 635K | |
![[ ]](/icons/unknown.gif) | UNIT 2 (1).pptx | 2017-01-24 01:48 | 634K | |
![[ ]](/icons/unknown.gif) | Welcome to the AST English Academy.pptx | 2015-07-11 02:58 | 632K | |
![[ ]](/icons/unknown.gif) | The Passive Voice U.I. 6.1.pptx | 2015-06-02 14:20 | 632K | |
![[ ]](/icons/layout.gif) | atg-worksheet-goingto2.pdf | 2018-05-05 20:55 | 632K | |
![[ ]](/icons/unknown.gif) | PAST PERFECT22.ppt | 2019-08-10 01:33 | 631K | |
![[ ]](/icons/unknown.gif) | Relative clauses U.I. 10.1.pptx | 2015-06-29 14:40 | 628K | |
![[ ]](/icons/unknown.gif) | PAST PERFECT 3 (1).ppt | 2022-11-12 18:05 | 628K | |
![[ ]](/icons/unknown.gif) | PAST PERFECT 3.ppt | 2024-02-15 03:02 | 625K | |
![[ ]](/icons/unknown.gif) | FIRST CONDITIONAL (3).ppt | 2023-03-16 03:35 | 624K | |
![[ ]](/icons/unknown.gif) | Possessive Pronouns and Adjectives.pptx | 2021-06-17 03:02 | 622K | |
![[ ]](/icons/unknown.gif) | Passive Voice Level 8 unit 6 Global (7).ppt | 2015-01-20 02:28 | 622K | |
![[ ]](/icons/unknown.gif) | Passive Voice Level 8 unit 6 Global (1).ppt | 2016-04-12 02:58 | 622K | |
![[ ]](/icons/unknown.gif) | Review Future forms 1.3.pptx | 2015-04-29 14:09 | 622K | |
![[IMG]](/icons/image2.gif) | Screenshot[6]-01.png | 2023-06-21 03:15 | 622K | |
![[ ]](/icons/unknown.gif) | how to express future.ppt | 2020-03-31 00:25 | 621K | |
![[ ]](/icons/unknown.gif) | Passive Voice Level 8 unit 6 Global.ppt | 2015-01-22 05:29 | 620K | |
![[ ]](/icons/layout.gif) | health problems illnesses sickness ailments injuries matching exercise vocabulary worksheet.pdf | 2016-01-23 18:10 | 619K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT PROGRESSIVE.ppt | 2023-12-06 02:57 | 619K | |
![[ ]](/icons/layout.gif) | atg-worksheet-should.pdf | 2018-08-25 21:02 | 615K | |
![[ ]](/icons/layout.gif) | atg-worksheet-beverbpast2.pdf | 2018-12-08 02:26 | 614K | |
![[ ]](/icons/layout.gif) | atg-worksheet-haveto.pdf | 2018-08-25 21:05 | 614K | |
![[ ]](/icons/unknown.gif) | The articles.ppt | 2016-03-19 02:50 | 613K | |
![[ ]](/icons/layout.gif) | LIKE FREE TIME ACTIVITIES AST.pdf | 2022-02-10 20:07 | 611K | |
![[ ]](/icons/layout.gif) | worksheet thisthatthesethose erika.pdf | 2019-05-11 16:20 | 609K | |
![[ ]](/icons/layout.gif) | atg-worksheet-thisthatthesethose.pdf | 2019-04-27 22:14 | 609K | |
![[ ]](/icons/unknown.gif) | WHEN AND WHILE 2.docx | 2024-02-15 03:06 | 603K | |
![[ ]](/icons/unknown.gif) | PRESENT PROGRESSIVE EX.docx | 2023-08-05 18:16 | 603K | |
![[ ]](/icons/unknown.gif) | unit 1 simple present vs progressive.pptx | 2015-01-17 19:18 | 602K | |
![[ ]](/icons/unknown.gif) | WHEN AND WHILE 2 (1).docx | 2023-05-20 03:06 | 602K | |
![[ ]](/icons/unknown.gif) | infinitive unit 6 book 3.docx | 2020-09-12 16:57 | 602K | |
![[ ]](/icons/unknown.gif) | WHEN AND WHILE 3.docx | 2018-12-01 17:36 | 601K | |
![[ ]](/icons/layout.gif) | opposites-of-adjectives.pdf | 2019-07-13 17:27 | 601K | |
![[ ]](/icons/layout.gif) | Ele_Unit10_Revision.pdf | 2016-05-21 22:40 | 599K | |
![[ ]](/icons/layout.gif) | Ele_U10_ExtraPractice.pdf | 2016-05-21 22:38 | 599K | |
![[ ]](/icons/unknown.gif) | like and don't like.docx | 2020-07-07 20:25 | 598K | |
![[ ]](/icons/unknown.gif) | level 1 Reading Comprehension.docx | 2016-01-21 01:20 | 597K | |
![[ ]](/icons/unknown.gif) | level 1 Reading Comprehension (1).docx | 2017-09-30 17:40 | 597K | |
![[ ]](/icons/layout.gif) | Ele_Unit3_Revision.pdf | 2017-05-13 00:33 | 597K | |
![[ ]](/icons/unknown.gif) | FURNITURE EXERCISE.docx | 2021-06-02 02:59 | 596K | |
![[ ]](/icons/unknown.gif) | reportedspeech L8 unit 2 (1).ppt | 2015-05-02 18:09 | 596K | |
![[IMG]](/icons/image2.gif) | HW SPECIAL PERSON.PNG | 2021-11-17 02:25 | 595K | |
![[ ]](/icons/layout.gif) | Ele_Unit5_Revision.pdf | 2017-03-04 22:57 | 591K | |
![[ ]](/icons/unknown.gif) | UNIT 2 book 2 grammar.docx | 2021-04-30 13:57 | 590K | |
![[ ]](/icons/layout.gif) | Beg_Unit9_Revision.pdf | 2018-05-18 23:59 | 589K | |
![[ ]](/icons/layout.gif) | Grammar-EXTRA_Inspired_2_Unit_7_have_has_to_and_dont_doesnt_have_to.pdf | 2018-11-17 22:27 | 588K | |
![[ ]](/icons/unknown.gif) | Adjective Clauses.pps | 2015-05-30 00:17 | 587K | |
![[ ]](/icons/layout.gif) | Rubric RM.pdf | 2014-06-07 21:16 | 587K | |
![[ ]](/icons/layout.gif) | Grammar-EXTRA_Inspired_2_Unit_4_Simple_future_will_wont.pdf | 2018-12-01 22:15 | 586K | |
![[ ]](/icons/layout.gif) | Ele_Unit3_ExtraPractice.pdf | 2017-05-13 00:33 | 584K | |
![[ ]](/icons/layout.gif) | Grammar-EXTRA_Inspired_1_Unit_3_Simple_present_and_adverbs_of_frequency.pdf | 2019-05-17 23:06 | 582K | |
![[ ]](/icons/unknown.gif) | PERMISSION, OBLIGATIONS, PERMISSION.ppt | 2024-05-18 02:48 | 581K | |
![[ ]](/icons/unknown.gif) | PERMISSION, OBLIGATIONS, PERMISSION (1).ppt | 2023-05-04 02:49 | 581K | |
![[ ]](/icons/layout.gif) | Grammar-EXTRA_Inspired_2_Unit_6_Present_perfect.pdf | 2018-11-03 21:09 | 580K | |
![[ ]](/icons/layout.gif) | Beg_Unit1_ExtraPractice.pdf | 2017-04-22 01:28 | 579K | |
![[ ]](/icons/unknown.gif) | A colection of TOEFL Reading Comprehension 4 (1).doc | 2014-09-09 00:24 | 578K | |
![[ ]](/icons/layout.gif) | irregular verbs simple past tense 1.pdf | 2015-10-17 16:58 | 577K | |
![[IMG]](/icons/image2.gif) | mixed conditionals structures.png | 2016-05-21 18:10 | 576K | |
![[ ]](/icons/layout.gif) | Grammar-EXTRA_Inspired_1_Unit_7_verb_gerund.pdf | 2019-05-17 23:07 | 575K | |
![[ ]](/icons/unknown.gif) | DEMONSTRATIVE PRONOUS.doc | 2018-06-19 02:21 | 575K | |
![[ ]](/icons/layout.gif) | Will Vs. Going to.pdf | 2015-08-14 02:18 | 574K | |
![[ ]](/icons/unknown.gif) | DEMONSTRATIVE_PRONOUS.doc | 2019-06-14 00:57 | 574K | |
![[ ]](/icons/layout.gif) | ALL ABOUT ME AST.pdf | 2022-01-24 21:03 | 573K | |
![[ ]](/icons/layout.gif) | Possessives Eval PDF AST.pdf | 2021-06-19 00:48 | 572K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT 4.docx | 2021-10-12 03:14 | 572K | |
![[ ]](/icons/unknown.gif) | prepositions of time.ppt | 2021-05-21 02:54 | 571K | |
![[ ]](/icons/unknown.gif) | present perfect (saturday class level 2).pptx | 2020-05-30 18:08 | 570K | |
![[ ]](/icons/unknown.gif) | THIRD CONDITIONAL.ppt | 2021-09-15 02:54 | 569K | |
![[ ]](/icons/unknown.gif) | will-going to.ppt | 2019-08-24 01:01 | 565K | |
![[ ]](/icons/layout.gif) | Action Verbs Vs. State Verbs.pdf | 2015-01-20 00:39 | 564K | |
![[ ]](/icons/layout.gif) | AST L-7 UNIT 2 HOMEWORK SCHEDULE, LIFE 3, OCT. 18-NOV. 13, 2021.pdf | 2021-10-26 21:21 | 563K | |
![[ ]](/icons/unknown.gif) | comparative adjectives.ppt | 2016-02-24 00:38 | 561K | |
![[ ]](/icons/unknown.gif) | SPORTS AND EXERCISE.docx | 2019-01-23 01:44 | 559K | |
![[ ]](/icons/layout.gif) | PREPOSITIONS AT IN ON OF PLACE.pdf | 2022-03-17 00:47 | 558K | |
![[ ]](/icons/layout.gif) | atg-worksheet-possadj.pdf | 2020-01-18 00:45 | 555K | |
![[ ]](/icons/unknown.gif) | Bookreport on PP.ppt | 2020-03-07 00:06 | 554K | |
![[ ]](/icons/layout.gif) | containers-and-amounts.pdf | 2019-03-02 21:44 | 552K | |
![[ ]](/icons/layout.gif) | Active and Passive Voice.pdf | 2016-01-28 02:37 | 549K | |
![[ ]](/icons/unknown.gif) | passive voice (level 4).docx | 2020-07-30 23:39 | 548K | |
![[IMG]](/icons/image2.gif) | NuevoDocumento 1_1 (2).jpg | 2017-02-06 19:01 | 544K | |
![[ ]](/icons/unknown.gif) | possessive adjectives 2.docx | 2016-01-26 00:52 | 543K | |
![[ ]](/icons/layout.gif) | Parts of a house and Furniture AST.pdf | 2022-01-31 20:21 | 541K | |
![[IMG]](/icons/image2.gif) | PTDC0074.JPG | 2014-10-31 01:38 | 538K | |
![[ ]](/icons/unknown.gif) | ADVERBS OF FREQUENCY 2.docx | 2017-04-29 17:48 | 536K | |
![[ ]](/icons/unknown.gif) | ADVERBS OF FREQUENCY 2 (1).docx | 2017-10-21 02:16 | 536K | |
![[ ]](/icons/unknown.gif) | Lesson 8 - Past Perfect.ppt | 2017-06-10 00:22 | 535K | |
![[ ]](/icons/unknown.gif) | QUANTIFIERS 2.docx | 2021-09-01 03:01 | 534K | |
![[ ]](/icons/unknown.gif) | The Man who lost his memory..docx | 2016-07-21 01:22 | 534K | |
![[ ]](/icons/unknown.gif) | FURNITURE EXERCISE 2.docx | 2018-07-14 16:07 | 531K | |
![[ ]](/icons/unknown.gif) | FIRST CONDITIONAL (2).ppt | 2022-11-16 02:57 | 530K | |
![[ ]](/icons/unknown.gif) | FOOD EXERCISE.docx | 2024-02-28 02:57 | 529K | |
![[ ]](/icons/binary.gif) | Inspired IC - 2.exe | 2016-07-09 17:59 | 527K | |
![[ ]](/icons/binary.gif) | Inspired IC - 3.exe | 2015-04-25 15:36 | 527K | |
![[ ]](/icons/unknown.gif) | simple past questions exercise 2.docx | 2023-08-02 02:27 | 525K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST REVIEW.docx | 2021-06-22 19:45 | 525K | |
![[IMG]](/icons/image2.gif) | Difference-between-look-see-and-watch-1030x1030.png | 2021-11-30 00:01 | 518K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT EXERCISE 8.docx | 2019-06-20 19:34 | 518K | |
![[ ]](/icons/unknown.gif) | board 4.docx | 2017-03-07 02:57 | 516K | |
![[ ]](/icons/unknown.gif) | Life In Extreme Environments.docx | 2018-04-16 01:33 | 515K | |
![[ ]](/icons/unknown.gif) | What do you worry about 2.ppt | 2024-02-17 17:59 | 515K | |
![[ ]](/icons/unknown.gif) | What_do_you_worry_about_2.ppt | 2014-11-22 17:46 | 515K | |
![[IMG]](/icons/image2.gif) | Screenshot[11]-01.png | 2021-09-24 02:19 | 515K | |
![[ ]](/icons/unknown.gif) | IN, ON ,AT EXERCISE.docx | 2021-05-21 03:13 | 513K | |
![[ ]](/icons/unknown.gif) | PREPOSITIONS EXERCISE 2.docx | 2023-08-23 02:51 | 513K | |
![[ ]](/icons/unknown.gif) | prepositions.docx | 2013-11-28 00:31 | 512K | |
![[ ]](/icons/unknown.gif) | PRONUNCIATION RULES.ppt | 2019-07-09 01:25 | 512K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST.docx | 2018-05-14 17:26 | 511K | |
![[ ]](/icons/unknown.gif) | simple past questions exercise.docx | 2023-06-03 17:30 | 510K | |
![[ ]](/icons/unknown.gif) | UNIT 9 REVIEW.pptx | 2021-09-02 22:00 | 509K | |
![[ ]](/icons/unknown.gif) | present continuous blue.ppt | 2016-01-23 18:09 | 508K | |
![[ ]](/icons/unknown.gif) | cont.pps | 2016-02-23 23:03 | 508K | |
![[ ]](/icons/unknown.gif) | cont (1).pps | 2015-08-18 01:13 | 508K | |
![[ ]](/icons/layout.gif) | future going to my homework.pdf | 2016-08-25 02:20 | 507K | |
![[ ]](/icons/layout.gif) | Possessive Noun Packet-0.pdf | 2019-01-15 18:07 | 507K | |
![[ ]](/icons/layout.gif) | Be Going To.pdf | 2014-06-12 00:06 | 506K | |
![[ ]](/icons/unknown.gif) | possessive.pptx | 2014-04-12 17:43 | 506K | |
![[ ]](/icons/unknown.gif) | COMPUTER SYMBOLS.ppt | 2017-01-24 02:59 | 503K | |
![[ ]](/icons/layout.gif) | atg-worksheet-goingto20r.pdf | 2018-07-28 21:24 | 500K | |
![[ ]](/icons/unknown.gif) | Telling Time G 2.3 PPP.pptm | 2015-05-08 00:05 | 498K | |
![[ ]](/icons/layout.gif) | Question Generator.pdf | 2014-03-17 23:35 | 497K | |
![[ ]](/icons/layout.gif) | atg-worksheet-advsfrequency.pdf | 2019-11-09 19:09 | 497K | |
![[IMG]](/icons/image2.gif) | ROOM.png | 2024-01-31 02:38 | 495K | |
![[ ]](/icons/layout.gif) | FAMILY MEMBERS AST.pdf | 2022-01-25 17:15 | 493K | |
![[ ]](/icons/layout.gif) | Proyecto Unidad 4.pdf | 2020-02-08 17:16 | 492K | |
![[ ]](/icons/unknown.gif) | GERUNDS AND INFINITIVES EXERCISE 2.docx | 2019-10-26 16:06 | 492K | |
![[ ]](/icons/layout.gif) | atg-worksheet-specialpluralnouns.pdf | 2019-10-26 22:25 | 491K | |
![[ ]](/icons/unknown.gif) | FOOD EXERCISE 3.docx | 2023-11-08 02:58 | 490K | |
![[ ]](/icons/unknown.gif) | QUIZ REPORTED SPEECH POSITIVE SENTENCES.docx | 2020-03-12 23:43 | 490K | |
![[ ]](/icons/unknown.gif) | USED TO (1).ppt | 2022-12-02 02:57 | 489K | |
![[ ]](/icons/layout.gif) | ele_unit9_extrapractice.pdf | 2017-11-28 20:02 | 487K | |
![[ ]](/icons/unknown.gif) | WHEN AND WHILE EXERCISE1.docx | 2019-08-03 02:20 | 487K | |
![[ ]](/icons/unknown.gif) | Telling Time G 2.3.pptm | 2015-08-11 01:43 | 485K | |
![[ ]](/icons/unknown.gif) | MORE STATIVE VERBS.docx | 2022-01-27 03:15 | 482K | |
![[ ]](/icons/layout.gif) | Beg_Unit4_ExtraPractice.pdf | 2016-08-06 22:20 | 482K | |
![[IMG]](/icons/image2.gif) | PTDC0039.JPG | 2015-08-26 21:48 | 480K | |
![[ ]](/icons/layout.gif) | Ele_U11_ExtraPractice (1).pdf | 2016-06-04 20:54 | 480K | |
![[ ]](/icons/unknown.gif) | MODAL VERBS SPECULATION.docx | 2019-11-13 02:26 | 479K | |
![[ ]](/icons/layout.gif) | time erika 2019.pdf | 2019-05-11 17:41 | 479K | |
![[ ]](/icons/layout.gif) | CLOTHES AST.pdf | 2021-11-24 00:32 | 478K | |
![[ ]](/icons/unknown.gif) | UNIT 12 GRAMMAR-BOOK 3.docx | 2021-03-23 02:15 | 475K | |
![[ ]](/icons/unknown.gif) | WHEN AND WHILE EXERCISES (2).ppt | 2023-02-21 02:55 | 475K | |
![[ ]](/icons/layout.gif) | SIMPLE PRESENT AST.pdf | 2022-02-08 00:53 | 472K | |
![[IMG]](/icons/image2.gif) | PTDC0068.JPG | 2016-11-11 05:05 | 468K | |
![[ ]](/icons/unknown.gif) | MODALVERBS-final.pptx | 2019-07-31 13:56 | 467K | |
![[IMG]](/icons/image2.gif) | HW UNIT 12.PNG | 2022-08-03 03:15 | 466K | |
![[ ]](/icons/layout.gif) | ICURSEA_AND_GRADABLE_&_NON-GRADABLE_ADJECTIVES.pdf | 2017-02-21 00:47 | 465K | |
![[ ]](/icons/layout.gif) | Prepositions of Place AST.pdf | 2022-02-02 00:40 | 463K | |
![[ ]](/icons/layout.gif) | Ele_Unit6_ExtraPractice.pdf | 2017-03-18 22:51 | 463K | |
![[ ]](/icons/layout.gif) | family members vocabulary esl exercises worksheet for kids.pdf | 2019-04-06 22:36 | 462K | |
![[ ]](/icons/layout.gif) | atg-chart-presentperfect.pdf | 2019-08-08 02:33 | 462K | |
![[ ]](/icons/layout.gif) | INFORMACION MATRICULA EN LINEA.pdf | 2016-06-02 01:18 | 460K | |
![[ ]](/icons/layout.gif) | Ele_Unit1_Revision.pdf | 2016-10-01 20:01 | 460K | |
![[ ]](/icons/layout.gif) | INFINITIVES OF PURPOSE AST.pdf | 2021-12-02 00:40 | 459K | |
![[ ]](/icons/unknown.gif) | ing-ed-adjectives.ppt | 2019-06-01 14:23 | 459K | |
![[ ]](/icons/layout.gif) | Ele_Unit5_ExtraPractice.pdf | 2017-03-04 22:57 | 458K | |
![[ ]](/icons/unknown.gif) | CONDITIONALS (1).ppt | 2016-09-06 22:51 | 457K | |
![[ ]](/icons/unknown.gif) | Unit 3-book 3 grammar.docx | 2021-10-21 21:16 | 457K | |
![[ ]](/icons/layout.gif) | atg-worksheet-someany1.pdf | 2020-02-29 01:47 | 455K | |
![[ ]](/icons/layout.gif) | atg-worksheet-someany.pdf | 2019-08-17 19:20 | 455K | |
![[ ]](/icons/unknown.gif) | Irregular ve=.pptx | 2018-06-02 18:14 | 454K | |
![[ ]](/icons/unknown.gif) | OBJECT PRONOUNS EXERCISE.docx | 2018-10-02 02:25 | 454K | |
![[ ]](/icons/unknown.gif) | VERB TO BE EXERCISE 2.docx | 2021-04-22 15:21 | 454K | |
![[IMG]](/icons/image2.gif) | daily routine homework.PNG | 2021-04-09 02:56 | 454K | |
![[ ]](/icons/layout.gif) | UI_Unit7_ExtraPractice.pdf | 2017-04-22 21:48 | 453K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST EXERCISE 2..docx | 2017-03-21 01:19 | 452K | |
![[ ]](/icons/unknown.gif) | UNIT 5 -book 4.docx | 2021-08-06 00:17 | 451K | |
![[ ]](/icons/layout.gif) | SHOULD AND SHOULDN´T AST2.pdf | 2022-03-25 00:48 | 450K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST REGULAR exercise.docx | 2017-01-14 17:09 | 450K | |
![[ ]](/icons/unknown.gif) | Past Tense mixed.docx | 2015-08-08 17:53 | 450K | |
![[ ]](/icons/layout.gif) | Gerunds and Infinitives worksheet.pdf | 2021-08-26 02:40 | 448K | |
![[ ]](/icons/unknown.gif) | PAST VERB TO BE.docx | 2021-06-05 02:53 | 448K | |
![[IMG]](/icons/image2.gif) | CARDINAL NUMBERS.jpg | 2018-05-19 01:07 | 447K | |
![[ ]](/icons/layout.gif) | Ele_Unit2_ExtraPractice.pdf | 2016-07-16 21:24 | 447K | |
![[ ]](/icons/unknown.gif) | INDIRECT QUESTIONS EXCERCISE 2.docx | 2023-10-17 03:02 | 446K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST EXERCISE 6.docx | 2024-01-27 18:11 | 446K | |
![[ ]](/icons/unknown.gif) | Gerunds and infinitives exercise 3.docx | 2022-03-22 03:10 | 446K | |
![[ ]](/icons/unknown.gif) | Tell the time.docx | 2018-08-01 03:35 | 446K | |
![[ ]](/icons/layout.gif) | atg-chart-pastirregular.pdf | 2021-11-24 02:06 | 444K | |
![[ ]](/icons/unknown.gif) | present simple.ppt | 2015-10-21 00:11 | 444K | |
![[ ]](/icons/layout.gif) | There is_There are AST.pdf | 2022-01-31 20:24 | 443K | |
![[ ]](/icons/unknown.gif) | SPECULATING EXERCISE.docx | 2019-04-27 17:22 | 443K | |
![[IMG]](/icons/image2.gif) | homework my favorite color.PNG | 2023-01-28 18:00 | 443K | |
![[ ]](/icons/unknown.gif) | the_house__prepositions_of_place.doc | 2014-10-01 06:35 | 443K | |
![[ ]](/icons/layout.gif) | irregular verbs.pdf | 2020-02-15 18:01 | 438K | |
![[ ]](/icons/layout.gif) | Beg_Unit9_ExtraPractice (1).pdf | 2016-08-06 18:16 | 436K | |
![[ ]](/icons/unknown.gif) | STATIVE AND DYNAMIC VERBS EXERCISE 1.docx | 2022-10-15 03:01 | 436K | |
![[IMG]](/icons/image2.gif) | PTDC0059.JPG | 2016-11-11 05:01 | 435K | |
![[ ]](/icons/unknown.gif) | Comparative_and_Superlative_Adjectives_Presentation.ppt | 2019-08-16 01:02 | 434K | |
![[ ]](/icons/unknown.gif) | conditional exercises.docx | 2019-10-20 01:13 | 432K | |
![[ ]](/icons/unknown.gif) | past simple ppt fund 2.ppt | 2014-10-16 03:24 | 429K | |
![[ ]](/icons/unknown.gif) | Past Simple Questions and Negatives G 7.4.pptx | 2015-10-28 00:26 | 428K | |
![[ ]](/icons/unknown.gif) | Unit 5 (grammar).docx | 2021-08-04 01:42 | 428K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT EXERCISE 1.docx | 2023-01-25 03:03 | 425K | |
![[ ]](/icons/unknown.gif) | ADVERBS OF FREQUENCY 3.docx | 2017-11-11 17:04 | 424K | |
![[ ]](/icons/unknown.gif) | UNIT 2 LESSON D..ppt | 2017-07-15 00:58 | 424K | |
![[ ]](/icons/layout.gif) | SIMPLE PAST.pdf | 2018-06-16 22:51 | 424K | |
![[ ]](/icons/unknown.gif) | Past Perfect Simple & Continuous, Past Simple UPP INTER 4.3.pptx | 2015-05-18 00:02 | 423K | |
![[ ]](/icons/unknown.gif) | UNIT 10 grammar book 5.docx | 2021-09-10 01:21 | 423K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT PROGRESSIVE EXERCISE.docx | 2022-12-10 03:47 | 422K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST POSITIVE AND NEGATIVE.docx | 2019-03-07 02:18 | 422K | |
![[IMG]](/icons/image2.gif) | PTDC0112.JPG | 2016-10-24 16:22 | 421K | |
![[ ]](/icons/unknown.gif) | Unit 3 book 4.docx | 2021-07-21 00:52 | 421K | |
![[ ]](/icons/unknown.gif) | RELATIVE CLAUSES grammar unit 10 book 5.docx | 2020-09-17 02:51 | 421K | |
![[ ]](/icons/unknown.gif) | Simple Present vs Present Continuous.ppt | 2018-05-18 02:50 | 421K | |
![[ ]](/icons/unknown.gif) | Simple Present vs Present Continuous (1).ppt | 2018-08-06 23:52 | 421K | |
![[ ]](/icons/unknown.gif) | past tenses review (level 4).docx | 2020-07-27 20:47 | 420K | |
![[IMG]](/icons/image2.gif) | product.PNG | 2021-04-08 02:33 | 420K | |
![[ ]](/icons/unknown.gif) | SECOND CONDITIONAL EXERCISE 2.docx | 2021-09-08 02:59 | 417K | |
![[ ]](/icons/layout.gif) | UI_Unit7_Revision.pdf | 2017-04-22 21:48 | 415K | |
![[ ]](/icons/unknown.gif) | Unit 9 book 4.docx | 2021-08-30 23:58 | 414K | |
![[ ]](/icons/layout.gif) | Prepositions_of_Place_2.pdf | 2018-10-13 01:51 | 413K | |
![[IMG]](/icons/image2.gif) | PTDC0037.JPG | 2014-11-20 01:21 | 412K | |
![[ ]](/icons/layout.gif) | present perfect.pdf | 2018-02-17 02:08 | 412K | |
![[IMG]](/icons/image2.gif) | PTDC0161.JPG | 2016-10-18 20:12 | 412K | |
![[ ]](/icons/unknown.gif) | UNIT 4 book 4 grammar.docx | 2021-07-28 00:08 | 411K | |
![[ ]](/icons/unknown.gif) | Unit 4 grammar explanation.docx | 2021-10-21 21:22 | 411K | |
![[ ]](/icons/unknown.gif) | Presentacion Unit 8 (2).ppt | 2020-03-12 01:00 | 411K | |
![[ ]](/icons/layout.gif) | Past Progressive Content.pdf | 2015-02-03 20:53 | 410K | |
![[ ]](/icons/unknown.gif) | Infinitives of Purpose2.pptx | 2023-03-02 02:43 | 410K | |
![[ ]](/icons/unknown.gif) | Study guide las quiz.docx | 2016-12-14 20:16 | 409K | |
![[ ]](/icons/unknown.gif) | UNIT 5 LESSON C.pptx | 2017-02-14 02:52 | 408K | |
![[ ]](/icons/unknown.gif) | can-cannot.docx | 2014-03-13 00:44 | 404K | |
![[ ]](/icons/layout.gif) | Was and Were AST.pdf | 2021-08-03 00:33 | 404K | |
![[ ]](/icons/unknown.gif) | passive causative level 8.ppt | 2016-04-12 02:59 | 403K | |
![[ ]](/icons/layout.gif) | AST CONVERSATION CLUB HOMEWORK SCHEDULE #2 AUG. 21-SEPT. 11, 2021.pdf | 2021-09-01 20:07 | 402K | |
![[ ]](/icons/layout.gif) | prepositions-of-place-worksheet erika .pdf | 2019-05-11 16:20 | 402K | |
![[ ]](/icons/layout.gif) | the indefinite article and zero article rules esl classroom poster for kids.pdf | 2016-03-19 03:00 | 402K | |
![[ ]](/icons/layout.gif) | BODY PARTS AST.pdf | 2022-03-03 15:56 | 402K | |
![[ ]](/icons/layout.gif) | pronouns.pdf | 2018-11-17 22:24 | 402K | |
![[ ]](/icons/unknown.gif) | sp vs spc.ppt | 2016-04-30 18:21 | 399K | |
![[ ]](/icons/unknown.gif) | presente simple vrs present continuos.ppt | 2015-07-11 03:03 | 399K | |
![[ ]](/icons/unknown.gif) | presente simple vrs present continuos (5).ppt | 2015-07-11 18:20 | 399K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT EXERCISE 2.docx | 2020-02-06 01:35 | 398K | |
![[ ]](/icons/layout.gif) | articles a-an-the 1.pdf | 2016-03-19 03:09 | 397K | |
![[ ]](/icons/layout.gif) | future forms.pdf | 2018-09-20 01:35 | 397K | |
![[ ]](/icons/layout.gif) | future_forms.pdf | 2017-10-20 00:03 | 397K | |
![[ ]](/icons/unknown.gif) | countable and uncountable list.docx | 2018-10-27 16:53 | 396K | |
![[ ]](/icons/unknown.gif) | IMPERATIVES.docx | 2016-07-30 18:34 | 396K | |
![[ ]](/icons/unknown.gif) | future forms.docx | 2018-02-10 17:34 | 393K | |
![[ ]](/icons/unknown.gif) | UNIT 2 book 5 grammar.docx | 2021-07-14 02:19 | 392K | |
![[ ]](/icons/unknown.gif) | WHEN & WHILE.docx | 2024-02-10 03:00 | 391K | |
![[ ]](/icons/unknown.gif) | Describing Nouns Fun B 14.1.pptx | 2015-05-28 03:17 | 389K | |
![[ ]](/icons/unknown.gif) | an_on_in_cp.ppt | 2016-03-05 02:46 | 389K | |
![[IMG]](/icons/image2.gif) | PTDC0069.JPG | 2016-11-11 05:04 | 387K | |
![[IMG]](/icons/image2.gif) | PTDC0162.JPG | 2016-10-18 20:13 | 386K | |
![[ ]](/icons/unknown.gif) | Simple past unit 6 book 2.docx | 2020-02-29 17:15 | 385K | |
![[ ]](/icons/unknown.gif) | stative verbs.docx | 2016-11-10 00:11 | 384K | |
![[ ]](/icons/unknown.gif) | there is_a_book.doc | 2018-06-21 00:36 | 382K | |
![[ ]](/icons/unknown.gif) | Present Perfect Tense 9,1.pptx | 2015-12-04 00:56 | 380K | |
![[ ]](/icons/layout.gif) | countries and nationality test doc-.pdf | 2019-02-02 22:14 | 380K | |
![[ ]](/icons/unknown.gif) | HAVE TO HAS TO.docx | 2024-02-28 02:59 | 379K | |
![[ ]](/icons/unknown.gif) | HAVE TO HAS TO (1).docx | 2023-02-01 02:45 | 379K | |
![[IMG]](/icons/image2.gif) | PTDC0038.JPG | 2014-11-20 01:23 | 379K | |
![[ ]](/icons/layout.gif) | time-expressions-and-verb-tenses1.pdf | 2017-04-04 23:22 | 379K | |
![[ ]](/icons/unknown.gif) | PartAdjshow.ppt | 2014-08-01 05:55 | 378K | |
![[IMG]](/icons/image2.gif) | DEVICE.png | 2024-02-02 02:44 | 378K | |
![[ ]](/icons/layout.gif) | FAMILY TREE AST.pdf | 2021-06-16 03:05 | 377K | |
![[ ]](/icons/layout.gif) | COOKING VERBS.pdf | 2022-02-18 01:13 | 376K | |
![[ ]](/icons/unknown.gif) | BE ALLOWED TO.docx | 2024-02-28 03:01 | 375K | |
![[ ]](/icons/unknown.gif) | BE ALLOWED TO (1).docx | 2023-02-01 02:47 | 375K | |
![[ ]](/icons/unknown.gif) | UNIT 3 book 5 grammar.docx | 2021-07-22 01:40 | 374K | |
![[ ]](/icons/unknown.gif) | THIRD CONDITIONAL (1).ppt | 2016-09-28 00:48 | 373K | |
![[ ]](/icons/layout.gif) | Cambridge Phrasal verb book.pdf | 2014-09-02 03:14 | 372K | |
![[ ]](/icons/unknown.gif) | AS...AS EXERCISE.docx | 2023-07-26 02:56 | 371K | |
![[ ]](/icons/unknown.gif) | GERUNDS EXERCISE2.docx | 2019-02-14 18:33 | 370K | |
![[ ]](/icons/unknown.gif) | unit 7 book 5 grammar.docx | 2021-08-17 22:38 | 369K | |
![[ ]](/icons/unknown.gif) | PREPOSITIONS_OF_PLACE PPP.ppt | 2019-01-29 01:34 | 369K | |
![[ ]](/icons/unknown.gif) | PRESENTPERFECT EXERCISE 1.docx | 2021-06-05 18:14 | 369K | |
![[ ]](/icons/layout.gif) | 100 most common esl irregular verbs list.pdf | 2018-11-10 16:08 | 368K | |
![[ ]](/icons/layout.gif) | Level 9 Unit 2 Impact 4 Home-Virtual Class and Final Oral and Written Assessment.pdf | 2020-03-14 17:58 | 365K | |
![[ ]](/icons/layout.gif) | pres. perf..pdf | 2017-07-07 01:48 | 364K | |
![[ ]](/icons/unknown.gif) | phrasalverbs 1 (1).ppt | 2014-09-02 03:17 | 364K | |
![[ ]](/icons/layout.gif) | To_Be_Print_All.pdf | 2020-01-18 00:43 | 363K | |
![[ ]](/icons/layout.gif) | To_Be_All.pdf | 2017-03-18 20:36 | 363K | |
![[ ]](/icons/layout.gif) | irregular+verbs+in+English.pdf | 2018-04-26 13:44 | 362K | |
![[ ]](/icons/unknown.gif) | prepositions (pictures).docx | 2014-02-20 01:30 | 362K | |
![[ ]](/icons/layout.gif) | Ratatouille.pdf | 2021-06-06 02:49 | 360K | |
![[ ]](/icons/unknown.gif) | FOR, TO, SO THAT.ppt | 2024-03-05 03:01 | 360K | |
![[ ]](/icons/unknown.gif) | Body Vocabulary.docx | 2014-10-16 19:07 | 359K | |
![[ ]](/icons/unknown.gif) | Family Tree Voc..ppt | 2021-04-27 03:02 | 357K | |
![[IMG]](/icons/image2.gif) | job presentation hw.PNG | 2021-06-09 01:29 | 355K | |
![[ ]](/icons/unknown.gif) | EXERCISE PAST PROGRESSIVE.docx | 2019-02-20 02:32 | 355K | |
![[ ]](/icons/unknown.gif) | DEMONSTRATIVE EXERCISE 2.docx | 2021-05-05 02:31 | 355K | |
![[ ]](/icons/layout.gif) | should and shouldn´t AST.pdf | 2021-12-16 00:17 | 353K | |
![[ ]](/icons/unknown.gif) | POSSESSIVE NOUNS EXERCISE.docx | 2021-04-29 02:58 | 353K | |
![[ ]](/icons/unknown.gif) | WAS-WERE MIXED.docx | 2017-02-18 17:17 | 351K | |
![[ ]](/icons/unknown.gif) | Presentation Unit 4.ppt | 2020-03-17 00:12 | 351K | |
![[IMG]](/icons/image2.gif) | Mind_Map_Future_Tense-1.jpg | 2015-03-25 04:14 | 349K | |
![[ ]](/icons/unknown.gif) | Presentation Unit 4 (3) (3).ppt | 2020-02-06 22:33 | 349K | |
![[ ]](/icons/unknown.gif) | PRESENT PROGRESSIVE AND SIMPLE PRESENT EXERCISES.docx | 2019-10-24 23:27 | 347K | |
![[ ]](/icons/unknown.gif) | prepositions of place and there is and there are.docx | 2020-01-27 23:44 | 347K | |
![[ ]](/icons/layout.gif) | Infinitives-of-purpose.pdf | 2018-07-28 22:23 | 347K | |
![[ ]](/icons/unknown.gif) | Possessive Adjectives Extra Points FUN A.docx | 2015-04-15 23:00 | 343K | |
![[ ]](/icons/unknown.gif) | there i s and there are exercises (Sat).docx | 2019-10-19 13:02 | 341K | |
![[ ]](/icons/layout.gif) | list-of-irregular-verbs.pdf | 2016-11-19 02:48 | 341K | |
![[ ]](/icons/layout.gif) | Relative Clauses.pdf | 2016-02-04 03:00 | 339K | |
![[ ]](/icons/unknown.gif) | ADJECTIVES EXERCISE.docx | 2021-04-28 03:01 | 339K | |
![[ ]](/icons/unknown.gif) | Exam 10-converted.docx | 2018-12-01 01:27 | 338K | |
![[ ]](/icons/unknown.gif) | MODAL VERBS traveling lesson.ppt | 2021-06-19 17:59 | 337K | |
![[ ]](/icons/unknown.gif) | MODAL VERBS.ppt | 2021-08-05 01:41 | 337K | |
![[ ]](/icons/unknown.gif) | 0 and 1.ppt | 2014-08-22 04:53 | 337K | |
![[ ]](/icons/unknown.gif) | Spelling-Rules-for-ed-and-ing-2gl21tu.pptx | 2016-04-30 18:22 | 336K | |
![[ ]](/icons/unknown.gif) | SPECULATIONS.docx | 2019-08-02 01:46 | 335K | |
![[ ]](/icons/layout.gif) | Adjectives-Physical-Appearance.pdf | 2015-09-25 23:33 | 334K | |
![[ ]](/icons/layout.gif) | AST Rubrics LEVEL 13 STEP BY STEP ONLINE MEETINGS 2021 MR. RODRÍGUEZ.pdf | 2021-08-31 12:12 | 333K | |
![[IMG]](/icons/image2.gif) | Past-simple-tense1.png | 2016-03-05 02:48 | 333K | |
![[ ]](/icons/unknown.gif) | MODAL VERBS..ppt | 2019-01-30 01:48 | 333K | |
![[ ]](/icons/layout.gif) | KITCHEN UTENSILS.pdf | 2022-02-18 01:42 | 333K | |
![[ ]](/icons/layout.gif) | AST Rubrics LEVEL-3 ONLINE MEETINGS 2021 MR. RODRÍGUEZ.pdf | 2021-08-17 23:32 | 332K | |
![[ ]](/icons/unknown.gif) | passive reporting verbs exercises book 5.docx | 2020-09-11 02:20 | 332K | |
![[ ]](/icons/layout.gif) | CLOTHES AND ACCESSORIES PDF AST.pdf | 2022-03-03 01:08 | 332K | |
![[ ]](/icons/unknown.gif) | FAMILY TREE EXERCISE 2.docx | 2019-04-13 00:11 | 331K | |
![[ ]](/icons/unknown.gif) | Family relationship (unit 1 book 2).docx | 2019-07-06 17:35 | 331K | |
![[ ]](/icons/layout.gif) | quintifiers-grammarworksheets.pdf | 2017-08-19 22:19 | 331K | |
![[ ]](/icons/unknown.gif) | Exam 11.docx | 2018-12-15 14:31 | 331K | |
![[ ]](/icons/unknown.gif) | Questions Review UI 2.1.pptx | 2015-05-05 15:55 | 330K | |
![[ ]](/icons/unknown.gif) | Comparative-Superlative Adj..docx | 2017-02-25 02:48 | 330K | |
![[ ]](/icons/layout.gif) | AST RUBRICS CONVERSATION CLUB, ONLINE MEETINGS 2021 MR. RODRÍGUEZ.pdf | 2021-08-31 18:17 | 328K | |
![[ ]](/icons/layout.gif) | INSP1_ws9.pdf | 2019-03-09 22:28 | 326K | |
![[ ]](/icons/unknown.gif) | futurepredictionsdecisionsplanspresentationandpractice-120508080712-phpapp01.pptx | 2015-03-25 04:18 | 325K | |
![[ ]](/icons/layout.gif) | Simple Past Exercises.pdf | 2017-07-29 22:23 | 324K | |
![[ ]](/icons/layout.gif) | narrative_tenses.pdf | 2015-07-28 01:54 | 322K | |
![[ ]](/icons/unknown.gif) | Ordinal Numbers.pptx | 2015-02-07 17:37 | 322K | |
![[ ]](/icons/layout.gif) | AST Rubrics LEVEL 3 ONLINE MEETINGS 2021 MR. RODRÍGUEZ.pdf | 2021-08-08 23:35 | 322K | |
![[ ]](/icons/unknown.gif) | futurepredictionsdecisionsplanspresentationandpractice.pptx | 2014-08-15 23:24 | 321K | |
![[ ]](/icons/layout.gif) | ARTICLES AST.pdf | 2021-12-17 00:48 | 321K | |
![[ ]](/icons/unknown.gif) | relative clauses exercise.docx | 2020-10-24 17:13 | 320K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT EXERCISE 3.docx | 2023-02-11 17:16 | 320K | |
![[ ]](/icons/layout.gif) | narrative_tenses_2.pdf | 2015-08-01 20:54 | 319K | |
![[ ]](/icons/unknown.gif) | futuretenses-120109161101-phpapp02.pps | 2014-08-15 23:14 | 316K | |
![[ ]](/icons/unknown.gif) | UNIT 6 book 4.docx | 2021-08-11 00:50 | 315K | |
![[IMG]](/icons/image2.gif) | family.jpg | 2015-10-24 17:37 | 315K | |
![[ ]](/icons/layout.gif) | AT IN ON PREPOSITIONS AST.pdf | 2021-08-31 01:52 | 311K | |
![[ ]](/icons/layout.gif) | atg-chart_do-go-play2.pdf | 2016-01-23 18:09 | 311K | |
![[ ]](/icons/layout.gif) | spelling-rules-for-tenses1.pdf | 2016-07-23 21:58 | 309K | |
![[ ]](/icons/unknown.gif) | PRESENT PROGRESSIVE OR CONTINUOUS.ppt | 2016-11-29 02:15 | 309K | |
![[ ]](/icons/layout.gif) | question-tags.pdf | 2016-07-28 23:25 | 308K | |
![[IMG]](/icons/image2.gif) | image (5).png | 2024-04-17 02:19 | 308K | |
![[IMG]](/icons/image2.gif) | Modal Verbs.png | 2015-03-25 04:35 | 307K | |
![[ ]](/icons/unknown.gif) | All Conditionals (10 slides).ppt | 2016-05-21 18:08 | 306K | |
![[ ]](/icons/unknown.gif) | All Conditionals (10 slides) (2).ppt | 2014-11-04 03:06 | 306K | |
![[ ]](/icons/unknown.gif) | Possessive Adjectives G 1.4.pptx | 2015-08-03 22:51 | 305K | |
![[ ]](/icons/unknown.gif) | Possessive Adjectives Easy GB 2.2.pptx | 2015-04-08 01:49 | 305K | |
![[ ]](/icons/unknown.gif) | Possessive Adjectives Easy GB 1.4.pptx | 2015-01-20 18:19 | 305K | |
![[ ]](/icons/unknown.gif) | FOOD EXERCISE 2.docx | 2022-08-09 02:49 | 305K | |
![[ ]](/icons/layout.gif) | Regular Verbs.pdf | 2017-07-08 03:03 | 304K | |
![[ ]](/icons/unknown.gif) | PRESENTATION 2 (1).pptx | 2020-02-06 22:31 | 301K | |
![[ ]](/icons/unknown.gif) | Defining Relative Clauses Worksheet.docx | 2019-08-24 17:18 | 301K | |
![[ ]](/icons/layout.gif) | TO BE GOING TO AST.pdf | 2021-09-01 00:47 | 301K | |
![[IMG]](/icons/image2.gif) | parts of the body (1).PNG | 2017-08-05 16:08 | 300K | |
![[ ]](/icons/unknown.gif) | Body Parts Exercise2.doc | 2016-08-23 17:17 | 298K | |
![[IMG]](/icons/image2.gif) | homework family tree.PNG | 2021-01-21 02:52 | 296K | |
![[ ]](/icons/layout.gif) | Present-Perfect-Slides.pdf | 2018-05-19 21:14 | 296K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT EXERCISE 5.docx | 2021-05-27 02:53 | 295K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT EXERCISE 6.docx | 2021-05-27 02:53 | 295K | |
![[ ]](/icons/unknown.gif) | DESCRIBE PEOPLE1.doc | 2023-07-29 17:28 | 293K | |
![[ ]](/icons/unknown.gif) | DESCRIBE PEOPLE1 (1).doc | 2023-02-18 18:09 | 292K | |
![[ ]](/icons/unknown.gif) | FAMILY TREE EXERCISE.docx | 2020-01-14 02:28 | 292K | |
![[ ]](/icons/unknown.gif) | relative-clauses.pptx | 2019-11-06 02:38 | 292K | |
![[ ]](/icons/layout.gif) | Syllabus LIFE Level 3.pdf | 2016-06-27 13:41 | 292K | |
![[ ]](/icons/unknown.gif) | PRESENTATION 2.pptx | 2020-01-10 19:05 | 291K | |
![[IMG]](/icons/image2.gif) | BBC-stockcheck-Diagram.jpg | 2014-08-11 20:20 | 291K | |
![[ ]](/icons/unknown.gif) | FREQUENCY ADVERBS EXERCISE.docx | 2023-07-12 02:58 | 291K | |
![[ ]](/icons/unknown.gif) | FREQUENCY ADVERBS EXERCISE (1).docx | 2017-03-04 02:30 | 291K | |
![[ ]](/icons/layout.gif) | Syllabus LIFE Level 6-Raquel Molina.pdf | 2016-04-05 14:33 | 290K | |
![[ ]](/icons/unknown.gif) | RELATIVE CLAUSES.ppt | 2023-12-19 02:56 | 290K | |
![[ ]](/icons/unknown.gif) | RELATIVE_CLAUSES.ppt | 2014-02-08 15:49 | 288K | |
![[ ]](/icons/unknown.gif) | RELATIVE_CLAUSES (2).ppt | 2014-07-26 15:38 | 288K | |
![[ ]](/icons/unknown.gif) | RELATIVE_CLAUSES (1).ppt | 2014-04-26 15:13 | 288K | |
![[ ]](/icons/unknown.gif) | UNIT 4 book 2 grammar.docx | 2021-05-22 13:44 | 287K | |
![[ ]](/icons/layout.gif) | gerund or infinitive after adjectives grammar information esl worksheet.pdf | 2016-05-05 02:58 | 287K | |
![[ ]](/icons/layout.gif) | Syllabus LIFE Level 3-Raquel Molina.pdf | 2016-07-01 19:04 | 287K | |
![[ ]](/icons/layout.gif) | gerund and infinitive 3.pdf | 2015-02-17 02:10 | 287K | |
![[ ]](/icons/layout.gif) | Past-Simple-practice.pdf | 2019-06-01 17:42 | 285K | |
![[IMG]](/icons/image2.gif) | thor.jpg | 2013-10-31 02:20 | 284K | |
![[ ]](/icons/unknown.gif) | SingularPluralandPossessive Nouns.doc | 2018-02-01 23:25 | 283K | |
![[ ]](/icons/layout.gif) | Was, Were.pdf | 2016-08-06 03:01 | 283K | |
![[ ]](/icons/unknown.gif) | action and state verbs level 3.pptx | 2014-09-27 14:00 | 281K | |
![[ ]](/icons/layout.gif) | comparative Adjectives AST.pdf | 2021-08-10 00:53 | 281K | |
![[ ]](/icons/layout.gif) | all_tenses_form_cheatsheet.pdf | 2020-07-14 02:02 | 280K | |
![[IMG]](/icons/image2.gif) | homework possessive adjective.PNG | 2021-03-25 02:35 | 279K | |
![[ ]](/icons/layout.gif) | Present-Simple-Tense.pdf | 2019-10-19 12:09 | 278K | |
![[ ]](/icons/unknown.gif) | phrasal verbs to teach.ppt | 2014-09-02 03:19 | 276K | |
![[ ]](/icons/unknown.gif) | Doc1.docx | 2020-04-15 21:44 | 274K | |
![[ ]](/icons/unknown.gif) | RELATIVE CLAUSES (2).ppt | 2024-02-10 18:03 | 274K | |
![[ ]](/icons/unknown.gif) | MOVIE WORKSHEET.docx | 2021-05-29 18:13 | 273K | |
![[ ]](/icons/unknown.gif) | Movie Reviews.docx | 2023-08-26 18:03 | 273K | |
![[IMG]](/icons/image2.gif) | hw good news.PNG | 2022-07-13 04:40 | 272K | |
![[ ]](/icons/unknown.gif) | ADVERBS OF FREQUENCY level 1.docx | 2017-08-19 18:09 | 271K | |
![[ ]](/icons/unknown.gif) | PREPOSITIONS EXERCISE 3.docx | 2024-01-27 18:14 | 269K | |
![[ ]](/icons/unknown.gif) | A lot of vs Lots of and many vs much G 4.4.pptx | 2015-09-01 00:30 | 268K | |
![[ ]](/icons/unknown.gif) | Introduction (2).ppt | 2023-01-28 18:06 | 268K | |
![[ ]](/icons/layout.gif) | JOBS AND OCCUPATIONS AST.pdf | 2021-06-30 00:12 | 267K | |
![[IMG]](/icons/image2.gif) | irregular verbs image.jpg | 2021-08-06 01:05 | 267K | |
![[ ]](/icons/unknown.gif) | Introduction.ppt | 2024-04-14 03:46 | 266K | |
![[ ]](/icons/unknown.gif) | Comparative and Superlative 9.2.pptx | 2015-12-04 00:55 | 265K | |
![[ ]](/icons/layout.gif) | irregular-plural-nouns.pdf | 2016-10-15 21:59 | 263K | |
![[ ]](/icons/unknown.gif) | UNIT 6 grammar.docx | 2021-08-11 02:14 | 263K | |
![[ ]](/icons/unknown.gif) | OBJECT AND SUBJECT QUESTIONS.ppt | 2016-01-15 03:00 | 263K | |
![[ ]](/icons/layout.gif) | past-simple-past-continous-exercises (1).pdf | 2017-08-12 20:35 | 263K | |
![[ ]](/icons/layout.gif) | To_Be_Entire_Unit.pdf | 2017-07-08 00:18 | 263K | |
![[ ]](/icons/unknown.gif) | VERB_TO_BE.ppt | 2023-01-28 18:07 | 262K | |
![[ ]](/icons/unknown.gif) | DESCRIBING PEOPLE EXERCISE.docx | 2019-10-30 00:45 | 260K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT 2.docx | 2019-10-12 17:54 | 259K | |
![[ ]](/icons/layout.gif) | Level 3 Places to go.pdf | 2017-02-11 03:06 | 256K | |
![[ ]](/icons/layout.gif) | animals_in_the_city_level_1-exercise.pdf | 2015-11-04 16:46 | 256K | |
![[ ]](/icons/layout.gif) | Conversation in Passive Voice.pdf | 2016-01-28 02:38 | 255K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST VERB TO BE.ppt | 2018-04-27 00:52 | 253K | |
![[ ]](/icons/layout.gif) | COUNT AND NONCOUNT.pdf | 2016-11-19 00:03 | 252K | |
![[ ]](/icons/layout.gif) | most-common-irregular-verbs (2).pdf | 2017-09-23 01:36 | 252K | |
![[ ]](/icons/layout.gif) | atg-quiz-indefpron.pdf | 2018-08-25 21:01 | 251K | |
![[IMG]](/icons/image2.gif) | Live Worksheet Going to.jpg | 2023-05-20 14:32 | 250K | |
![[ ]](/icons/layout.gif) | gs_question_words_-_exercises.pdf | 2018-04-21 01:46 | 250K | |
![[ ]](/icons/unknown.gif) | Speculation New.docx | 2019-05-07 01:00 | 250K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT SENTENCES.docx | 2017-05-19 17:34 | 249K | |
![[ ]](/icons/layout.gif) | RWC_chapter4- main idea supporting details.pdf | 2018-05-26 21:04 | 249K | |
![[ ]](/icons/layout.gif) | Irregular Simple Past Verbs AST.pdf | 2022-02-23 22:05 | 248K | |
![[ ]](/icons/layout.gif) | present perfect test.pdf | 2017-07-07 01:51 | 248K | |
![[ ]](/icons/layout.gif) | animals_in_the_city.pdf | 2015-11-04 16:45 | 248K | |
![[ ]](/icons/unknown.gif) | AST UNIT 10 WRITTEN QUIZ ANSWERS PAPER LEVEL-3 STEP BY STEP 2021 (JULY-AUGUST).docx | 2021-08-08 22:16 | 247K | |
![[ ]](/icons/layout.gif) | indefinite pronouns 1.pdf | 2018-06-19 00:40 | 244K | |
![[ ]](/icons/layout.gif) | quantifiers much many.pdf | 2017-08-19 22:19 | 244K | |
![[ ]](/icons/layout.gif) | COUNTRIES-AND-NATIONALITIES-exercises-and-key.pdf | 2016-10-15 22:11 | 244K | |
![[ ]](/icons/layout.gif) | Tellling Time AST.pdf | 2021-06-28 17:56 | 243K | |
![[ ]](/icons/unknown.gif) | Clothing Exercise.docx | 2017-03-14 01:01 | 242K | |
![[ ]](/icons/unknown.gif) | Clothing.docx | 2019-10-23 00:48 | 242K | |
![[ ]](/icons/unknown.gif) | COMPARATIVES AND SUPERLATIVES EXERCISE (3).doc | 2023-05-12 02:59 | 242K | |
![[ ]](/icons/layout.gif) | UNIT #2 TEST AST.pdf | 2021-06-29 01:37 | 242K | |
![[ ]](/icons/layout.gif) | Irregular Past and Past Participle Verbs.pdf | 2022-03-17 00:39 | 242K | |
![[ ]](/icons/unknown.gif) | COMPARATIVES AND SUPERLATIVES EXERCISE1.doc | 2022-03-17 02:58 | 242K | |
![[ ]](/icons/unknown.gif) | COMPARATIVES AND SUPERLATIVES EXERCISE.doc | 2023-11-29 02:55 | 242K | |
![[ ]](/icons/unknown.gif) | COMPARATIVES AND SUPERLATIVES EXERCISE (2).doc | 2023-01-28 18:11 | 242K | |
![[ ]](/icons/unknown.gif) | COMPARATIVES_AND_SUPERLATIVES_EXERCISE.doc | 2014-08-23 17:42 | 241K | |
![[ ]](/icons/unknown.gif) | COMPARATIVES AND SUPERLATIVES EXERCISE (1).doc | 2023-02-09 02:52 | 241K | |
![[ ]](/icons/layout.gif) | atg-quiz-possadjpron-subjobj.pdf | 2023-03-02 03:04 | 240K | |
![[ ]](/icons/layout.gif) | DESCRIBING PEOPLE PDF AST.pdf | 2022-03-03 02:52 | 239K | |
![[ ]](/icons/unknown.gif) | if.ppt | 2016-07-23 00:34 | 239K | |
![[ ]](/icons/layout.gif) | Third & Mixed conditionals ESL Library.pdf | 2017-05-03 01:44 | 238K | |
![[ ]](/icons/unknown.gif) | 2ND CONDITIONAL.docx | 2023-12-15 02:59 | 238K | |
![[ ]](/icons/layout.gif) | Simple Past VRS Present Perfect.pdf | 2017-08-28 03:42 | 237K | |
![[ ]](/icons/layout.gif) | REGULAR AND IRREGULAR VERBS AST.pdf | 2022-02-26 02:30 | 236K | |
![[ ]](/icons/layout.gif) | atg-quiz-thereisthereare2.pdf | 2019-10-26 22:22 | 236K | |
![[ ]](/icons/unknown.gif) | UNIT 1 grammar book 5.docx | 2021-09-29 00:59 | 235K | |
![[ ]](/icons/layout.gif) | WILL AND WON´T AST.pdf | 2021-09-22 00:50 | 234K | |
![[IMG]](/icons/image2.gif) | Quantifiers.cmap.jpg | 2015-08-05 23:17 | 233K | |
![[IMG]](/icons/image2.gif) | Quantifiers.cmap (1).jpg | 2015-02-14 18:08 | 233K | |
![[ ]](/icons/unknown.gif) | REPORTED SPEECH EXERCISE.docx | 2021-12-11 02:57 | 233K | |
![[ ]](/icons/layout.gif) | comparatives_superlatives_worksheet_with_answers.pdf | 2018-01-13 22:18 | 233K | |
![[ ]](/icons/unknown.gif) | DESCRIBE PEOPLE 3.doc | 2023-08-05 18:14 | 233K | |
![[ ]](/icons/layout.gif) | Present Perfect AST.pdf | 2021-12-09 02:58 | 233K | |
![[ ]](/icons/layout.gif) | PRESENT PERFECT PACK AST.pdf | 2022-03-24 00:08 | 233K | |
![[ ]](/icons/layout.gif) | 7.Present-Perfect.pdf | 2020-01-22 00:24 | 233K | |
![[ ]](/icons/unknown.gif) | UNIT 9 grammar book 3.docx | 2021-06-05 00:53 | 233K | |
![[ ]](/icons/unknown.gif) | DESCRIBE PEOPLE 3 (2).doc | 2023-02-18 18:10 | 233K | |
![[ ]](/icons/unknown.gif) | Intro Second Conditional..ppt | 2017-09-06 23:50 | 230K | |
![[ ]](/icons/unknown.gif) | Unit 2 book 4.docx | 2021-07-13 00:40 | 229K | |
![[ ]](/icons/layout.gif) | Personal Information AST.pdf | 2022-01-25 17:01 | 228K | |
![[ ]](/icons/unknown.gif) | UNIT 8 GRAMMAR LEVEL 4.docx | 2021-08-25 02:14 | 228K | |
![[ ]](/icons/unknown.gif) | Presentation Unit 1.pptx | 2020-10-18 17:41 | 228K | |
![[ ]](/icons/unknown.gif) | review of present tenses.docx | 2019-01-14 22:45 | 227K | |
![[ ]](/icons/unknown.gif) | UNIT 8 GRAMMAR EXPLANATION.docx | 2020-02-28 02:39 | 227K | |
![[ ]](/icons/unknown.gif) | means of transportation.pptx | 2016-11-01 01:42 | 226K | |
![[ ]](/icons/layout.gif) | Present Continuous Elementary.pdf | 2018-01-27 21:25 | 225K | |
![[ ]](/icons/unknown.gif) | Indirect Questions Exercise.docx | 2024-01-27 02:58 | 225K | |
![[ ]](/icons/unknown.gif) | Indirect Questions Exercise (1).docx | 2022-10-15 02:59 | 225K | |
![[ ]](/icons/unknown.gif) | regular verbs exercise.docx | 2017-02-14 23:53 | 224K | |
![[ ]](/icons/unknown.gif) | THERE IS-ARE.docx | 2019-04-26 02:20 | 224K | |
![[ ]](/icons/unknown.gif) | Irregular Verbs Past 1.doc | 2017-03-17 01:49 | 224K | |
![[ ]](/icons/unknown.gif) | spellingrules.ppt | 2014-09-11 04:25 | 223K | |
![[IMG]](/icons/image2.gif) | SUBJECT VERB RULES 1_6.PNG | 2021-12-07 23:58 | 223K | |
![[IMG]](/icons/image2.gif) | prepo.png | 2014-08-29 02:29 | 222K | |
![[ ]](/icons/unknown.gif) | So that, for, to exercise.docx | 2024-03-05 03:09 | 222K | |
![[ ]](/icons/layout.gif) | Verb-to-be.pdf | 2019-10-18 22:14 | 222K | |
![[ ]](/icons/layout.gif) | should_shouldnt.pdf | 2017-08-09 00:43 | 220K | |
![[ ]](/icons/layout.gif) | shoul_shouldn´t[1] (1).pdf | 2016-09-13 00:59 | 220K | |
![[IMG]](/icons/image2.gif) | USING ARTICLES AST.jpg | 2021-12-17 00:46 | 220K | |
![[ ]](/icons/unknown.gif) | Countries and Nationalities..doc | 2018-08-14 02:28 | 219K | |
![[ ]](/icons/layout.gif) | UNIT #9 TEST AST .pdf | 2021-12-04 00:51 | 218K | |
![[ ]](/icons/unknown.gif) | Countries_and_Nationalities.doc | 2018-02-23 01:38 | 218K | |
![[ ]](/icons/unknown.gif) | Countries_and_Nationalities (1).doc | 2018-06-28 01:58 | 218K | |
![[ ]](/icons/layout.gif) | countries-and-nationalities.pdf | 2019-02-02 22:15 | 218K | |
![[ ]](/icons/unknown.gif) | PLURAL NOUNS.docx | 2016-01-30 22:16 | 218K | |
![[ ]](/icons/layout.gif) | Phrasal verb.pdf | 2016-01-27 01:26 | 217K | |
![[ ]](/icons/unknown.gif) | SUPERLATIVES.doc | 2022-06-23 04:13 | 215K | |
![[ ]](/icons/unknown.gif) | plural_of_nouns[1].doc | 2018-06-19 01:57 | 214K | |
![[ ]](/icons/unknown.gif) | plural_of_nouns.doc | 2021-04-23 02:58 | 214K | |
![[ ]](/icons/unknown.gif) | mixed PRONOUNS.docx | 2016-07-05 02:47 | 214K | |
![[ ]](/icons/layout.gif) | Future_Tense_Exercise_1and2.pdf | 2018-03-10 02:08 | 212K | |
![[ ]](/icons/layout.gif) | Verbs-Followed-by-Gerunds-and-Infinitives.pdf | 2016-11-03 01:22 | 212K | |
![[ ]](/icons/unknown.gif) | was-and-were-1-exercises-grammar-.doc | 2019-05-04 16:20 | 212K | |
![[ ]](/icons/layout.gif) | Simple Present VS. Present Progressive.pdf | 2016-09-05 02:15 | 211K | |
![[ ]](/icons/layout.gif) | Tarjetas_de_memorización (1).pdf | 2018-04-20 01:12 | 211K | |
![[ ]](/icons/layout.gif) | UNIT #12 TEST AST WORD KEY_ANSWERS.pdf | 2021-09-30 12:52 | 211K | |
![[ ]](/icons/unknown.gif) | Conditionals worksheet 1.docx | 2017-05-10 15:43 | 210K | |
![[ ]](/icons/layout.gif) | FINAL ORAL PRESENTATION AST.pdf | 2022-03-24 00:24 | 209K | |
![[ ]](/icons/unknown.gif) | There_to_be_room.doc | 2018-09-11 02:06 | 209K | |
![[ ]](/icons/unknown.gif) | -ING EXERCISE..docx | 2023-05-13 18:11 | 209K | |
![[ ]](/icons/layout.gif) | Irregular Verbs List.pdf | 2017-07-08 03:04 | 209K | |
![[ ]](/icons/unknown.gif) | -ING EXERCISE. (1).docx | 2018-11-02 01:32 | 209K | |
![[ ]](/icons/layout.gif) | Countables-uncountables.pdf | 2019-03-02 02:30 | 209K | |
![[ ]](/icons/unknown.gif) | fruits_and_vegetables[2].doc | 2019-02-25 05:58 | 209K | |
![[ ]](/icons/unknown.gif) | FAMILY VOCAB.docx | 2017-04-22 18:14 | 208K | |
![[ ]](/icons/unknown.gif) | FAMILY VOCAB (1).docx | 2017-09-30 17:40 | 208K | |
![[ ]](/icons/layout.gif) | UNIT #12 TEST AST .pdf | 2021-12-18 01:56 | 208K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT PROGRESSIVE.docx | 2019-02-20 00:37 | 208K | |
![[ ]](/icons/layout.gif) | PRESENT PERFECT FOR AND SINCE EXERCISE..pdf | 2017-07-12 23:34 | 208K | |
![[ ]](/icons/unknown.gif) | Unit ! Assessment.docx | 2023-01-28 00:25 | 208K | |
![[ ]](/icons/layout.gif) | Updated_Carta de entrega ebook VitalSource (2).pdf | 2020-04-28 01:41 | 207K | |
![[IMG]](/icons/image2.gif) | pets.jpg | 2017-06-04 04:06 | 207K | |
![[ ]](/icons/unknown.gif) | COMPARATIVE EXERCISE.doc | 2024-04-14 03:49 | 207K | |
![[ ]](/icons/layout.gif) | 20130923015933.pdf | 2013-10-08 03:06 | 206K | |
![[ ]](/icons/unknown.gif) | Quiz used to or could.docx | 2016-07-26 02:02 | 206K | |
![[ ]](/icons/layout.gif) | Simple Present Exercises - Level 1.pdf | 2014-07-31 02:54 | 205K | |
![[ ]](/icons/unknown.gif) | There_to_be_room (1).doc | 2021-06-01 02:56 | 205K | |
![[ ]](/icons/unknown.gif) | mixed conditional (situations).docx | 2018-11-08 02:38 | 205K | |
![[ ]](/icons/layout.gif) | L52-Adverbs-of-Manner.pdf | 2019-02-23 21:23 | 205K | |
![[ ]](/icons/layout.gif) | can-can-t.pdf | 2019-11-16 19:33 | 204K | |
![[ ]](/icons/unknown.gif) | Delectronics_pict.[1].doc | 2022-10-22 17:21 | 204K | |
![[ ]](/icons/unknown.gif) | PASSIVE EXERCISE IN CLASS.pptx | 2023-12-09 03:02 | 203K | |
![[ ]](/icons/unknown.gif) | Comparative Exercise 2.doc | 2018-04-14 17:59 | 202K | |
![[ ]](/icons/unknown.gif) | SECOND CONDITIONAL TYPE 2.docx | 2022-12-21 03:07 | 201K | |
![[ ]](/icons/unknown.gif) | means_of_transport_picture_crossword[1].doc | 2018-11-07 02:01 | 201K | |
![[ ]](/icons/unknown.gif) | SUPERLATIVE EXERCISE.doc | 2022-06-21 02:15 | 201K | |
![[ ]](/icons/layout.gif) | world_english_3e_level_intro_grammar_activities_unit_1_lesson_a.pdf | 2023-10-18 20:11 | 200K | |
![[ ]](/icons/unknown.gif) | Introduce yourself.docx | 2022-02-01 20:09 | 200K | |
![[ ]](/icons/layout.gif) | world_english_Unit 10 goal c should.pdf | 2023-05-06 16:16 | 200K | |
![[ ]](/icons/layout.gif) | UNIT #9 TEST AST INTENSIVE.pdf | 2022-03-12 02:30 | 198K | |
![[ ]](/icons/unknown.gif) | adjectives_of_personality.doc | 2017-04-08 16:23 | 197K | |
![[ ]](/icons/layout.gif) | BEGvoc2-5.pdfpossessive adjectives.pdf | 2018-07-14 02:18 | 197K | |
![[ ]](/icons/layout.gif) | BEGvoc2-5.pdf | 2018-09-22 01:57 | 197K | |
![[ ]](/icons/layout.gif) | IN ON AT #2 AST.pdf | 2022-03-14 23:46 | 197K | |
![[ ]](/icons/layout.gif) | Exercises Using Imperatives.pdf | 2016-01-22 01:56 | 196K | |
![[ ]](/icons/layout.gif) | DO AND MAKE AST.pdf | 2022-02-10 00:24 | 196K | |
![[ ]](/icons/layout.gif) | COLLOCATIONS DO MAKE AST.pdf | 2021-07-02 00:48 | 196K | |
![[ ]](/icons/layout.gif) | past-simple-continuous-exercise-2.pdf | 2017-05-06 01:19 | 195K | |
![[IMG]](/icons/image2.gif) | singularandplural.jpg | 2019-08-08 01:09 | 195K | |
![[ ]](/icons/unknown.gif) | elecrical_match[1].doc | 2023-10-28 17:34 | 194K | |
![[ ]](/icons/layout.gif) | Past Simple_Comprehension.pdf | 2021-08-03 00:35 | 194K | |
![[ ]](/icons/layout.gif) | PAST SIMPLE IRREGULAR VERBS AST.pdf | 2022-02-23 22:12 | 194K | |
![[ ]](/icons/unknown.gif) | infinitive of purpose.docx | 2016-11-15 23:43 | 193K | |
![[ ]](/icons/unknown.gif) | FRUITS AND VEGETABLES EXERCISE.docx | 2017-02-17 01:21 | 193K | |
![[IMG]](/icons/image2.gif) | homework shopping list countable_ uncountable.PNG | 2021-04-29 02:27 | 193K | |
![[ ]](/icons/layout.gif) | Commas.pdf | 2017-06-03 02:31 | 192K | |
![[ ]](/icons/layout.gif) | reported-passives.pdf | 2015-07-24 02:39 | 192K | |
![[ ]](/icons/layout.gif) | State Verbs and Action Verbs Content.pdf | 2015-07-02 02:58 | 191K | |
![[ ]](/icons/unknown.gif) | ELLIPSISIS LEVEL 5 AND 9 UNIT 1.pptx | 2017-05-15 23:18 | 191K | |
![[ ]](/icons/layout.gif) | PrimaryCardinalOrdinal1.pdf | 2019-02-09 21:13 | 191K | |
![[ ]](/icons/layout.gif) | pastsimpleregularexercises.pdf | 2015-02-19 00:21 | 191K | |
![[ ]](/icons/layout.gif) | elementarypastsimpleregularexercises.pdf | 2018-09-28 23:40 | 191K | |
![[ ]](/icons/unknown.gif) | Third conditional exercise.docx | 2020-08-27 21:14 | 190K | |
![[ ]](/icons/unknown.gif) | Family Tree 2.doc | 2021-04-27 03:04 | 190K | |
![[ ]](/icons/unknown.gif) | Family Tree 1.doc | 2017-01-25 02:20 | 190K | |
![[ ]](/icons/unknown.gif) | RELATIVE CLAUSES EXERCISE NEW.docx | 2020-02-14 00:57 | 189K | |
![[ ]](/icons/layout.gif) | SIMPLE PAST WITH RULES AST.pdf | 2021-08-04 00:56 | 189K | |
![[IMG]](/icons/image2.gif) | objects pronouns.jpg | 2023-03-24 19:15 | 189K | |
![[ ]](/icons/unknown.gif) | wil wont (sat).docx | 2020-06-19 21:38 | 189K | |
![[ ]](/icons/layout.gif) | Simple-present-test.pdf | 2019-10-18 21:42 | 188K | |
![[ ]](/icons/layout.gif) | countable and uncountable nouns exercises #2.pdf | 2022-02-16 18:27 | 188K | |
![[ ]](/icons/layout.gif) | atg-quiz-someany.pdf | 2019-03-02 02:22 | 188K | |
![[ ]](/icons/layout.gif) | when while 1.pdf | 2016-08-13 22:46 | 186K | |
![[ ]](/icons/layout.gif) | atg-quiz-andbutsobecause.pdf | 2017-07-15 21:18 | 186K | |
![[ ]](/icons/layout.gif) | PRESENT_SIMPLE.pdf | 2016-07-23 21:57 | 186K | |
![[ ]](/icons/layout.gif) | PRESENT SIMPLE, superguay.pdf | 2013-12-01 01:06 | 186K | |
![[ ]](/icons/layout.gif) | PRESENT SIMPLE, pdf.pdf | 2017-08-25 01:28 | 186K | |
![[ ]](/icons/layout.gif) | PRESENT SIMPLE,.pdf | 2017-04-20 02:41 | 186K | |
![[ ]](/icons/layout.gif) | Song--because-you-loved-me.pdf | 2019-05-25 17:19 | 185K | |
![[ ]](/icons/layout.gif) | elementarysubjectpronounsandpossessiveadjectivesexercises.pdf | 2018-09-22 01:56 | 185K | |
![[ ]](/icons/layout.gif) | Simple Present Exercises - Fun 1.pdf | 2014-11-20 01:45 | 185K | |
![[ ]](/icons/layout.gif) | Simple Present Exercises - Fun I.pdf | 2015-02-13 01:53 | 185K | |
![[ ]](/icons/layout.gif) | art003-definite-indefinite-articles.pdf | 2018-12-01 22:32 | 183K | |
![[ ]](/icons/layout.gif) | elementarypresentcontinuousexercises.pdf | 2018-07-21 21:12 | 183K | |
![[ ]](/icons/layout.gif) | Present ContInuous#1 AST.pdf | 2022-03-03 15:51 | 183K | |
![[ ]](/icons/unknown.gif) | Irregular Verbs Past 2.doc | 2017-03-17 01:50 | 183K | |
![[ ]](/icons/unknown.gif) | Gerunds_and_Infinitives 1.ppt | 2015-09-02 01:55 | 183K | |
![[ ]](/icons/layout.gif) | PreInt-Intermediate_ReadingComprehension.pdf | 2016-04-20 23:06 | 182K | |
![[ ]](/icons/layout.gif) | elementarypresentsimpleexercises.pdf | 2019-02-09 21:12 | 181K | |
![[ ]](/icons/layout.gif) | Possessive Pronouns and Adjectives Warm Up AST.pdf | 2021-06-18 00:36 | 181K | |
![[ ]](/icons/layout.gif) | elementary_present_continuous_exercises(2).pdf | 2016-04-08 01:05 | 181K | |
![[ ]](/icons/layout.gif) | this that these those.pdf | 2019-07-20 00:51 | 181K | |
![[ ]](/icons/unknown.gif) | Any.docx | 2015-04-15 23:31 | 180K | |
![[ ]](/icons/layout.gif) | Directions-Worksheet-Reading-Worksheet AST.pdf | 2022-02-03 00:17 | 180K | |
![[ ]](/icons/layout.gif) | elementarypresentsimpleexercises(1).pdf | 2016-04-07 00:57 | 179K | |
![[ ]](/icons/layout.gif) | Scoring Rubric for Oral Presentations.pdf | 2017-02-18 22:46 | 179K | |
![[ ]](/icons/unknown.gif) | IMPERSONAL PASSIVE.pptx | 2015-07-24 02:40 | 178K | |
![[ ]](/icons/unknown.gif) | First Conditional.ppt | 2024-02-29 02:53 | 178K | |
![[ ]](/icons/layout.gif) | elementarbegoingtoexercises.pdf | 2018-10-27 20:15 | 177K | |
![[ ]](/icons/unknown.gif) | either both.docx | 2020-08-11 22:04 | 176K | |
![[ ]](/icons/unknown.gif) | GERUNDS EXERCISE.docx | 2020-01-22 01:35 | 175K | |
![[ ]](/icons/layout.gif) | ARTICLES.pdf | 2016-03-02 01:19 | 174K | |
![[ ]](/icons/layout.gif) | Unit 3 Content.pdf | 2015-08-13 02:21 | 174K | |
![[ ]](/icons/unknown.gif) | unit 2 grammar -book 3.docx | 2021-07-24 14:56 | 174K | |
![[ ]](/icons/layout.gif) | elementarypresentcontinuousandpresentsimpleexercises (1).pdf | 2014-05-07 00:29 | 174K | |
![[ ]](/icons/unknown.gif) | used to exercise.docx | 2016-08-10 22:54 | 174K | |
![[ ]](/icons/unknown.gif) | ZERO CONDITIONAL EX.docx | 2023-11-04 18:08 | 174K | |
![[ ]](/icons/layout.gif) | 72_Dress-Codes_US_Student.pdf | 2017-07-07 04:15 | 173K | |
![[ ]](/icons/layout.gif) | simple past tense jack and the beanstalk 1 (1).pdf | 2015-08-01 17:22 | 173K | |
![[ ]](/icons/unknown.gif) | FIRST CONDITIONAL EX.docx | 2024-02-10 18:01 | 173K | |
![[IMG]](/icons/image2.gif) | Future Tenses chart.jpg | 2014-08-15 23:23 | 173K | |
![[IMG]](/icons/image2.gif) | future tenses cheat sheet.jpg | 2014-08-15 23:15 | 172K | |
![[ ]](/icons/layout.gif) | elementarypresentcontinuousforfutureuseexercises.pdf | 2018-06-16 21:46 | 172K | |
![[ ]](/icons/layout.gif) | atg-quiz-thisthatthesethose2.pdf | 2019-10-26 22:23 | 172K | |
![[ ]](/icons/layout.gif) | Compare-Contrast-Transitions.pdf | 2021-11-02 12:52 | 172K | |
![[ ]](/icons/unknown.gif) | Review Present tenses 1.2.pptx | 2015-04-21 01:36 | 171K | |
![[ ]](/icons/layout.gif) | Past-simple-tense.pdf | 2019-05-31 16:43 | 171K | |
![[ ]](/icons/layout.gif) | simple past tense rapunzel 1.pdf | 2016-04-09 20:31 | 171K | |
![[ ]](/icons/layout.gif) | Present_Perfect.pdf | 2014-02-21 02:36 | 171K | |
![[ ]](/icons/layout.gif) | Prepositions of Place.pdf | 2024-04-27 13:47 | 171K | |
![[ ]](/icons/layout.gif) | expressionsofquantityexercises.pdf | 2017-06-03 02:35 | 171K | |
![[IMG]](/icons/image2.gif) | DO AND MAKE COLLOCATIONS POSTER AST.jpg | 2022-02-10 00:23 | 170K | |
![[IMG]](/icons/image2.gif) | irregular verbs list.png | 2019-01-14 20:06 | 170K | |
![[ ]](/icons/unknown.gif) | USED TO.docx | 2019-06-01 17:34 | 170K | |
![[ ]](/icons/unknown.gif) | presenttobe-120127084759-phpapp02.pps | 2014-04-12 17:41 | 168K | |
![[IMG]](/icons/image2.gif) | ordinal-numbers-english.jpg | 2018-05-19 01:08 | 168K | |
![[ ]](/icons/unknown.gif) | homophones-exercises.pptx | 2016-02-06 18:27 | 167K | |
![[IMG]](/icons/image2.gif) | adjective order.gif | 2018-10-12 23:13 | 167K | |
![[ ]](/icons/unknown.gif) | REGULAR VERBS (4).doc | 2015-01-27 02:35 | 167K | |
![[ ]](/icons/layout.gif) | will-vs-going-to1 PDF AST.pdf | 2022-03-11 00:00 | 166K | |
![[ ]](/icons/unknown.gif) | Inspired 2_test_U6_ standard.doc | 2015-11-07 15:41 | 165K | |
![[ ]](/icons/layout.gif) | Possessive nouns AST.pdf | 2022-01-29 02:55 | 165K | |
![[ ]](/icons/layout.gif) | Common Irregular Verbs.pdf | 2016-09-07 14:01 | 165K | |
![[ ]](/icons/unknown.gif) | Future tenses review (level 4).docx | 2020-08-03 21:46 | 163K | |
![[ ]](/icons/unknown.gif) | Inspired_3_U7_Test_basic.doc | 2016-09-03 17:40 | 163K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT EX.docx | 2016-07-09 17:59 | 163K | |
![[ ]](/icons/layout.gif) | 2_Simple-Present (1).pdf | 2018-11-03 02:30 | 163K | |
![[ ]](/icons/layout.gif) | IMPERSONAL PASSIVE PDF.pdf | 2015-07-28 01:50 | 163K | |
![[ ]](/icons/unknown.gif) | Inspired_3_U2_Test_standard.doc | 2015-05-16 17:25 | 163K | |
![[ ]](/icons/layout.gif) | SUPERLATIVE RULES.pdf | 2021-04-19 19:40 | 162K | |
![[ ]](/icons/unknown.gif) | bored or boring.docx | 2013-11-23 22:12 | 162K | |
![[ ]](/icons/unknown.gif) | Inspired 2_test_U7_ standard.doc | 2015-12-05 18:01 | 162K | |
![[ ]](/icons/layout.gif) | order of adjectives.pdf | 2019-10-26 22:27 | 162K | |
![[ ]](/icons/layout.gif) | order of adjectives (1).pdf | 2017-01-20 23:22 | 162K | |
![[ ]](/icons/layout.gif) | Countable Nouns (2) (1).pdf | 2015-10-30 00:18 | 161K | |
![[ ]](/icons/unknown.gif) | Present_continuous_2.doc | 2016-12-06 17:14 | 161K | |
![[ ]](/icons/layout.gif) | Grammar Quiz.pdf | 2016-09-11 19:07 | 161K | |
![[ ]](/icons/unknown.gif) | Inspired 2_test_U8_ standard.doc | 2016-09-10 15:54 | 161K | |
![[ ]](/icons/layout.gif) | auxiliary verbs was-wasn't-were-weren't-did-didn't 1.pdf | 2017-02-14 23:56 | 160K | |
![[ ]](/icons/unknown.gif) | Present_continuous[13].doc | 2016-08-23 00:47 | 160K | |
![[ ]](/icons/unknown.gif) | Inspired_3_U4_Test_basic.doc | 2015-09-12 16:39 | 160K | |
![[ ]](/icons/unknown.gif) | FAMILY TREES CROSSWORD.docx | 2021-04-27 03:06 | 159K | |
![[ ]](/icons/unknown.gif) | 30 New Modal Perfect Exercises.docx | 2015-03-04 00:26 | 157K | |
![[ ]](/icons/unknown.gif) | PASSIVE EXERCISE IN CLASS (3).pptx | 2022-12-15 02:55 | 156K | |
![[ ]](/icons/unknown.gif) | PASSIVE EXERCISE IN CLASS (4).pptx | 2023-03-29 02:55 | 156K | |
![[ ]](/icons/layout.gif) | Irregular Verbs - Final Test.pdf | 2016-06-14 18:51 | 156K | |
![[ ]](/icons/layout.gif) | basic_punctuation_rules.pdf | 2017-06-03 02:29 | 156K | |
![[ ]](/icons/unknown.gif) | Inspired_3_U1_Test_basic.doc | 2015-05-16 15:52 | 156K | |
![[ ]](/icons/unknown.gif) | GERUNDS WORKSHEET.docx | 2019-07-05 02:06 | 155K | |
![[ ]](/icons/layout.gif) | Simple Past Vs. Past Progressive.pdf | 2016-11-27 22:16 | 155K | |
![[ ]](/icons/unknown.gif) | UNIT 9 (GRAMMAR).docx | 2021-03-08 23:57 | 155K | |
![[ ]](/icons/unknown.gif) | Inspired_3_U2_Test_basic.doc | 2015-05-23 16:25 | 155K | |
![[ ]](/icons/unknown.gif) | Unit 9 GRAMMAR BOOK 4.docx | 2020-03-04 00:53 | 154K | |
![[ ]](/icons/unknown.gif) | UNIT 9 (GRAMMAR)2222.docx | 2021-08-31 00:04 | 154K | |
![[ ]](/icons/unknown.gif) | THE BODY EXERCISE 1.docx | 2016-08-23 17:24 | 153K | |
![[IMG]](/icons/image2.gif) | PLURAL NOUNS RULES AST.jpg | 2022-02-03 00:19 | 153K | |
![[ ]](/icons/unknown.gif) | past perfect vs. simple past.ppt | 2018-08-02 02:08 | 152K | |
![[ ]](/icons/unknown.gif) | Body Parts Exercise1.doc | 2017-01-31 17:55 | 152K | |
![[IMG]](/icons/image2.gif) | present-simple-vs-continuous2.jpg | 2018-07-21 20:29 | 151K | |
![[ ]](/icons/unknown.gif) | Grammar Exercises AMEICANA LEVEL 1 UNIT 2.doc | 2018-08-11 21:25 | 151K | |
![[ ]](/icons/unknown.gif) | PRESENT PROGRESSIVE EXERCISE.docx | 2019-07-18 00:32 | 150K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT EXERCISE 2..doc | 2017-02-24 02:13 | 150K | |
![[ ]](/icons/unknown.gif) | wish-and-regrets.pptx | 2015-02-20 05:41 | 149K | |
![[ ]](/icons/unknown.gif) | Prepositions of place 2019.docx | 2019-11-02 17:14 | 149K | |
![[IMG]](/icons/image2.gif) | free-time-worksheets-telling-the-time-to-1-min-2.gif | 2015-05-08 00:32 | 149K | |
![[ ]](/icons/layout.gif) | Second Conditional ESL040 Homework.pdf | 2018-05-10 02:19 | 149K | |
![[ ]](/icons/layout.gif) | Second Conditional ESL040 Homework (1).pdf | 2020-02-14 00:33 | 149K | |
![[ ]](/icons/layout.gif) | gr.the.pdf | 2018-12-01 22:31 | 148K | |
![[ ]](/icons/unknown.gif) | The use of Will UP INTER 5.1.pptx | 2015-05-25 03:26 | 148K | |
![[ ]](/icons/layout.gif) | adjective order 11.pdf | 2018-10-13 01:52 | 146K | |
![[ ]](/icons/layout.gif) | To_Be_Exercise_1.pdf | 2015-10-03 16:22 | 146K | |
![[ ]](/icons/unknown.gif) | GLOBAL 1 SYLLABUS.docx | 2014-08-13 00:15 | 145K | |
![[ ]](/icons/layout.gif) | three little pigs.pdf | 2014-09-04 00:08 | 145K | |
![[ ]](/icons/layout.gif) | Am_Is_Are_ Have_Has_worksheet.pdf | 2018-09-29 22:45 | 145K | |
![[IMG]](/icons/image2.gif) | art attack.jpg | 2014-08-23 15:44 | 145K | |
![[ ]](/icons/unknown.gif) | FOOD EXERCISE1.docx | 2022-06-02 00:39 | 145K | |
![[ ]](/icons/unknown.gif) | HW erika may 18 19.docx | 2019-05-11 16:23 | 145K | |
![[ ]](/icons/unknown.gif) | Fisrt day of class AST fun 1.pptx | 2020-10-06 02:59 | 145K | |
![[ ]](/icons/unknown.gif) | GLOBAL 1 SYLLABUS 8 weeks on campus.docx | 2015-08-03 22:43 | 144K | |
![[ ]](/icons/layout.gif) | inversion unit 2 life 6.pdf | 2019-02-12 01:33 | 143K | |
![[ ]](/icons/unknown.gif) | FREQUENCY ADVERBS exercise.doc | 2019-06-01 17:47 | 143K | |
![[ ]](/icons/layout.gif) | simple past tense the elves and the shoemaker 1.pdf | 2017-01-14 20:59 | 141K | |
![[ ]](/icons/unknown.gif) | UNIT 9 GRAMMAR 2NDE.docx | 2020-03-04 22:15 | 141K | |
![[ ]](/icons/layout.gif) | Pronoun9_Indefinite_Pronouns.pdf | 2017-11-18 21:25 | 141K | |
![[IMG]](/icons/image2.gif) | maxresdefault.jpg | 2019-07-20 00:40 | 140K | |
![[ ]](/icons/layout.gif) | ADVERBS FREQUENCY AST.pdf | 2022-03-09 00:32 | 140K | |
![[ ]](/icons/layout.gif) | futurewith going to.pdf | 2017-10-21 00:32 | 140K | |
![[ ]](/icons/layout.gif) | be going to exercises.pdf | 2016-11-17 01:45 | 140K | |
![[ ]](/icons/layout.gif) | GOING TO.pdf | 2018-10-27 19:24 | 140K | |
![[ ]](/icons/layout.gif) | FUTURE WITH GOING TO.pdf | 2018-07-28 20:36 | 140K | |
![[ ]](/icons/unknown.gif) | QUANTIFIERS EXERCISE 1 (1).doc | 2022-08-10 03:20 | 140K | |
![[ ]](/icons/layout.gif) | INSP1_ws12.pdf | 2018-09-22 22:18 | 139K | |
![[ ]](/icons/unknown.gif) | Regular verbs-Simple Past.doc | 2014-10-11 04:07 | 139K | |
![[ ]](/icons/layout.gif) | NI1-Grammar-worksheet-5.pdf | 2018-10-13 21:02 | 139K | |
![[ ]](/icons/layout.gif) | phrasal_verbs_list(1).pdf | 2017-02-23 01:53 | 139K | |
![[ ]](/icons/unknown.gif) | Present Continuous G 8.1.pptm | 2015-11-05 23:36 | 139K | |
![[ ]](/icons/unknown.gif) | grammar Unit 1-book 4.docx | 2021-07-07 01:03 | 138K | |
![[ ]](/icons/layout.gif) | VERB + GERUND AST.pdf | 2021-07-06 00:32 | 137K | |
![[ ]](/icons/layout.gif) | Have and Have Got.pdf | 2018-09-29 21:51 | 137K | |
![[ ]](/icons/layout.gif) | INSP2_ws7PRESENT PERFECT.pdf | 2017-11-04 21:07 | 137K | |
![[ ]](/icons/layout.gif) | INSP2_ws7.pdf | 2017-11-04 00:33 | 137K | |
![[ ]](/icons/unknown.gif) | Modal Verbs Quiz.docx | 2014-07-10 22:49 | 137K | |
![[ ]](/icons/unknown.gif) | FUN B GLOBAL INFO First day.docx | 2015-04-09 00:24 | 137K | |
![[ ]](/icons/layout.gif) | Prepositions of Place Elementary erika.pdf | 2019-05-11 16:19 | 136K | |
![[ ]](/icons/layout.gif) | Prepositions of Place Elementary.pdf | 2018-10-13 00:23 | 136K | |
![[ ]](/icons/unknown.gif) | WORD ORDER IN QUESTIONS (1) (1).pptx | 2015-07-21 02:30 | 136K | |
![[ ]](/icons/unknown.gif) | Family Tree.ppt | 2015-07-31 03:27 | 136K | |
![[ ]](/icons/unknown.gif) | ANA ALVARADO.docx | 2013-10-31 02:54 | 136K | |
![[ ]](/icons/layout.gif) | Present Simple and Continuous AST.pdf | 2021-11-24 00:30 | 136K | |
![[ ]](/icons/layout.gif) | Present Simple and Continuous AST#3.pdf | 2022-03-03 15:55 | 136K | |
![[ ]](/icons/unknown.gif) | WORD ORDER IN QUESTIONS.pptx | 2015-01-22 05:18 | 135K | |
![[ ]](/icons/unknown.gif) | WORD ORDER IN QUESTIONS (1).pptx | 2015-07-11 02:59 | 135K | |
![[ ]](/icons/unknown.gif) | SPECULATIONS IN PRESENT NEW.docx | 2018-07-28 15:23 | 135K | |
![[ ]](/icons/unknown.gif) | EPECULATIONS IN PRESENT NEW.docx | 2018-04-12 23:28 | 135K | |
![[ ]](/icons/layout.gif) | Conversation- Persuasive Speech Rubric.pdf | 2018-05-08 00:11 | 135K | |
![[ ]](/icons/unknown.gif) | perfect progressive exercise.docx | 2020-02-01 16:05 | 135K | |
![[ ]](/icons/layout.gif) | grammar used to.pdf | 2015-07-31 02:49 | 135K | |
![[ ]](/icons/unknown.gif) | get in touch.docx | 2014-09-25 00:06 | 134K | |
![[IMG]](/icons/image2.gif) | WILL VS GOING TO.jpg | 2021-12-01 00:48 | 134K | |
![[ ]](/icons/unknown.gif) | Materials.docx | 2015-08-03 22:44 | 134K | |
![[ ]](/icons/unknown.gif) | MY CHILDHOOD MEMORIES USED TO..docx | 2017-07-19 17:22 | 134K | |
![[IMG]](/icons/image2.gif) | comparative-chart.jpg | 2016-02-24 00:42 | 134K | |
![[ ]](/icons/layout.gif) | EXTRA2.pdf | 2018-09-22 22:18 | 133K | |
![[ ]](/icons/layout.gif) | PAST-SIMPLE--irregular-verbs-.pdf | 2019-05-31 16:49 | 133K | |
![[ ]](/icons/unknown.gif) | ENGLISH I 8 Week Calendar.docx | 2015-08-03 22:42 | 133K | |
![[ ]](/icons/layout.gif) | infinitive of purpose exercises.pdf | 2014-07-29 16:50 | 133K | |
![[ ]](/icons/layout.gif) | INSP2_ws12INFINITIVE OF PURPOSE.pdf | 2017-10-21 00:36 | 133K | |
![[ ]](/icons/layout.gif) | INSP2_ws12.pdf | 2018-07-28 21:42 | 133K | |
![[ ]](/icons/layout.gif) | INFINITIVE OF PURPOSE INSP MCM12.pdf | 2018-10-27 20:09 | 133K | |
![[ ]](/icons/layout.gif) | INFINITIVE OF PURPOSE.pdf | 2017-10-21 21:15 | 133K | |
![[ ]](/icons/unknown.gif) | pronouns.docx | 2017-11-11 17:04 | 133K | |
![[ ]](/icons/unknown.gif) | Phrasal-verbs-Intermediate-lesson.doc | 2014-08-01 02:34 | 133K | |
![[IMG]](/icons/image2.gif) | printable.png | 2015-06-08 00:57 | 132K | |
![[ ]](/icons/layout.gif) | gr.frequ.pdf | 2017-05-20 02:31 | 132K | |
![[ ]](/icons/unknown.gif) | MY CHILDHOOD MEMORIES SIMPLE PAST..docx | 2016-08-09 00:07 | 131K | |
![[ ]](/icons/layout.gif) | Past simple and Present Perfect AST.pdf | 2022-02-22 00:27 | 131K | |
![[ ]](/icons/layout.gif) | Should Students AST.pdf | 2021-12-15 01:02 | 131K | |
![[ ]](/icons/unknown.gif) | I Took This Picture.docx | 2023-06-08 03:00 | 131K | |
![[ ]](/icons/unknown.gif) | prepositions_of_time__in_on_at.doc | 2017-04-29 17:53 | 131K | |
![[ ]](/icons/unknown.gif) | Daily_Routines EX 1.doc | 2024-01-24 03:10 | 131K | |
![[ ]](/icons/unknown.gif) | DESCRIBE PEOPLE 2.doc | 2023-02-18 18:10 | 131K | |
![[ ]](/icons/unknown.gif) | DESCRIBE PEOPLE 2 (1).doc | 2023-08-05 18:13 | 131K | |
![[ ]](/icons/unknown.gif) | Communicative Activity.docx | 2017-05-10 00:20 | 130K | |
![[ ]](/icons/unknown.gif) | Daily_Routines.doc | 2021-07-10 18:47 | 130K | |
![[TXT]](/icons/text.gif) | Oral presentation _ LearnEnglish Teens _ British Council.html | 2017-10-14 17:16 | 130K | |
![[IMG]](/icons/image2.gif) | image1 (2).jpeg | 2019-09-04 01:37 | 129K | |
![[ ]](/icons/unknown.gif) | COMPARATIVES AND SUPERLATIVES EXERCISE 2.docx | 2021-08-20 02:59 | 129K | |
![[ ]](/icons/unknown.gif) | QUANTIFIERS EXERCISE 1.doc | 2023-12-13 02:57 | 129K | |
![[ ]](/icons/layout.gif) | UNIT #4 TEST AST .pdf | 2021-07-10 18:16 | 128K | |
![[ ]](/icons/unknown.gif) | QUANTIFIERS EXERCISE.doc | 2019-03-01 01:11 | 128K | |
![[ ]](/icons/unknown.gif) | BE_GOING_TO_EXERCISE 1 (1).doc | 2024-05-11 18:06 | 128K | |
![[ ]](/icons/unknown.gif) | Phrasal Verbs U.I. 9.2.pptx | 2015-06-22 03:23 | 128K | |
![[ ]](/icons/layout.gif) | Past Simple.pdf | 2018-09-22 21:18 | 128K | |
![[ ]](/icons/layout.gif) | Past Simple (4).pdf | 2018-01-13 22:06 | 128K | |
![[ ]](/icons/layout.gif) | Past Simple (3).pdf | 2018-01-13 22:07 | 128K | |
![[ ]](/icons/layout.gif) | Past Simple (2).pdf | 2017-09-23 21:23 | 128K | |
![[IMG]](/icons/image2.gif) | frequency expressions.jpg | 2019-02-16 19:26 | 127K | |
![[ ]](/icons/unknown.gif) | was-or-were-fun-activities-.doc | 2019-05-04 17:19 | 127K | |
![[ ]](/icons/unknown.gif) | reporting exercises unit 8.docx | 2019-03-02 01:01 | 125K | |
![[ ]](/icons/unknown.gif) | present_continuous.doc | 2024-01-25 02:52 | 125K | |
![[ ]](/icons/unknown.gif) | present_continuous (1).doc | 2023-01-28 02:58 | 125K | |
![[ ]](/icons/unknown.gif) | present continuous.doc | 2016-11-29 02:17 | 125K | |
![[ ]](/icons/unknown.gif) | present_continuous[12].doc | 2016-08-23 00:47 | 125K | |
![[ ]](/icons/layout.gif) | phrasal verbs tables completa.pdf | 2016-02-19 23:36 | 124K | |
![[ ]](/icons/layout.gif) | verb simple past.pdf | 2018-05-19 02:47 | 123K | |
![[ ]](/icons/unknown.gif) | prepositios erika.docx | 2017-10-28 14:36 | 123K | |
![[ ]](/icons/unknown.gif) | WILL AND GOING TO EX 2.doc | 2023-03-03 03:49 | 123K | |
![[ ]](/icons/layout.gif) | exercisesquestiontags.pdf | 2016-07-28 23:28 | 123K | |
![[ ]](/icons/unknown.gif) | WAS WERE EX.1.docx | 2015-05-16 16:35 | 122K | |
![[ ]](/icons/layout.gif) | conditionals_zero_form.pdf | 2020-01-29 00:49 | 122K | |
![[ ]](/icons/unknown.gif) | WAS WERE EX.1 (1).docx | 2014-07-12 16:40 | 122K | |
![[ ]](/icons/unknown.gif) | UNIT 1 EXERCISE.doc | 2018-02-01 23:19 | 122K | |
![[ ]](/icons/layout.gif) | Prepositions-Flashcards-2.pdf | 2022-02-02 00:39 | 121K | |
![[ ]](/icons/unknown.gif) | 43173_prepositions_of_time__in_on_at.doc | 2017-04-08 16:22 | 121K | |
![[ ]](/icons/unknown.gif) | PRESENTATION UNIT 6 (2).pptx | 2020-01-30 22:30 | 121K | |
![[ ]](/icons/unknown.gif) | WILL AND BE GOING TO.doc | 2022-08-04 02:57 | 121K | |
![[ ]](/icons/layout.gif) | phrasal verbs-separable.pdf | 2015-02-27 01:24 | 120K | |
![[ ]](/icons/layout.gif) | SEPARABLE AND INSEPARABLE PHRASAL VERBS 2 (1).pdf | 2017-06-20 00:58 | 120K | |
![[ ]](/icons/layout.gif) | PRESENT SIMPLE OR CONTINUOUS AS#2.pdf | 2022-03-03 15:53 | 120K | |
![[ ]](/icons/layout.gif) | PRESENT CONTINUOUS AST.pdf | 2021-08-18 01:17 | 120K | |
![[ ]](/icons/unknown.gif) | containers and quantities.docx | 2016-03-12 22:20 | 120K | |
![[ ]](/icons/unknown.gif) | WILL AND BE GOING TO (1).doc | 2022-08-04 03:01 | 119K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2020-03-12 at 15.42.33.jpeg | 2020-03-13 01:01 | 119K | |
![[ ]](/icons/unknown.gif) | Past Tense and Past Continuous Verbs pencil.ppt.pptx | 2016-05-25 01:01 | 118K | |
![[ ]](/icons/unknown.gif) | family-meeting-causative-speaking (1).docx | 2016-01-28 00:17 | 118K | |
![[ ]](/icons/layout.gif) | Family-Tree.pdf | 2019-06-14 01:37 | 118K | |
![[ ]](/icons/unknown.gif) | MAKING PREDICTIONS.doc | 2024-02-22 03:01 | 118K | |
![[ ]](/icons/layout.gif) | QUESTIONNAIRE HOBBIES AST.pdf | 2021-07-07 00:53 | 117K | |
![[IMG]](/icons/image2.gif) | LIFE-Oral Presentaion Level VI 7-9.jpg | 2018-09-07 01:37 | 116K | |
![[ ]](/icons/layout.gif) | Simple past regular verbs.pdf | 2017-06-10 02:35 | 116K | |
![[ ]](/icons/layout.gif) | possessive-nouns.pdf | 2019-04-13 20:04 | 115K | |
![[ ]](/icons/layout.gif) | jupitergr4.pdf | 2014-01-18 02:14 | 115K | |
![[ ]](/icons/unknown.gif) | Presentation Units 1-2L4-Dailies.pptx | 2020-07-30 17:03 | 115K | |
![[ ]](/icons/layout.gif) | present_perfect_form_mixed_exercise_1.pdf | 2018-05-26 21:09 | 114K | |
![[ ]](/icons/unknown.gif) | Vocabulary prepositions erika.docx | 2019-05-11 16:18 | 114K | |
![[IMG]](/icons/image2.gif) | state verbs.jpg | 2016-01-23 18:10 | 113K | |
![[IMG]](/icons/image2.gif) | state verbs (1).jpg | 2016-04-14 01:00 | 113K | |
![[ ]](/icons/layout.gif) | Debates.pdf | 2021-06-18 03:29 | 113K | |
![[ ]](/icons/layout.gif) | INSP1_ws2.pdf | 2019-08-10 02:39 | 113K | |
![[IMG]](/icons/image2.gif) | WhatsApp Image 2024-05-30 at 18.49.17_ce872c7b.jpg | 2024-05-31 01:15 | 113K | |
![[ ]](/icons/layout.gif) | subject-and-object-questions-exercise-1.pdf | 2016-01-16 02:01 | 112K | |
![[ ]](/icons/layout.gif) | subject-and-object-questions-exercise-1(2).pdf | 2016-01-16 02:03 | 112K | |
![[IMG]](/icons/image2.gif) | Tarea 1 - Nivel 5.png | 2024-01-29 15:11 | 112K | |
![[IMG]](/icons/image2.gif) | irregular-verbs-list-classroom-posters_38807_1.jpg | 2019-09-05 14:25 | 112K | |
![[ ]](/icons/unknown.gif) | simpson family.docx | 2019-07-20 17:56 | 112K | |
![[ ]](/icons/layout.gif) | Hot-n--cold.pdf | 2019-07-13 17:25 | 112K | |
![[ ]](/icons/unknown.gif) | Inventions and Discoveries.docx | 2023-06-28 02:54 | 112K | |
![[ ]](/icons/unknown.gif) | Inventions and Discoveries (1).docx | 2022-12-15 02:57 | 112K | |
![[ ]](/icons/layout.gif) | exercisessomeany.pdf | 2017-03-04 20:06 | 112K | |
![[ ]](/icons/layout.gif) | INSP1_ws8.pdf | 2019-03-09 22:27 | 112K | |
![[ ]](/icons/layout.gif) | present_perfect_or_past_simple.pdf | 2018-11-10 21:00 | 111K | |
![[ ]](/icons/layout.gif) | Homonyms, Homographs, Homophones.pdf | 2014-11-15 00:57 | 111K | |
![[ ]](/icons/unknown.gif) | Inventions and Discoveries (2).docx | 2024-03-09 18:02 | 110K | |
![[ ]](/icons/layout.gif) | SIMPLE PRESENT SIMPLE PAST AND PRESENT PERFECT AST.pdf | 2022-03-17 00:38 | 110K | |
![[ ]](/icons/layout.gif) | SIMPLE PRESENT AND PAST PRESENT PERFECT AST.pdf | 2021-12-09 00:41 | 110K | |
![[IMG]](/icons/image2.gif) | adverbios frecuencia.png | 2016-08-06 22:15 | 110K | |
![[ ]](/icons/layout.gif) | Gerund or Infinitive.pdf | 2017-02-23 01:53 | 110K | |
![[ ]](/icons/unknown.gif) | CLOTHING EXERCISE.doc | 2023-07-29 17:31 | 110K | |
![[ ]](/icons/unknown.gif) | DIRECT AND INDIRECT QUESTIONS. (1).pptx | 2022-10-15 02:58 | 110K | |
![[ ]](/icons/unknown.gif) | DIRECT AND INDIRECT QUESTIONS..pptx | 2024-01-27 02:57 | 110K | |
![[ ]](/icons/layout.gif) | Verb-to-be (1).pdf | 2019-10-18 22:12 | 109K | |
![[ ]](/icons/layout.gif) | COMPARATIVE_SUPERLATIVE with rules.pdf | 2017-09-23 02:22 | 109K | |
![[ ]](/icons/unknown.gif) | Presentation Unit 5 (2) (1).pptx | 2019-09-18 22:57 | 109K | |
![[IMG]](/icons/image2.gif) | Verb noun collocations AST.png | 2022-02-10 00:20 | 109K | |
![[ ]](/icons/layout.gif) | Levels1-2_SylviaEarle_Reading.pdf | 2017-12-04 23:08 | 108K | |
![[ ]](/icons/layout.gif) | SYNONYMS ESL.pdf | 2021-12-07 23:57 | 108K | |
![[IMG]](/icons/image2.gif) | HW there is_ there are.JPG | 2020-07-02 03:00 | 108K | |
![[ ]](/icons/layout.gif) | SUBJECT-VERB WORKSHEET.pdf | 2021-12-06 19:35 | 107K | |
![[ ]](/icons/layout.gif) | past continuous.pdf | 2017-08-12 20:35 | 106K | |
![[ ]](/icons/layout.gif) | indefinite-pronouns AST.pdf | 2022-03-29 01:04 | 106K | |
![[ ]](/icons/unknown.gif) | 20 New Modal Perfect Exercises.docx | 2015-03-09 17:27 | 106K | |
![[ ]](/icons/layout.gif) | JOBS AND PROFESSIONS AST.pdf | 2022-02-08 00:52 | 105K | |
![[ ]](/icons/layout.gif) | HUMAN BODY PARTS AST.pdf | 2022-03-04 00:14 | 105K | |
![[ ]](/icons/unknown.gif) | Prepositions of Movement.docx | 2014-11-20 23:16 | 104K | |
![[ ]](/icons/layout.gif) | used to ex.pdf | 2015-07-31 02:51 | 104K | |
![[IMG]](/icons/image2.gif) | actionverbs.jpg | 2019-05-25 17:21 | 104K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT OR PRESENT PROGRESSIVE.doc | 2018-10-26 00:29 | 104K | |
![[ ]](/icons/layout.gif) | PRESENT SIMPLE AST.pdf | 2022-02-08 16:52 | 103K | |
![[ ]](/icons/unknown.gif) | Frequency Adverbs G 5.1 and 5.3.pptx | 2015-09-18 23:18 | 103K | |
![[ ]](/icons/layout.gif) | exercisesmuchmany.pdf | 2017-03-04 19:53 | 103K | |
![[ ]](/icons/layout.gif) | Exercises_Much_Many.pdf | 2020-02-29 01:48 | 103K | |
![[ ]](/icons/layout.gif) | REGLAMENTO DE LA ACADEMIA DE INGLÉS DE LA ESCUELA AMERICANA ONLINE (1).pdf | 2024-04-14 03:45 | 102K | |
![[IMG]](/icons/image2.gif) | mixed conditionals 2.jpg | 2015-02-26 02:58 | 102K | |
![[IMG]](/icons/image2.gif) | will-going-to-difference.gif | 2022-03-11 00:01 | 102K | |
![[ ]](/icons/layout.gif) | exercisesquantifiers.pdf | 2017-08-19 22:13 | 102K | |
![[ ]](/icons/layout.gif) | The Police AST.pdf | 2021-06-30 00:11 | 101K | |
![[ ]](/icons/layout.gif) | HAPPY! Pharell Williams Song AST.pdf | 2022-01-31 20:23 | 101K | |
![[ ]](/icons/unknown.gif) | STATIVE VERBS QUIZ.docx | 2022-01-28 02:52 | 100K | |
![[ ]](/icons/unknown.gif) | Have got 9.3.pptx | 2015-12-04 00:56 | 100K | |
![[ ]](/icons/unknown.gif) | -First conditional.pptx | 2019-10-07 14:30 | 100K | |
![[IMG]](/icons/image2.gif) | au_problem.PNG | 2013-09-15 02:57 | 100K | |
![[ ]](/icons/layout.gif) | IN ON AT PREPOSITIONS OF PLACE AST.pdf | 2021-11-26 16:08 | 100K | |
![[ ]](/icons/layout.gif) | IN ON AT AST.pdf | 2022-03-14 23:45 | 100K | |
![[ ]](/icons/unknown.gif) | Presentation Unit 1 (6).pptx | 2020-01-16 01:00 | 100K | |
![[ ]](/icons/layout.gif) | REGULAR VERBS (1).pdf | 2018-09-01 02:39 | 99K | |
![[ ]](/icons/unknown.gif) | A or An G 1.1.pptx | 2015-08-03 22:45 | 99K | |
![[ ]](/icons/layout.gif) | exercisesadjectiveorder.pdf | 2017-05-05 23:43 | 99K | |
![[IMG]](/icons/image2.gif) | object pronouns.jpg | 2013-11-17 17:27 | 98K | |
![[ ]](/icons/layout.gif) | Gerund&infinitive.pdf | 2014-01-23 23:25 | 98K | |
![[ ]](/icons/layout.gif) | cleft_sentences1.pdf | 2017-02-27 23:02 | 97K | |
![[ ]](/icons/layout.gif) | Facturacion AS400- HOME.pdf | 2013-09-15 02:57 | 97K | |
![[ ]](/icons/unknown.gif) | What time is it.docx | 2021-05-06 02:55 | 97K | |
![[ ]](/icons/layout.gif) | INSP1_ws13.pdf | 2019-08-24 19:26 | 97K | |
![[ ]](/icons/unknown.gif) | PHYSICAL APPEARANCE VOCABULARY..docx | 2017-02-04 17:26 | 96K | |
![[ ]](/icons/layout.gif) | PRESENT CONTINUOUS FOR FUTURE.pdf | 2017-10-21 21:15 | 96K | |
![[ ]](/icons/layout.gif) | INSP2_ws5present continuous for future.pdf | 2017-10-21 00:38 | 96K | |
![[ ]](/icons/layout.gif) | participle_adjectives_short_list.pdf | 2017-03-14 00:37 | 96K | |
![[ ]](/icons/unknown.gif) | RELATIVE CLAUSES grammar explanation unit 10 2nde.docx | 2019-09-06 00:31 | 96K | |
![[ ]](/icons/unknown.gif) | RELATIVE CLAUSES grammar explanation.docx | 2019-06-14 02:52 | 96K | |
![[ ]](/icons/layout.gif) | so_too_neither_either.pdf | 2016-07-27 01:59 | 95K | |
![[ ]](/icons/layout.gif) | Oral-Rubric.pdf | 2021-10-27 03:06 | 95K | |
![[ ]](/icons/layout.gif) | Plurals.pdf | 2019-07-20 00:46 | 95K | |
![[ ]](/icons/layout.gif) | Plurals-regular.pdf | 2016-10-15 21:59 | 95K | |
![[ ]](/icons/unknown.gif) | song simple present.docx | 2020-07-15 01:19 | 95K | |
![[ ]](/icons/unknown.gif) | 15 WAYS TO SAY HELLO LEVEL 3.pptx | 2014-09-25 00:41 | 95K | |
![[ ]](/icons/layout.gif) | To_Be_Exercise_5.pdf | 2016-09-24 22:48 | 95K | |
![[ ]](/icons/unknown.gif) | LV 2 - American School 2014 (Comparatives) HW#2.docx | 2014-02-03 04:57 | 95K | |
![[ ]](/icons/layout.gif) | VY_22_INOVACE_OYI23.pdf | 2019-03-09 22:35 | 95K | |
![[ ]](/icons/unknown.gif) | ordering_food.doc | 2017-02-11 02:14 | 95K | |
![[ ]](/icons/unknown.gif) | Life_Upper-intermediate_Wordlist.doc | 2016-08-10 20:19 | 95K | |
![[IMG]](/icons/image2.gif) | IN ON AT IMAGE AST.jpg | 2022-03-14 23:47 | 94K | |
![[ ]](/icons/layout.gif) | INSP1_ws3.pdf | 2019-08-10 02:41 | 94K | |
![[ ]](/icons/layout.gif) | plural-s-es_SDISH.pdf | 2019-02-02 22:06 | 94K | |
![[IMG]](/icons/image2.gif) | there-is-there-are.gif | 2018-05-05 01:07 | 94K | |
![[ ]](/icons/unknown.gif) | Comparative Adjectives.pptx | 2014-08-15 20:51 | 94K | |
![[IMG]](/icons/image2.gif) | USEOFVERBBE-SIMPLEPRESENT.jpg | 2019-04-06 20:43 | 93K | |
![[ ]](/icons/layout.gif) | MAIN-IDEAS-AND-SUPPORTING.pdf | 2018-04-21 17:06 | 93K | |
![[ ]](/icons/unknown.gif) | Irregular_verbs.doc | 2022-10-25 03:15 | 93K | |
![[ ]](/icons/unknown.gif) | Presentation 7.pptx | 2019-08-31 21:44 | 93K | |
![[ ]](/icons/layout.gif) | Pronunciation_final-ed-es.pdf | 2018-09-01 02:40 | 93K | |
![[ ]](/icons/layout.gif) | countable_and_uncountable_nouns_exercise_1.pdf | 2019-08-17 19:19 | 92K | |
![[ ]](/icons/unknown.gif) | HAVE HAS EXERCISE.docx | 2021-05-12 21:49 | 91K | |
![[ ]](/icons/unknown.gif) | narrative tenese class.ESB | 2015-07-11 02:26 | 91K | |
![[ ]](/icons/layout.gif) | PRACTICE_UNIT_2.pdf | 2018-12-08 02:25 | 91K | |
![[ ]](/icons/layout.gif) | Past_Tense_Exercise_14.pdf | 2014-05-13 00:40 | 90K | |
![[ ]](/icons/unknown.gif) | A SPOOKY STORY.pptx | 2015-01-23 01:30 | 90K | |
![[ ]](/icons/unknown.gif) | Modals.pptx | 2015-03-25 04:32 | 90K | |
![[ ]](/icons/layout.gif) | gerund_infinitive_verbs_list.pdf | 2017-02-23 01:50 | 90K | |
![[ ]](/icons/layout.gif) | gerund_infinitive_verbs_list(1).pdf | 2015-10-31 01:25 | 90K | |
![[ ]](/icons/layout.gif) | Microsoft Word - List of verbs followed by gerund or infinitive.doc.pdf | 2015-09-02 15:33 | 90K | |
![[ ]](/icons/unknown.gif) | Noun clauses,exercises.docx | 2020-01-16 21:04 | 90K | |
![[ ]](/icons/unknown.gif) | Presentation Unit 5.pptx | 2013-11-06 02:31 | 89K | |
![[ ]](/icons/unknown.gif) | Adverbs Spelling -LY G 6.2.pptx | 2015-10-16 00:10 | 89K | |
![[ ]](/icons/unknown.gif) | DIRECT AND INDIRECT QUESTIONS. (2).pptx | 2023-03-24 02:55 | 89K | |
![[ ]](/icons/unknown.gif) | PRESENTATION UNIT 6 (2) [Autosaved].pptx | 2019-06-14 01:12 | 88K | |
![[ ]](/icons/unknown.gif) | Prepositions of place, furniture, prepositions of place[1].doc | 2018-06-21 00:42 | 88K | |
![[ ]](/icons/unknown.gif) | Wh- question + do and does.pptx | 2014-04-03 00:51 | 88K | |
![[ ]](/icons/unknown.gif) | Past_Simple_Exercise_3 (1).doc | 2023-05-17 17:50 | 88K | |
![[ ]](/icons/layout.gif) | test_simple_past_present_perfect_en.pdf | 2017-08-12 02:07 | 87K | |
![[ ]](/icons/layout.gif) | some-and-any-exercise-2.pdf | 2016-11-19 00:04 | 87K | |
![[ ]](/icons/layout.gif) | Frequency Adverbs.pdf | 2015-02-11 23:07 | 87K | |
![[ ]](/icons/layout.gif) | 2013-14 - Lezione 27 novembre 2013 - Cleft sentences.pdf | 2017-02-27 23:00 | 87K | |
![[ ]](/icons/unknown.gif) | Comparative form of Adjectives (1).docx | 2016-01-23 16:35 | 87K | |
![[ ]](/icons/layout.gif) | have-to-dont-have-to.pdf | 2018-08-25 21:04 | 86K | |
![[ ]](/icons/layout.gif) | SO ND SUCH.pdf | 2016-02-03 00:01 | 85K | |
![[ ]](/icons/unknown.gif) | FREQUENCY ADVERBS EXERCISE.pptx | 2016-10-27 00:31 | 85K | |
![[ ]](/icons/layout.gif) | To_Be_Exercise_4.pdf | 2017-04-22 18:13 | 85K | |
![[TXT]](/icons/text.gif) | The Pronunciation of Regular Verbs in the Past.htm | 2015-10-30 02:03 | 84K | |
![[ ]](/icons/unknown.gif) | REGULAR_VERBS.doc | 2019-11-13 02:16 | 84K | |
![[ ]](/icons/unknown.gif) | REGULAR_VERBS (1).doc | 2022-10-25 03:14 | 84K | |
![[ ]](/icons/unknown.gif) | UNITS 10 and 12 book 5 grammar explanation.docx | 2020-03-12 00:10 | 83K | |
![[ ]](/icons/layout.gif) | BEGvoc6-5.pdf | 2017-01-21 21:58 | 83K | |
![[ ]](/icons/unknown.gif) | HAVE HAS EXERCISE..docx | 2018-09-25 01:52 | 83K | |
![[IMG]](/icons/image2.gif) | Prepositions of place.jpg | 2024-04-20 14:05 | 83K | |
![[ ]](/icons/unknown.gif) | Past_Simple_Exercise_3.doc | 2024-02-07 16:11 | 83K | |
![[ ]](/icons/unknown.gif) | Past_Simple_Exercise_1.doc | 2017-03-18 02:18 | 83K | |
![[ ]](/icons/unknown.gif) | English Level 3 exam.docx | 2024-04-06 14:33 | 82K | |
![[ ]](/icons/unknown.gif) | Simple Past VRS Present Perfect.docx | 2013-12-04 02:06 | 82K | |
![[IMG]](/icons/image2.gif) | Common Homophones.jpg | 2015-05-02 18:10 | 82K | |
![[IMG]](/icons/image2.gif) | Speaking Rubric II.jpg | 2014-09-24 01:41 | 82K | |
![[ ]](/icons/unknown.gif) | Object_Pronouns.doc | 2017-02-18 01:09 | 82K | |
![[ ]](/icons/layout.gif) | verbs-simple-present1.pdf | 2015-02-21 16:24 | 81K | |
![[IMG]](/icons/image2.gif) | There is, there are worksheet.jpg | 2024-02-24 14:24 | 81K | |
![[ ]](/icons/layout.gif) | INSP2_ws3 FUTURE WITH WILL.pdf | 2018-03-10 02:05 | 80K | |
![[ ]](/icons/unknown.gif) | Countable vs Noncountable Nouns G.4.3.pptx | 2015-09-01 00:29 | 80K | |
![[ ]](/icons/unknown.gif) | Past Perfect vs past simple (1) (1) (1).pptx | 2017-03-16 01:07 | 80K | |
![[ ]](/icons/layout.gif) | ALL ABOUT ME AST 2.pdf | 2021-11-24 00:32 | 80K | |
![[ ]](/icons/unknown.gif) | Simple Past Tense.pptx | 2015-04-30 02:28 | 80K | |
![[ ]](/icons/unknown.gif) | Simple Past Tense G 7.1.pptx | 2015-10-28 00:23 | 79K | |
![[ ]](/icons/unknown.gif) | do doea is am are have has.docx | 2014-02-05 16:41 | 79K | |
![[ ]](/icons/unknown.gif) | Presentation 10 (1) (1) (1) (1).pptx | 2019-08-10 01:16 | 79K | |
![[ ]](/icons/layout.gif) | INSP2_ws1.pdf | 2018-11-17 22:26 | 79K | |
![[ ]](/icons/unknown.gif) | Using A, An, Some, Any and The G. 4.3.pptx | 2014-09-24 00:25 | 79K | |
![[ ]](/icons/unknown.gif) | definite article (the) or no article..doc | 2017-12-04 21:26 | 79K | |
![[ ]](/icons/layout.gif) | grammar_presentsimple practice.pdf | 2014-03-05 23:47 | 79K | |
![[ ]](/icons/unknown.gif) | To Be - Past Tense 6.3.pptx | 2015-10-16 00:10 | 79K | |
![[ ]](/icons/unknown.gif) | Present Simple & Present Continuous G 8.2.pptx | 2015-11-05 23:37 | 78K | |
![[ ]](/icons/layout.gif) | 1x Instagram Template Page without stories AT&T am.pdf | 2020-02-08 17:18 | 78K | |
![[ ]](/icons/layout.gif) | Be.pdf | 2018-09-22 19:08 | 78K | |
![[ ]](/icons/unknown.gif) | Ordinal Numbers G 1.3.pptx | 2015-08-08 02:08 | 78K | |
![[ ]](/icons/layout.gif) | Colon.pdf | 2017-06-03 02:32 | 77K | |
![[ ]](/icons/unknown.gif) | There is or theres are GB. 4.1.pptx | 2015-02-06 00:28 | 77K | |
![[ ]](/icons/unknown.gif) | There is or theres are G. 4.1.pptx | 2015-04-22 01:31 | 77K | |
![[ ]](/icons/layout.gif) | Comparative and Superlative.pdf | 2022-02-28 19:39 | 77K | |
![[ ]](/icons/unknown.gif) | There is VS There are G. 4.1.pptx | 2015-09-01 00:28 | 77K | |
![[ ]](/icons/unknown.gif) | INFINITIVES OF PURPOSE.docx | 2023-08-26 18:09 | 76K | |
![[IMG]](/icons/image2.gif) | HW.JPG | 2022-11-05 19:15 | 76K | |
![[ ]](/icons/unknown.gif) | simpson family 2019 d.docx | 2019-10-19 12:21 | 76K | |
![[ ]](/icons/layout.gif) | RulesforCapitalizationTipSheet.pdf | 2019-02-09 21:12 | 76K | |
![[ ]](/icons/layout.gif) | past-simple-vs-present-perfect.pdf | 2018-05-19 21:11 | 76K | |
![[ ]](/icons/layout.gif) | nominalization-worksheet.pdf | 2019-02-27 00:41 | 76K | |
![[ ]](/icons/layout.gif) | ORAL PRESENTATION My Favorite Place.pdf | 2023-10-27 03:00 | 76K | |
![[IMG]](/icons/image2.gif) | APARTMENT.JPG | 2022-08-03 03:13 | 75K | |
![[ ]](/icons/unknown.gif) | INFINITIVES OF PURPOSE EXERCISE.docx | 2019-11-08 00:53 | 75K | |
![[IMG]](/icons/image2.gif) | prepositions-of-time-and-place-in-on-at-grammar-guides_53554_1.jpg | 2018-05-11 23:42 | 75K | |
![[ ]](/icons/layout.gif) | ADJECTIVE NOUN COLLOCATIONS AST.pdf | 2022-02-10 00:35 | 75K | |
![[ ]](/icons/unknown.gif) | Presentation 10.1.pptx | 2020-11-21 17:20 | 75K | |
![[ ]](/icons/unknown.gif) | going to.pptx | 2015-06-09 02:56 | 75K | |
![[ ]](/icons/unknown.gif) | unit 7 book 2 (saturday).pptx | 2020-04-26 17:21 | 75K | |
![[ ]](/icons/unknown.gif) | reading_comprehension_simple_present (1).docx | 2016-01-23 17:11 | 75K | |
![[ ]](/icons/unknown.gif) | reading_comprehension_simple_present (1) (1).docx | 2017-05-20 17:24 | 75K | |
![[ ]](/icons/layout.gif) | list-of-common-uncountable-nouns.pdf | 2015-11-20 00:52 | 75K | |
![[ ]](/icons/layout.gif) | present_perfect_or_past_simple_2.pdf | 2020-01-17 00:40 | 75K | |
![[IMG]](/icons/image2.gif) | PRESENT CONTINUOUS FORMS POSTER AST.png | 2022-03-04 00:00 | 74K | |
![[ ]](/icons/layout.gif) | reported_statements.pdf | 2020-02-19 01:51 | 74K | |
![[ ]](/icons/layout.gif) | ShoppingListFood.pdf | 2016-08-13 22:12 | 74K | |
![[ ]](/icons/layout.gif) | Present-Simple-vs.-Progressive-exercises.pdf | 2018-07-21 20:55 | 74K | |
![[ ]](/icons/layout.gif) | Present-Simple-vs.-Progressive-exercises (1).pdf | 2018-10-13 20:36 | 74K | |
![[ ]](/icons/unknown.gif) | Cuentas por Cobrar Julio.xls | 2013-09-15 02:57 | 74K | |
![[ ]](/icons/unknown.gif) | gerund and phrasal verbs, life 6.docx | 2019-09-11 21:25 | 74K | |
![[ ]](/icons/unknown.gif) | Verbs followed by prepositions.docx | 2014-12-15 19:45 | 74K | |
![[ ]](/icons/unknown.gif) | To Be - Past Tense.pptx | 2015-04-23 02:59 | 74K | |
![[ ]](/icons/unknown.gif) | Presentation 10.pptx | 2020-03-17 00:14 | 73K | |
![[ ]](/icons/unknown.gif) | Simple Past Exercises - Elementary.docx | 2014-01-31 01:42 | 73K | |
![[ ]](/icons/unknown.gif) | Narrative tenses UI 2.4.pptx | 2015-05-07 15:57 | 73K | |
![[ ]](/icons/unknown.gif) | Adverbs of frequency.pptx | 2014-03-22 15:52 | 73K | |
![[ ]](/icons/layout.gif) | some__any1354823608341.pdf | 2018-11-17 00:36 | 73K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT EXERCISE.docx | 2023-04-22 18:22 | 73K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT EXERCISE6.docx | 2021-06-22 19:43 | 73K | |
![[ ]](/icons/unknown.gif) | Reading Exercise.doc | 2015-07-20 03:08 | 73K | |
![[ ]](/icons/unknown.gif) | Past_simple_regular_affirmative[1].doc | 2022-07-21 03:08 | 73K | |
![[ ]](/icons/unknown.gif) | Prepositions In, from and near G 2.1 PPP.pptx | 2014-03-15 17:47 | 72K | |
![[ ]](/icons/unknown.gif) | Prepositions In, From, and Near G 2.1.pptx | 2015-08-11 01:40 | 72K | |
![[ ]](/icons/layout.gif) | comparatives and superlatives 2 worksheet.pdf | 2016-11-20 16:42 | 72K | |
![[ ]](/icons/unknown.gif) | reading-comprehension-tests_83653.docx | 2019-06-08 18:02 | 72K | |
![[ ]](/icons/unknown.gif) | The Comparative and Superlative G 8.3.pptx | 2015-11-05 23:38 | 72K | |
![[ ]](/icons/unknown.gif) | COMPLETE THESE SENTENCES WITH A SUITABLE RELATIVE PRONOUN OR ADVERB.docx | 2014-08-15 13:58 | 72K | |
![[IMG]](/icons/image2.gif) | slide-7.jpg | 2018-08-04 22:27 | 71K | |
![[IMG]](/icons/image2.gif) | IRREGULAR VERBS AST PAGE 182.PNG | 2022-02-23 22:03 | 71K | |
![[ ]](/icons/layout.gif) | Demonstrative Adjectives AST.pdf | 2022-02-04 00:44 | 71K | |
![[IMG]](/icons/image2.gif) | Lat Presentation.jpg | 2023-12-16 17:48 | 71K | |
![[ ]](/icons/unknown.gif) | Wh- questions G 7.1 PPP.pptx | 2015-02-26 23:04 | 71K | |
![[IMG]](/icons/image2.gif) | MODAL VERBS AST.png | 2022-03-25 00:56 | 70K | |
![[ ]](/icons/unknown.gif) | A Brief story of Thanksgiving.doc | 2015-11-26 00:43 | 70K | |
![[IMG]](/icons/image2.gif) | second conditional HW.PNG | 2021-10-28 03:46 | 70K | |
![[ ]](/icons/unknown.gif) | Reported statements and questions Up. In. 7.3.pptx | 2015-06-08 01:00 | 70K | |
![[ ]](/icons/unknown.gif) | The Infinitive of Purpose ¨to¨ G 8.4.pptx | 2015-11-05 23:39 | 70K | |
![[ ]](/icons/unknown.gif) | Object Pronouns G 3.3.pptx | 2015-08-25 00:38 | 70K | |
![[ ]](/icons/layout.gif) | 2Presents_extra[1].pdf | 2018-04-28 22:04 | 70K | |
![[ ]](/icons/unknown.gif) | Verb to be G 1.2.pptx | 2015-08-03 22:49 | 69K | |
![[IMG]](/icons/image2.gif) | fashion-how-much-is-it-fun-activities-games-oneonone-activities_8463_1.jpg | 2018-05-10 23:30 | 69K | |
![[ ]](/icons/unknown.gif) | USED TO EXERCISE.doc | 2019-04-13 17:49 | 69K | |
![[ ]](/icons/unknown.gif) | First Conditional.doc | 2017-05-18 00:49 | 69K | |
![[IMG]](/icons/image2.gif) | IRREGULAR VERBS CHART AST.PNG | 2021-12-09 00:09 | 69K | |
![[ ]](/icons/unknown.gif) | VERB followed by prepositions.docx | 2014-01-28 17:56 | 69K | |
![[ ]](/icons/unknown.gif) | Presentation Unit 1- L5-Dailies.pptx | 2020-05-07 02:44 | 69K | |
![[ ]](/icons/layout.gif) | Present_Tense_Exercise_14.pdf | 2017-05-19 17:37 | 69K | |
![[ ]](/icons/layout.gif) | irregulares.pdf | 2018-05-26 14:12 | 69K | |
![[ ]](/icons/layout.gif) | irregulares (1).pdf | 2016-03-12 17:58 | 69K | |
![[ ]](/icons/unknown.gif) | Life_Elementary_Wordlist.doc | 2016-10-01 19:07 | 68K | |
![[ ]](/icons/layout.gif) | past-tense-irregular-verbs AST.pdf | 2021-11-24 00:31 | 68K | |
![[ ]](/icons/layout.gif) | past-tense-irregular-verbs.pdf | 2018-06-02 01:29 | 68K | |
![[ ]](/icons/unknown.gif) | SHOULD OR SHOULDN.docx | 2019-01-30 02:31 | 68K | |
![[ ]](/icons/unknown.gif) | Simple Past Exercises.docx | 2013-11-08 01:35 | 67K | |
![[ ]](/icons/layout.gif) | microsoft-word-infinitive_or_gerund.pdf | 2017-02-23 01:51 | 67K | |
![[ ]](/icons/unknown.gif) | Do vs Does G 3.2.pptx | 2015-08-25 00:37 | 67K | |
![[IMG]](/icons/image2.gif) | FIRST CONDITIONAL HW.JPG | 2023-03-18 18:29 | 67K | |
![[ ]](/icons/unknown.gif) | Wh- Questions G 2.2.pptx | 2015-08-11 01:42 | 67K | |
![[ ]](/icons/unknown.gif) | Simple Present G 2.3.pptx | 2015-08-11 01:44 | 67K | |
![[ ]](/icons/unknown.gif) | will or going to.docx | 2021-08-21 18:10 | 67K | |
![[ ]](/icons/unknown.gif) | Presentation 9 (1).pptx | 2019-12-07 14:48 | 67K | |
![[ ]](/icons/layout.gif) | Sentences Preposition of Places.pdf | 2024-03-02 14:41 | 67K | |
![[ ]](/icons/layout.gif) | relative_clauses_exercise_4.pdf | 2013-12-10 17:36 | 67K | |
![[ ]](/icons/layout.gif) | relative_clauses_exercise_1.pdf | 2020-01-29 00:52 | 66K | |
![[ ]](/icons/unknown.gif) | Simple present PPP.pptx | 2015-05-08 00:07 | 66K | |
![[IMG]](/icons/image2.gif) | Rule I Direct & Indirect Speech.JPG | 2016-02-06 18:28 | 66K | |
![[ ]](/icons/unknown.gif) | Wh- questions G 2.3 PPP.pptx | 2015-05-13 02:02 | 66K | |
![[ ]](/icons/layout.gif) | SIMPLE PAST HARRY POTTER.pdf | 2022-02-23 00:59 | 66K | |
![[ ]](/icons/layout.gif) | prepositions-of-time.pdf | 2015-01-20 23:59 | 66K | |
![[ ]](/icons/unknown.gif) | He_walked_on_the_moon (1).doc | 2023-10-21 18:12 | 66K | |
![[IMG]](/icons/image2.gif) | can.jpg | 2019-11-28 01:28 | 65K | |
![[ ]](/icons/unknown.gif) | Modals of Speculation Up. Inter. 4.1.pptx | 2015-05-17 23:57 | 65K | |
![[ ]](/icons/unknown.gif) | to be in past.pptx | 2014-10-16 03:27 | 65K | |
![[ ]](/icons/unknown.gif) | Much,many, Few, little.pptx | 2014-07-17 03:05 | 65K | |
![[ ]](/icons/unknown.gif) | Simple Past Tense Irregular Verbs G 7.2.pptx | 2015-10-28 00:24 | 65K | |
![[IMG]](/icons/image2.gif) | learn-tell-time1.png | 2015-08-19 02:13 | 65K | |
![[ ]](/icons/unknown.gif) | PASSIVE_VOICE (3).pptx | 2018-02-10 18:04 | 64K | |
![[ ]](/icons/layout.gif) | tenses_table.pdf | 2017-04-04 00:39 | 64K | |
![[ ]](/icons/layout.gif) | stative-verbs-list.pdf | 2017-01-26 23:17 | 64K | |
![[ ]](/icons/layout.gif) | stative-verbs-list (1).pdf | 2016-06-29 01:22 | 64K | |
![[ ]](/icons/unknown.gif) | PREPOSITIONS OF TIME EXERCISE..docx | 2019-04-01 23:25 | 64K | |
![[ ]](/icons/layout.gif) | grammar-worksheet-grade-3-adjectives-sentences-1.pdf | 2016-08-20 18:13 | 64K | |
![[IMG]](/icons/image2.gif) | HAVE_SMTH_DONE.png | 2016-04-12 03:02 | 64K | |
![[ ]](/icons/unknown.gif) | He_walked_on_the_moon.doc | 2021-07-31 18:16 | 64K | |
![[ ]](/icons/unknown.gif) | Presentation 9.pptx | 2019-11-04 20:24 | 63K | |
![[ ]](/icons/unknown.gif) | Ordinary numbers.docx | 2014-05-03 17:24 | 63K | |
![[ ]](/icons/layout.gif) | irregular-verb-list.pdf | 2016-01-19 02:25 | 63K | |
![[ ]](/icons/unknown.gif) | Qualifiers - (Intensifiers)pptx.pptx | 2020-05-24 00:41 | 63K | |
![[ ]](/icons/unknown.gif) | Reading comprehension # 1.doc | 2016-07-22 04:24 | 63K | |
![[ ]](/icons/layout.gif) | there-is-there-are.pdf | 2019-02-02 22:07 | 62K | |
![[ ]](/icons/layout.gif) | there-is-there-are (2).pdf | 2019-07-20 00:42 | 62K | |
![[ ]](/icons/layout.gif) | VY_22_INOVACE_OYI4.pdf | 2017-11-18 21:24 | 62K | |
![[ ]](/icons/unknown.gif) | FUTURE_EXERCISE.doc | 2019-03-08 02:07 | 62K | |
![[ ]](/icons/unknown.gif) | Forming the Simple Past -review 7.1.pptx | 2015-10-28 00:25 | 62K | |
![[ ]](/icons/unknown.gif) | Be used to OR Get used to UI 5.4.pptx | 2015-05-25 03:29 | 62K | |
![[ ]](/icons/unknown.gif) | ALL ORAL EVALUATIONS.rtf | 2021-08-13 23:58 | 61K | |
![[ ]](/icons/layout.gif) | gr.degree.pdf | 2017-02-21 00:48 | 61K | |
![[IMG]](/icons/image2.gif) | NOMINATING PRIZE HW.JPG | 2022-09-10 17:07 | 61K | |
![[ ]](/icons/unknown.gif) | SYLLABUS daily.docx | 2014-11-19 19:53 | 61K | |
![[ ]](/icons/unknown.gif) | REPORTED SPEECH- PRESENTATION.pptx | 2020-11-21 17:24 | 61K | |
![[ ]](/icons/unknown.gif) | RELATIVE PRONOUN, level 5.docx | 2019-06-12 23:38 | 61K | |
![[ ]](/icons/unknown.gif) | A B C.pptx | 2015-03-18 00:24 | 61K | |
![[ ]](/icons/unknown.gif) | Reported Speech exercise 2. (1).docx | 2023-12-09 18:08 | 60K | |
![[ ]](/icons/unknown.gif) | Reported Speech exercise 2..docx | 2017-09-12 00:45 | 60K | |
![[ ]](/icons/unknown.gif) | RELATIVE PRONOUN.docx | 2019-11-25 19:45 | 60K | |
![[ ]](/icons/layout.gif) | possessive-nouns1_WBTNB.pdf | 2019-01-15 18:03 | 60K | |
![[ ]](/icons/unknown.gif) | SomeCommonIrregularVerbs.doc | 2014-07-21 17:54 | 60K | |
![[ ]](/icons/layout.gif) | present_perfect_or_past_simple_4.pdf | 2017-11-04 21:06 | 59K | |
![[IMG]](/icons/image2.gif) | image (1).png | 2015-04-18 15:39 | 59K | |
![[ ]](/icons/unknown.gif) | Collocation Exercise.docx | 2023-10-21 18:20 | 59K | |
![[ ]](/icons/unknown.gif) | PASSIVE VOICE.pptx | 2018-08-18 15:14 | 59K | |
![[ ]](/icons/unknown.gif) | PASSIVE VOICE 1.pptx | 2019-08-10 16:33 | 59K | |
![[ ]](/icons/unknown.gif) | Global Intermediate Unit Test 3.docx | 2014-07-07 02:26 | 59K | |
![[ ]](/icons/layout.gif) | plural-nouns.pdf | 2018-07-28 02:17 | 59K | |
![[ ]](/icons/layout.gif) | COMMON IRREGULAR VERBS PRACTICE AST.pdf | 2022-02-25 00:32 | 58K | |
![[ ]](/icons/unknown.gif) | SomeCommonIrregularVerbs-1.doc | 2014-07-26 01:05 | 58K | |
![[ ]](/icons/unknown.gif) | Cardinal and Ordinal Numbers.pptx | 2020-10-15 17:19 | 58K | |
![[IMG]](/icons/image2.gif) | homophone list.jpg | 2014-10-16 03:23 | 58K | |
![[ ]](/icons/unknown.gif) | connectors.doc | 2018-06-07 01:45 | 58K | |
![[ ]](/icons/unknown.gif) | PASSIVE VOICE- PRESENTATION.pptx | 2020-08-04 15:57 | 57K | |
![[ ]](/icons/layout.gif) | presentcontinuousgoingto.pdf | 2018-08-04 21:11 | 57K | |
![[IMG]](/icons/image2.gif) | articles-determiners-71-638.jpg | 2015-08-04 02:25 | 57K | |
![[ ]](/icons/unknown.gif) | Presentation Future Probability.pptx | 2020-06-06 02:47 | 57K | |
![[ ]](/icons/unknown.gif) | PRESENT_PERFECT_PROGRESSIVE_EXERCISE.doc | 2019-10-19 13:01 | 57K | |
![[ ]](/icons/layout.gif) | can-cannot.pdf | 2017-05-27 01:06 | 56K | |
![[ ]](/icons/unknown.gif) | Present Perfect (1).pptx | 2016-02-13 15:59 | 56K | |
![[ ]](/icons/unknown.gif) | SYLLABUS Saturday.docx | 2014-07-11 12:43 | 56K | |
![[ ]](/icons/unknown.gif) | Presentation Unit 3-Life.pptx | 2019-11-25 19:35 | 56K | |
![[ ]](/icons/unknown.gif) | Subject Pronoun GB 2.pptx | 2015-03-26 23:08 | 56K | |
![[ ]](/icons/unknown.gif) | exercises on determiners, level4.docx | 2020-02-18 17:42 | 56K | |
![[ ]](/icons/unknown.gif) | PASSIVE REPORTING VERBS pptx.pptx | 2020-09-20 13:10 | 56K | |
![[ ]](/icons/unknown.gif) | PRESENTATION-GERUNDS AND INFINITIV.pptx | 2020-10-30 04:22 | 56K | |
![[ ]](/icons/unknown.gif) | Be going to + base form verbs G 10.2.pptx | 2015-12-10 23:42 | 56K | |
![[ ]](/icons/unknown.gif) | PHYSICAL APPEARANCE 2..docx | 2017-02-04 17:28 | 55K | |
![[ ]](/icons/layout.gif) | Grammar-PastSimplePresentPerfect_2665.pdf | 2018-11-03 21:07 | 55K | |
![[ ]](/icons/unknown.gif) | Assignments - Saturdays-1-5.docx | 2017-12-04 21:05 | 55K | |
![[ ]](/icons/layout.gif) | Plural-Possessive-Sentences-ST.pdf | 2019-09-28 21:13 | 55K | |
![[ ]](/icons/unknown.gif) | PRESENTATION QUANTIFIERS.pptx | 2020-11-15 16:07 | 55K | |
![[ ]](/icons/layout.gif) | present_simple_form_wh-questions_other-verbs.pdf | 2018-04-21 01:47 | 55K | |
![[ ]](/icons/unknown.gif) | Possessives 's G 3.1 PPP.pptx | 2014-03-26 01:29 | 55K | |
![[ ]](/icons/layout.gif) | verbs-simple-present2.pdf | 2014-10-25 17:14 | 55K | |
![[ ]](/icons/unknown.gif) | Possessives 's G 3.1.pptx | 2015-08-25 00:36 | 55K | |
![[ ]](/icons/unknown.gif) | Quite U.I. 6.3.pptx | 2015-06-03 16:03 | 54K | |
![[ ]](/icons/unknown.gif) | Presentation Negative Statements.pptx | 2020-03-14 21:29 | 54K | |
![[ ]](/icons/unknown.gif) | Practice Test.doc | 2014-11-13 02:30 | 54K | |
![[ ]](/icons/unknown.gif) | Presentation Passive Caustive .pptx | 2020-06-21 18:23 | 54K | |
![[ ]](/icons/layout.gif) | Preposition of Place.pdf | 2024-03-02 14:39 | 54K | |
![[IMG]](/icons/image2.gif) | Past-perfect-and-past-simple-1.png | 2014-07-23 05:41 | 53K | |
![[ ]](/icons/unknown.gif) | Presentation Preferences-Past Unreal Forms.pptx | 2020-06-30 20:45 | 53K | |
![[ ]](/icons/unknown.gif) | 20100115023918narrative_tense_practice.rtf | 2015-07-25 14:07 | 53K | |
![[ ]](/icons/unknown.gif) | Reported speech POSITIVE NEGATIVE.docx | 2018-06-11 18:37 | 52K | |
![[IMG]](/icons/image2.gif) | mixed cond.jpg | 2016-05-21 18:10 | 52K | |
![[ ]](/icons/unknown.gif) | The Third Conditional.doc | 2021-09-15 02:56 | 52K | |
![[ ]](/icons/layout.gif) | simple_past_07_double_consonants_worksheet.pdf | 2019-03-09 22:34 | 52K | |
![[IMG]](/icons/image2.gif) | Oral Presentation Rubric.png | 2024-05-04 10:50 | 52K | |
![[ ]](/icons/unknown.gif) | Relative Clauses EXERCISE 2.doc | 2014-02-13 03:17 | 52K | |
![[ ]](/icons/unknown.gif) | PRESENT_PERFECT_exercise_2.doc | 2019-09-11 02:34 | 52K | |
![[ ]](/icons/unknown.gif) | Reported speech POSITIVE NEGATIVE 2.docx | 2015-10-14 03:51 | 51K | |
![[ ]](/icons/layout.gif) | present_simple_form_mixed_exercise_2_other_verbs.pdf | 2018-11-03 02:38 | 51K | |
![[IMG]](/icons/image2.gif) | pronunciation-of-ed-in-english.gif | 2016-03-05 02:46 | 51K | |
![[ ]](/icons/unknown.gif) | Relative Clauses EXERCISE 1.doc | 2016-09-02 00:43 | 51K | |
![[ ]](/icons/unknown.gif) | Assignment # 3.doc | 2014-05-07 23:06 | 51K | |
![[ ]](/icons/layout.gif) | regulae verbs pronunciation.pdf | 2016-04-27 00:12 | 50K | |
![[ ]](/icons/layout.gif) | gr.edpron.pdf | 2016-08-27 01:26 | 50K | |
![[IMG]](/icons/image2.gif) | family tree.gif | 2014-08-16 17:05 | 50K | |
![[IMG]](/icons/image2.gif) | ordinal numbers.jpg | 2016-07-30 19:48 | 50K | |
![[ ]](/icons/layout.gif) | m5s5testst.pdf | 2018-02-24 00:29 | 50K | |
![[ ]](/icons/unknown.gif) | Presentation Conditionals (2) and (3) (mixed).pptx | 2020-11-15 16:12 | 49K | |
![[ ]](/icons/unknown.gif) | Presentation Purpose-Results.pptx | 2020-06-16 20:56 | 49K | |
![[ ]](/icons/unknown.gif) | Final Exam Level 3 Kids Sat 8-12 Chris.docx | 2016-12-18 21:54 | 49K | |
![[ ]](/icons/unknown.gif) | but , and.docx | 2020-07-02 00:27 | 49K | |
![[ ]](/icons/unknown.gif) | passive-voice-fun-activities-games_601.doc | 2018-06-28 23:05 | 49K | |
![[ ]](/icons/layout.gif) | stative-verbs.pdf | 2016-01-12 00:51 | 49K | |
![[ ]](/icons/layout.gif) | stative-verbs(1).pdf | 2016-01-12 02:38 | 49K | |
![[IMG]](/icons/image2.gif) | adverbs-frequency poster AST.gif | 2022-02-11 00:47 | 49K | |
![[IMG]](/icons/image2.gif) | adverbs-frequency.gif | 2019-02-16 19:22 | 49K | |
![[ ]](/icons/layout.gif) | BBCF_infoData_stock_check.pdf | 2014-08-11 20:18 | 48K | |
![[ ]](/icons/unknown.gif) | Past sim, past contin, past perfect.docx | 2020-01-28 04:17 | 48K | |
![[ ]](/icons/unknown.gif) | gbg_unittest12.doc | 2015-08-11 01:39 | 48K | |
![[ ]](/icons/unknown.gif) | P.Perfect ,PPP,past t, gerunds, infin.docx | 2019-11-26 03:35 | 47K | |
![[ ]](/icons/unknown.gif) | Presentation used to-be used to-get used to.pptx | 2020-10-18 17:46 | 47K | |
![[ ]](/icons/unknown.gif) | Presentation Nominalization).pptx | 2020-06-12 02:53 | 47K | |
![[ ]](/icons/unknown.gif) | HOW TO WRITE QUESTIONS.pptx | 2017-04-06 01:10 | 47K | |
![[ ]](/icons/unknown.gif) | Assignment 1 Unit 1.doc | 2015-07-16 18:03 | 46K | |
![[ ]](/icons/unknown.gif) | Presentation Conditionals (0) and (1).pptx | 2020-09-10 16:13 | 46K | |
![[ ]](/icons/unknown.gif) | Presentation Present - Perfect Participle Clauses.pptx | 2020-06-21 18:54 | 46K | |
![[ ]](/icons/layout.gif) | past_perfect_or_past_simple_1.pdf | 2016-01-21 01:03 | 46K | |
![[ ]](/icons/unknown.gif) | Presentation Adverbial Phrases.pptx | 2020-06-30 20:43 | 46K | |
![[ ]](/icons/unknown.gif) | quiz unit 9 fundamentals II.doc | 2015-07-06 23:10 | 46K | |
![[ ]](/icons/unknown.gif) | Quiz Unit 15 Fundamentals II.doc | 2015-09-05 14:44 | 46K | |
![[ ]](/icons/unknown.gif) | Ordinal numbers.docx | 2014-10-18 22:06 | 45K | |
![[ ]](/icons/unknown.gif) | PAST PERFECT EXERCISE.docx | 2021-10-22 03:01 | 45K | |
![[ ]](/icons/unknown.gif) | PAST PERFECT EXERCISE1.docx | 2024-05-07 16:05 | 45K | |
![[ ]](/icons/unknown.gif) | Present Perfect ,PPP,past tense,exec. level 9.docx | 2016-02-29 23:46 | 45K | |
![[ ]](/icons/unknown.gif) | Presentation Empahtic Structures 1.pptx | 2020-06-06 02:48 | 45K | |
![[ ]](/icons/unknown.gif) | Presentation Modals of Ability.pptx | 2020-09-16 17:11 | 45K | |
![[ ]](/icons/unknown.gif) | passive-voice_56903.doc | 2018-06-28 23:04 | 45K | |
![[ ]](/icons/unknown.gif) | level 2 adultos unit 5 sabados de 1 a 5pm.doc | 2014-01-22 17:18 | 45K | |
![[ ]](/icons/unknown.gif) | PAST VERB TO BE.doc | 2017-03-15 01:13 | 45K | |
![[ ]](/icons/layout.gif) | present_perfect_form_mixed_exercise_2.pdf | 2018-11-10 21:01 | 44K | |
![[ ]](/icons/unknown.gif) | REPORTED SPEECH.pptx | 2022-04-07 02:54 | 44K | |
![[ ]](/icons/layout.gif) | Pronunciation-Rules-for-the-Simple-Past-Tense-of-Regular-Verbs.pdf | 2016-08-27 01:28 | 44K | |
![[ ]](/icons/unknown.gif) | English Sentence Structures.docx | 2014-10-16 19:16 | 44K | |
![[ ]](/icons/layout.gif) | test_simple_present_en.pdf | 2019-11-10 16:17 | 44K | |
![[ ]](/icons/unknown.gif) | use-of-the-passive-voice (1).doc | 2015-04-14 01:41 | 44K | |
![[ ]](/icons/unknown.gif) | DO AND MAKE.doc | 2023-10-21 18:19 | 44K | |
![[ ]](/icons/layout.gif) | Food-Worksheet-Descriptions AST.pdf | 2022-02-16 00:28 | 43K | |
![[ ]](/icons/layout.gif) | present_continuous_all_forms_exercise_1.pdf | 2018-10-13 20:53 | 43K | |
![[ ]](/icons/unknown.gif) | PRONUNCIATION (-ED) EXERCISE..docx | 2016-11-22 01:00 | 43K | |
![[ ]](/icons/unknown.gif) | PRONUNCIATION EXERCISE.docx | 2019-02-20 02:11 | 43K | |
![[ ]](/icons/layout.gif) | present_continuous_all_forms_exercise_2.pdf | 2018-01-27 21:24 | 43K | |
![[ ]](/icons/unknown.gif) | Causatives have and get Up. In 6.2.pptx | 2015-06-03 16:03 | 42K | |
![[ ]](/icons/unknown.gif) | From passive voice to active voice.docx | 2015-11-06 12:19 | 42K | |
![[ ]](/icons/layout.gif) | present_simple_mixed_exercise_1_be_and_other_verbs.pdf | 2017-07-08 21:07 | 42K | |
![[ ]](/icons/layout.gif) | gerunds_and_infinitives_part_1.pdf | 2016-07-30 23:00 | 42K | |
![[ ]](/icons/unknown.gif) | GL10 Oral presentations briefs Wk7 118.14.docx | 2014-08-11 20:16 | 42K | |
![[ ]](/icons/unknown.gif) | telefonia_destino.xlsx | 2013-09-15 02:57 | 42K | |
![[ ]](/icons/unknown.gif) | americana trabajo #1.doc | 2017-12-04 21:25 | 42K | |
![[ ]](/icons/unknown.gif) | quiz unit 13.doc | 2015-09-05 17:23 | 41K | |
![[ ]](/icons/unknown.gif) | Assignment #2.doc | 2013-11-07 01:23 | 41K | |
![[ ]](/icons/layout.gif) | say_and_tell_exercise_1.pdf | 2020-02-19 01:53 | 41K | |
![[ ]](/icons/unknown.gif) | ASSIGNMENT 1 2014.doc | 2014-07-04 04:14 | 41K | |
![[ ]](/icons/unknown.gif) | Simple Present Exercises.pptx | 2014-09-25 01:57 | 40K | |
![[ ]](/icons/layout.gif) | gr.there.pdf | 2019-02-02 22:08 | 40K | |
![[IMG]](/icons/image2.gif) | animal song.jpg | 2017-08-12 15:22 | 40K | |
![[ ]](/icons/unknown.gif) | unit 6 level 2 adultos 2014.doc | 2014-02-07 23:56 | 40K | |
![[ ]](/icons/unknown.gif) | COMPARATIVE AND SUPERLATIVE RULES.doc | 2024-04-14 03:48 | 40K | |
![[ ]](/icons/unknown.gif) | COMPARATIVE AND SUPERLATIVE RULES (2).doc | 2023-01-28 18:09 | 40K | |
![[ ]](/icons/unknown.gif) | Grammar quiz unit 2.docx | 2015-08-12 23:06 | 40K | |
![[ ]](/icons/unknown.gif) | COMPARATIVE AND SUPERLATIVE RULES (1).doc | 2023-02-09 02:50 | 40K | |
![[ ]](/icons/layout.gif) | adverbs_of_frequency.pdf | 2019-11-16 19:32 | 39K | |
![[ ]](/icons/layout.gif) | The Great Gatsby Chapter Questions.pdf | 2018-04-24 00:24 | 39K | |
![[ ]](/icons/layout.gif) | breakfast Readcomp.pdf | 2016-11-12 18:19 | 39K | |
![[IMG]](/icons/image2.gif) | food.png | 2016-07-25 23:43 | 39K | |
![[ ]](/icons/layout.gif) | To_Be_Exercise_3 positive neg.pdf | 2015-10-03 16:23 | 39K | |
![[ ]](/icons/layout.gif) | To_Be_Exercise_3.pdf | 2017-08-05 17:53 | 39K | |
![[ ]](/icons/unknown.gif) | So vs Such Up Inter 7.2.pptx | 2015-06-08 00:59 | 39K | |
![[ ]](/icons/unknown.gif) | EXERCISE.docx | 2013-11-13 03:42 | 39K | |
![[ ]](/icons/unknown.gif) | DEMOSTRATIVE EXERCISE.docx | 2020-01-28 02:00 | 39K | |
![[ ]](/icons/unknown.gif) | quiz unit 11 fundamentals II.doc | 2015-07-21 15:33 | 39K | |
![[ ]](/icons/layout.gif) | past-simple-tense-exercises_42_13.10..pdf | 2019-06-15 02:15 | 38K | |
![[ ]](/icons/unknown.gif) | phrasal verb.docx | 2017-02-28 00:18 | 38K | |
![[ ]](/icons/layout.gif) | prefixes_suffixes.pdf | 2015-11-10 02:32 | 38K | |
![[ ]](/icons/layout.gif) | Nominalization.pdf | 2016-07-27 02:01 | 38K | |
![[ ]](/icons/layout.gif) | en33inst-l1-quiz.pdf | 2018-05-12 02:17 | 38K | |
![[ ]](/icons/layout.gif) | count and noncount review.pdf | 2016-11-19 01:34 | 38K | |
![[ ]](/icons/unknown.gif) | Unit 3 Third assignment.doc | 2015-07-31 03:28 | 38K | |
![[ ]](/icons/unknown.gif) | Regular Verbs short list.doc | 2015-04-25 18:11 | 38K | |
![[ ]](/icons/unknown.gif) | Pronoun Table Template.doc | 2015-01-14 00:17 | 38K | |
![[ ]](/icons/layout.gif) | gr.adverbs.pdf | 2019-02-23 21:23 | 37K | |
![[ ]](/icons/unknown.gif) | COMPARATIVE ADVERBS.docx | 2019-08-17 17:32 | 37K | |
![[ ]](/icons/layout.gif) | Cleft_sentences1 (1)2.pdf | 2016-11-01 01:28 | 37K | |
![[ ]](/icons/layout.gif) | Cleft_sentences1 (1).pdf | 2017-02-27 23:00 | 37K | |
![[ ]](/icons/layout.gif) | ecomsu3e1-COMPARATIVE AND SUPERLATIVES.pdf | 2017-09-23 22:14 | 37K | |
![[ ]](/icons/layout.gif) | comparatives and superlatives.pdf | 2017-02-20 22:42 | 37K | |
![[ ]](/icons/unknown.gif) | FOCUSING ADVERBS UNIT 12.docx | 2019-09-14 22:16 | 37K | |
![[ ]](/icons/unknown.gif) | Spelling_of_-ING_Verbs.doc | 2016-11-30 20:14 | 37K | |
![[ ]](/icons/unknown.gif) | SUPERLATIVE RULES.doc | 2015-11-28 01:33 | 37K | |
![[ ]](/icons/unknown.gif) | English Academy SYLLABUS Level 1.doc | 2015-07-16 18:26 | 37K | |
![[ ]](/icons/unknown.gif) | List of Verbs.docx | 2014-02-04 15:49 | 36K | |
![[ ]](/icons/unknown.gif) | definite or indefinite article (1).docx | 2023-08-09 02:54 | 36K | |
![[ ]](/icons/unknown.gif) | REPORTED SPEECH COMMANDS exercise.docx | 2019-09-11 15:22 | 36K | |
![[ ]](/icons/unknown.gif) | HAVE TO OR HAS TO.docx | 2019-11-27 00:31 | 36K | |
![[ ]](/icons/unknown.gif) | definite or indefinite article.docx | 2017-11-22 01:06 | 36K | |
![[ ]](/icons/unknown.gif) | Pronouns Reference Chart.doc | 2015-04-11 00:17 | 36K | |
![[ ]](/icons/unknown.gif) | Verb Patterns.doc | 2017-12-04 21:33 | 35K | |
![[ ]](/icons/unknown.gif) | Oral quiz scoring sheet.doc | 2015-07-16 18:29 | 35K | |
![[ ]](/icons/unknown.gif) | SECOND_CONDITIONAL_SENTENCES_TYPE_2 (2).docx | 2014-05-10 16:03 | 35K | |
![[ ]](/icons/unknown.gif) | Simple Present VS. Present Progressive.docx | 2015-05-30 18:06 | 35K | |
![[ ]](/icons/unknown.gif) | Do_or_Make_Survey.doc | 2023-08-26 03:07 | 35K | |
![[ ]](/icons/unknown.gif) | ADVERBS OF FREQUENCY ING.doc | 2018-09-06 01:25 | 35K | |
![[IMG]](/icons/image2.gif) | time signals direct & indirect speech.JPG | 2016-02-06 18:26 | 34K | |
![[ ]](/icons/layout.gif) | LOOK SEE WATCH AST.pdf | 2022-03-09 00:36 | 34K | |
![[ ]](/icons/unknown.gif) | Prepositions_after_Verbs_1.docx | 2014-11-22 17:49 | 34K | |
![[ ]](/icons/unknown.gif) | body parts.docx | 2017-06-01 00:27 | 34K | |
![[ ]](/icons/unknown.gif) | BE ALLOWED TO EXERCISE 2.docx | 2019-01-30 15:31 | 34K | |
![[ ]](/icons/unknown.gif) | 8 Parts of speech Diagnostic Ex..doc | 2015-01-14 00:15 | 34K | |
![[ ]](/icons/unknown.gif) | POSSESSIVES.docx | 2017-07-08 16:46 | 34K | |
![[ ]](/icons/unknown.gif) | I wish.docx | 2014-08-02 17:42 | 34K | |
![[ ]](/icons/unknown.gif) | Phrasal Verbs - 1.docx | 2016-12-05 22:15 | 34K | |
![[ ]](/icons/unknown.gif) | Fill in the blank with the correct verb in passive voice.docx | 2015-09-24 03:06 | 34K | |
![[ ]](/icons/unknown.gif) | Fill in the blank in passive voice.docx | 2016-04-09 17:51 | 34K | |
![[ ]](/icons/layout.gif) | phrasal_verbs.pdf | 2016-11-02 01:15 | 33K | |
![[ ]](/icons/unknown.gif) | level_1-2_lesson_10_reading_text.docx | 2021-07-21 03:40 | 33K | |
![[ ]](/icons/unknown.gif) | SECOND_CONDITIONAL_SENTENCES_TYPE_2.docx | 2023-12-16 03:07 | 33K | |
![[ ]](/icons/unknown.gif) | SECOND_CONDITIONAL_SENTENCES_TYPE_2 (1).docx | 2017-06-15 00:52 | 33K | |
![[ ]](/icons/unknown.gif) | FIRST_CONDITIONAL (2).docx | 2022-11-16 02:58 | 33K | |
![[ ]](/icons/unknown.gif) | advanced-6b-ellipsis-and-substitution.doc | 2016-11-29 00:23 | 33K | |
![[ ]](/icons/unknown.gif) | Second Assignment.doc | 2015-07-24 04:37 | 33K | |
![[ ]](/icons/unknown.gif) | Countable and uncountable nouns.doc | 2015-11-20 00:11 | 33K | |
![[ ]](/icons/unknown.gif) | SUPERLATIVE_RULES.doc | 2014-08-23 17:43 | 33K | |
![[ ]](/icons/unknown.gif) | SUPERLATIVE_RULES (1).doc | 2014-05-31 15:13 | 33K | |
![[ ]](/icons/unknown.gif) | PAST PERFECT or SIMPLE PAST.docx | 2021-07-27 03:01 | 32K | |
![[ ]](/icons/layout.gif) | TACEnglish_ET_v11_VP_3.2.6_Nominalisation_v1.pdf | 2016-07-27 02:03 | 32K | |
![[ ]](/icons/unknown.gif) | Future continuous and future perfect.docx | 2020-02-06 04:19 | 32K | |
![[ ]](/icons/layout.gif) | esingp1e1.pdf | 2019-04-27 02:26 | 32K | |
![[ ]](/icons/unknown.gif) | SIMPLE vs PROGRESSIVE 2.doc | 2018-04-17 01:50 | 32K | |
![[ ]](/icons/unknown.gif) | Prepositions after Verbs 1.docx | 2024-02-17 18:01 | 32K | |
![[IMG]](/icons/image2.gif) | THIRD PERSON SINGULAR VERB SPELLING.jpg | 2019-02-02 01:46 | 32K | |
![[ ]](/icons/unknown.gif) | UNIT 4 (GRAMMAR).docx | 2020-02-04 01:57 | 31K | |
![[ ]](/icons/layout.gif) | simple_past_55_questions_worksheet.pdf | 2018-07-13 01:01 | 31K | |
![[ ]](/icons/unknown.gif) | Johannes Vermeer Bio 215.14.docx | 2015-05-15 21:43 | 31K | |
![[ ]](/icons/unknown.gif) | Short stories.doc | 2014-08-23 15:42 | 31K | |
![[ ]](/icons/unknown.gif) | Book Report Information Sheet.doc | 2017-01-30 21:49 | 31K | |
![[IMG]](/icons/image2.gif) | image.png | 2023-10-20 02:44 | 31K | |
![[ ]](/icons/unknown.gif) | Happy by Pharell Williams.docx | 2016-05-07 15:23 | 31K | |
![[ ]](/icons/unknown.gif) | ORAL PRESENTATION My Favorite Place.docx | 2024-03-16 00:49 | 31K | |
![[ ]](/icons/unknown.gif) | MIXED CONDITIONAL GRAMMAR UNIT 8 LEVEL 4.docx | 2020-09-03 02:59 | 31K | |
![[ ]](/icons/unknown.gif) | Book Report Project - information page - 2nd term 2012.doc | 2015-06-29 18:08 | 31K | |
![[ ]](/icons/layout.gif) | Indefinite Pronouns.pdf | 2018-08-25 20:55 | 30K | |
![[IMG]](/icons/image2.gif) | There is or There are.jpg | 2015-04-22 01:29 | 30K | |
![[ ]](/icons/layout.gif) | auxiliaries unit 1.pdf | 2013-10-01 21:52 | 30K | |
![[ ]](/icons/unknown.gif) | What is Haiku.doc | 2014-06-25 23:14 | 30K | |
![[IMG]](/icons/image2.gif) | got talent.jpg | 2014-07-26 16:10 | 30K | |
![[IMG]](/icons/image2.gif) | INSTRUCTIONS WOKRSHEET ONLINE.JPG | 2023-01-26 01:58 | 30K | |
![[ ]](/icons/layout.gif) | reported.pdf | 2015-08-15 01:14 | 30K | |
![[ ]](/icons/unknown.gif) | passive-with-reporting-verbs-worksheet.doc | 2019-12-06 00:39 | 30K | |
![[ ]](/icons/unknown.gif) | FUTURE CLAUSES.doc | 2015-02-11 23:51 | 30K | |
![[ ]](/icons/unknown.gif) | An Extensive List of Phrasal Verbs.docx | 2017-05-30 00:46 | 29K | |
![[ ]](/icons/unknown.gif) | QUIZ 1.doc | 2015-01-24 15:25 | 29K | |
![[ ]](/icons/unknown.gif) | GRAMMAR UNIT 12 BOOK 5.docx | 2021-09-08 00:58 | 29K | |
![[IMG]](/icons/image2.gif) | INDEFINITE PRONOUNS POSTER AST.jpg | 2022-03-29 01:01 | 29K | |
![[ ]](/icons/unknown.gif) | Parts of Speech Table Reference.doc | 2015-02-07 16:18 | 29K | |
![[ ]](/icons/unknown.gif) | PAST MODALS EXERCISE 2.docx | 2022-06-11 03:39 | 28K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT EXERCISE.doc | 2019-04-01 23:51 | 28K | |
![[ ]](/icons/unknown.gif) | UNIT 7 GRAMMAR EXPLANATION.docx | 2020-02-21 23:59 | 28K | |
![[ ]](/icons/layout.gif) | 48393_imperative.pdf | 2018-05-12 02:15 | 28K | |
![[ ]](/icons/unknown.gif) | REPORTED SPEECH POSITIVE.docx | 2016-08-13 17:27 | 28K | |
![[ ]](/icons/layout.gif) | simple_past_13_irregular_verbs_worksheets.pdf | 2017-06-10 02:36 | 28K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT EXERCISE (1).doc | 2021-07-31 18:18 | 28K | |
![[ ]](/icons/unknown.gif) | Book_Report_Project_-_information_page_-.doc | 2015-11-24 00:10 | 28K | |
![[ ]](/icons/layout.gif) | INVERSION+STRUCTURES life 6 unit 2.pdf | 2019-02-12 01:34 | 27K | |
![[ ]](/icons/unknown.gif) | ENG I SYLLABUS GLOBAL 1 for 11 weeks.docx | 2014-09-25 00:04 | 27K | |
![[ ]](/icons/unknown.gif) | Test 3.docx | 2014-08-28 02:58 | 27K | |
![[ ]](/icons/unknown.gif) | Write down the correct form.docx | 2013-11-19 16:34 | 27K | |
![[ ]](/icons/unknown.gif) | PASSIVE_EXE_3.docx | 2015-01-17 15:58 | 27K | |
![[ ]](/icons/unknown.gif) | Reported Speech, level 8.docx | 2014-11-07 20:31 | 27K | |
![[ ]](/icons/unknown.gif) | Reported Speech, level 6.docx | 2015-02-06 13:56 | 27K | |
![[ ]](/icons/layout.gif) | there is-are 2 (2).pdf | 2017-02-18 17:22 | 27K | |
![[ ]](/icons/unknown.gif) | English II Syllabus 8 weeks.docx | 2015-10-15 23:03 | 27K | |
![[ ]](/icons/unknown.gif) | grammar Units 10 and 12 book 4.docx | 2020-03-12 00:09 | 27K | |
![[ ]](/icons/layout.gif) | singular_and_plural_nouns_WS3.pdf | 2019-04-27 22:15 | 27K | |
![[ ]](/icons/unknown.gif) | FUN A Syllabus 8 weeks WED.docx | 2015-01-14 02:29 | 26K | |
![[ ]](/icons/unknown.gif) | WILL AND WON'T.docx | 2016-09-23 21:44 | 26K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT EXERCISE 4.docx | 2017-08-02 14:43 | 26K | |
![[ ]](/icons/unknown.gif) | FUN A Syllabus 8 weeks.docx | 2015-03-18 00:20 | 26K | |
![[ ]](/icons/unknown.gif) | Reading Comprehension Biography.doc | 2015-11-03 17:15 | 26K | |
![[ ]](/icons/unknown.gif) | 10 practical tips for writing better exam essays.docx | 2014-09-28 19:23 | 26K | |
![[ ]](/icons/layout.gif) | simple_past_40_irregular_verbs_to_be_worksheet (1).pdf | 2018-04-14 21:29 | 26K | |
![[ ]](/icons/layout.gif) | regular-verbs-list-different-spelling (1).pdf | 2018-12-01 01:41 | 26K | |
![[ ]](/icons/unknown.gif) | tongue twisters.doc | 2018-02-15 02:30 | 26K | |
![[ ]](/icons/unknown.gif) | Syllabus level 6 Ucles.docx | 2013-10-01 21:18 | 25K | |
![[ ]](/icons/unknown.gif) | QUANTIFIERS.docx | 2018-07-17 00:34 | 25K | |
![[ ]](/icons/layout.gif) | comparativesandsuperlatives.pdf | 2018-07-13 00:58 | 25K | |
![[ ]](/icons/layout.gif) | comparativesandsuperlatives (1).pdf | 2018-09-22 22:17 | 25K | |
![[ ]](/icons/unknown.gif) | should-shouldn't.docx | 2017-09-02 15:15 | 25K | |
![[ ]](/icons/layout.gif) | past-simple-exercise-7.pdf | 2019-06-15 02:17 | 25K | |
![[ ]](/icons/unknown.gif) | INDEFINITE OF PLACE.docx | 2016-12-03 17:50 | 25K | |
![[ ]](/icons/layout.gif) | irregular verbs chart - alphabetical order.pdf | 2017-03-11 18:32 | 25K | |
![[ ]](/icons/layout.gif) | regular verbs list.pdf | 2018-05-26 02:17 | 25K | |
![[ ]](/icons/unknown.gif) | GLOBAL Syllabus Level 3 Units 1-5.docx | 2015-10-15 14:26 | 25K | |
![[ ]](/icons/unknown.gif) | PASSIVE EXE 3.docx | 2016-11-09 00:40 | 25K | |
![[ ]](/icons/unknown.gif) | RELATIVE_CLAUSES_EXERCISE_2.docx | 2015-05-02 15:04 | 24K | |
![[ ]](/icons/unknown.gif) | RELATIVE CLAUSES EXERCISE 4.docx | 2023-12-19 02:57 | 24K | |
![[ ]](/icons/unknown.gif) | RELATIVE CLAUSES EXERCISE 3.docx | 2016-02-06 15:29 | 24K | |
![[ ]](/icons/layout.gif) | test_simple_past_en.pdf | 2018-07-13 01:04 | 24K | |
![[ ]](/icons/unknown.gif) | AMERICAN ENGLISH ACADEMY Unit 8.docx | 2016-03-12 16:51 | 24K | |
![[ ]](/icons/unknown.gif) | Reading Comprehension 1 level 2.docx | 2018-07-23 20:39 | 24K | |
![[ ]](/icons/unknown.gif) | AMERICAN SCHOOL eNGLISH ACADEMY Quiz Unit 7.docx | 2016-03-12 16:50 | 24K | |
![[ ]](/icons/unknown.gif) | Exercise on Relative Clauses.docx | 2014-08-02 17:34 | 24K | |
![[ ]](/icons/unknown.gif) | GLOBAL Syllabus Level 5 Units 1-5.docx | 2015-07-02 20:30 | 24K | |
![[IMG]](/icons/image2.gif) | count1.png | 2015-08-04 02:28 | 24K | |
![[ ]](/icons/layout.gif) | GOING TO 1.pdf | 2017-10-21 21:14 | 24K | |
![[ ]](/icons/layout.gif) | FUTUREWITHGOINGTO2.pdf | 2017-10-21 00:34 | 24K | |
![[ ]](/icons/unknown.gif) | Verb Lists infinitive & gerunds | 2013-11-01 17:17 | 24K | |
![[ ]](/icons/unknown.gif) | PRONUNCIATION_RULES.doc | 2019-05-09 02:29 | 24K | |
![[ ]](/icons/unknown.gif) | Basic Verb List.docx | 2016-03-05 02:47 | 24K | |
![[ ]](/icons/unknown.gif) | GLOBAL Oral presentation RUBRIC level VI Units 6-7 REVISED.docx | 2015-10-15 14:28 | 24K | |
![[ ]](/icons/unknown.gif) | GRAMMAR UNIT 11 BOOK 5.docx | 2020-03-13 00:51 | 24K | |
![[ ]](/icons/unknown.gif) | GLOBAL Oral presentation RUBRIC level VI Units 6-7.docx | 2015-06-11 23:00 | 23K | |
![[ ]](/icons/unknown.gif) | GLOBAL Oral presentation RUBRIC level 6.docx | 2016-03-01 22:58 | 23K | |
![[ ]](/icons/unknown.gif) | REPORTED SPEECH COMMANDS exercise.2.docx | 2016-09-20 23:37 | 23K | |
![[ ]](/icons/unknown.gif) | PAST_MODALS EXERCISE.docx | 2017-08-25 00:10 | 23K | |
![[ ]](/icons/unknown.gif) | English VII Syllabus (Saturday afternoon) [complete].docx | 2013-10-07 05:23 | 23K | |
![[ ]](/icons/unknown.gif) | PAST MODALS.docx | 2023-11-21 03:08 | 23K | |
![[ ]](/icons/unknown.gif) | Conditional Clause and Main Clause.docx | 2017-05-10 15:44 | 23K | |
![[ ]](/icons/unknown.gif) | Indirect Questions Exercise 2.docx | 2022-05-04 02:53 | 23K | |
![[ ]](/icons/unknown.gif) | GLOBAL Syllabus Fundamentals 1.docx | 2015-07-11 02:20 | 23K | |
![[ ]](/icons/unknown.gif) | PAST_MODALS EXERCISE (1).docx | 2017-06-02 00:14 | 23K | |
![[ ]](/icons/unknown.gif) | GLOBAL Oral presentation RUBRIC Fundamentals.docx | 2015-02-02 23:02 | 23K | |
![[ ]](/icons/layout.gif) | most-common-irregular-verbs.pdf | 2020-02-17 23:35 | 23K | |
![[ ]](/icons/unknown.gif) | Legal Systems Group Oral Presentations GL7 Wk4.docx | 2014-11-06 23:43 | 23K | |
![[ ]](/icons/unknown.gif) | Legal Systems Group Oral Presentations GL7 Wk#4.docx | 2014-11-06 21:10 | 23K | |
![[ ]](/icons/unknown.gif) | LIFE Oral presentation 2 RUBRIC level 5.docx | 2016-11-30 00:58 | 23K | |
![[ ]](/icons/unknown.gif) | Passive voice with reporting verbs Explanation docx.docx | 2020-02-27 02:58 | 23K | |
![[ ]](/icons/unknown.gif) | PronunciationTT.doc | 2015-02-07 16:16 | 23K | |
![[ ]](/icons/layout.gif) | past-simple-exercise-1.pdf | 2019-06-15 02:18 | 23K | |
![[ ]](/icons/unknown.gif) | GLOBAL Oral presentation RUBRIC level 4.docx | 2014-07-08 22:36 | 23K | |
![[ ]](/icons/layout.gif) | WorksheetWorks_Possessive_Noun_Phrases_1.pdf | 2015-02-19 03:17 | 23K | |
![[ ]](/icons/unknown.gif) | GLOBAL Syllabus Level 6.docx | 2016-01-19 22:17 | 23K | |
![[ ]](/icons/unknown.gif) | GLOBAL Syllabus Level 6 Syllabus-Raquel Molina.docx | 2015-05-26 22:18 | 23K | |
![[ ]](/icons/unknown.gif) | Present_Perfect_Progressive_Ex_1.docx | 2017-10-28 00:12 | 23K | |
![[ ]](/icons/unknown.gif) | Adjective.docx | 2013-10-31 21:19 | 23K | |
![[ ]](/icons/unknown.gif) | Present_Perfect_Progressive_Ex_1 (1).docx | 2017-08-04 00:58 | 23K | |
![[ ]](/icons/unknown.gif) | test unit 1, Alive and Well.docx | 2014-07-19 02:15 | 22K | |
![[ ]](/icons/layout.gif) | avaliacion.pdf | 2017-11-14 01:51 | 22K | |
![[ ]](/icons/layout.gif) | FEGCh2PronunciationRegularPastTenseVerbs.pdf | 2019-03-23 20:07 | 22K | |
![[ ]](/icons/layout.gif) | FEGCh2PronunciationRegularPastTenseVerbs (1).pdf | 2020-02-18 23:29 | 22K | |
![[ ]](/icons/unknown.gif) | Fundamentals B Global Planning.docx | 2015-04-09 00:22 | 22K | |
![[ ]](/icons/layout.gif) | WorksheetWorks_Possessive_Nouns_1.pdf | 2016-09-24 22:54 | 22K | |
![[ ]](/icons/layout.gif) | Verb ListsInfinIng.pdf | 2016-03-17 01:46 | 22K | |
![[ ]](/icons/unknown.gif) | Quiz unit 1.docx | 2015-05-07 01:36 | 22K | |
![[ ]](/icons/unknown.gif) | Regular and Irregular Verbs List.docx | 2015-06-29 18:59 | 22K | |
![[ ]](/icons/unknown.gif) | AST OVERALL EVALUATION #2.docx | 2022-03-31 01:08 | 22K | |
![[ ]](/icons/unknown.gif) | GLOBAL Oral presentation RUBRIC level 6 unit 8-9.docx | 2015-09-21 22:08 | 22K | |
![[ ]](/icons/unknown.gif) | GLOBAL Oral presentation RUBRIC Level 3 (1-2).docx | 2015-11-03 22:07 | 22K | |
![[ ]](/icons/unknown.gif) | Golden Age of Holland 1568-1700.docx | 2015-05-15 21:45 | 22K | |
![[ ]](/icons/unknown.gif) | LIFE Oral presentation RUBRIC Level IV 10-12.docx | 2020-03-07 21:59 | 22K | |
![[ ]](/icons/unknown.gif) | World EcoDeficit 2006.doc | 2015-01-14 00:12 | 22K | |
![[ ]](/icons/layout.gif) | can-cannot-exercise-4.pdf | 2019-11-09 19:19 | 21K | |
![[IMG]](/icons/image2.gif) | simple present - rules.png | 2019-05-25 17:22 | 21K | |
![[ ]](/icons/unknown.gif) | RELATIVE CLAUSES EXERCISE 2..docx | 2018-02-15 00:47 | 21K | |
![[ ]](/icons/layout.gif) | can-cannot-exercise-1.pdf | 2019-11-09 19:18 | 21K | |
![[ ]](/icons/unknown.gif) | passive voice.docx | 2020-02-27 04:13 | 21K | |
![[ ]](/icons/unknown.gif) | LIFE Oral presentation RUBRIC level 6 units 7-9.docx | 2019-11-09 00:50 | 21K | |
![[ ]](/icons/unknown.gif) | SECOND CONDITIONAL EX.docx | 2015-08-06 00:12 | 21K | |
![[ ]](/icons/layout.gif) | The real story of the three little pigs.pdf | 2015-03-18 02:52 | 21K | |
![[ ]](/icons/unknown.gif) | ORAL BOOK REPORT RUBRIC 1.docx | 2015-06-17 19:17 | 21K | |
![[ ]](/icons/unknown.gif) | prepositions_of_time test.docx | 2017-07-22 17:17 | 21K | |
![[ ]](/icons/unknown.gif) | GLOBAL Oral presentation RUBRIC-Level 8.docx | 2014-07-25 22:12 | 21K | |
![[ ]](/icons/unknown.gif) | Verb Tense Reference Table.docx | 2015-01-15 18:44 | 21K | |
![[ ]](/icons/layout.gif) | phrasal-verbs-separable-not1.pdf | 2016-08-01 21:33 | 21K | |
![[ ]](/icons/layout.gif) | Nominalizations.pdf | 2016-06-04 21:47 | 21K | |
![[ ]](/icons/unknown.gif) | Exercise on Past Perfect Simple.docx | 2014-02-28 16:06 | 21K | |
![[ ]](/icons/unknown.gif) | PASSIVE VOICE FOR ALL TENSES RULES.docx | 2015-04-18 00:31 | 21K | |
![[ ]](/icons/unknown.gif) | datos facturacion.docx | 2013-09-15 02:57 | 21K | |
![[ ]](/icons/unknown.gif) | Grammar quiz unit 1.docx | 2015-10-24 14:13 | 21K | |
![[ ]](/icons/unknown.gif) | irregular verbs.docx | 2013-11-14 03:45 | 21K | |
![[ ]](/icons/unknown.gif) | Grammar quiz 1A.docx | 2015-10-28 23:00 | 21K | |
![[ ]](/icons/unknown.gif) | the tree little pigs.docx | 2016-06-11 22:51 | 21K | |
![[ ]](/icons/unknown.gif) | AST OVERALL EVALUATION.docx | 2022-03-30 01:20 | 20K | |
![[ ]](/icons/unknown.gif) | Explanation of the passive forms unit 2 Life 6 Edition 2.docx | 2020-01-24 00:47 | 20K | |
![[ ]](/icons/unknown.gif) | LIFE Oral Presentation level 3 Units 1-2.docx | 2018-10-20 14:31 | 20K | |
![[ ]](/icons/unknown.gif) | LIFE Oral presentation RUBRIC level 3 Units 1-2.docx | 2018-07-28 21:37 | 20K | |
![[ ]](/icons/unknown.gif) | LIFE Oral presentation RUBRIC level 6 units 10-12.docx | 2018-09-26 01:19 | 20K | |
![[IMG]](/icons/image2.gif) | possessive adj..png | 2019-02-12 14:48 | 20K | |
![[ ]](/icons/unknown.gif) | Read the story (past tense regular verbs pronunciation.docx | 2015-11-11 00:56 | 20K | |
![[ ]](/icons/unknown.gif) | LIFE Oral presentation RUBRIC level 5 Raquel.docx | 2017-08-10 23:34 | 20K | |
![[ ]](/icons/unknown.gif) | LIFE Oral presentation RUBRIC level 5 Raquel Molina.docx | 2018-02-02 00:06 | 20K | |
![[ ]](/icons/unknown.gif) | Quiz Grammar.docx | 2015-06-12 22:45 | 20K | |
![[ ]](/icons/unknown.gif) | Conditionals.docx | 2019-02-02 18:04 | 20K | |
![[ ]](/icons/unknown.gif) | future forms 2.docx | 2018-06-09 17:37 | 20K | |
![[ ]](/icons/unknown.gif) | Adjectives Order Ref. doc1 GL7.docx | 2014-11-06 23:38 | 20K | |
![[ ]](/icons/unknown.gif) | Adjectives Order Ref. doc#1 GL7.docx | 2014-11-06 23:36 | 20K | |
![[ ]](/icons/unknown.gif) | Inversion Grammar.docx | 2016-05-23 21:46 | 20K | |
![[ ]](/icons/unknown.gif) | LIFE Oral presentation RUBRIC level 5.docx | 2016-10-27 23:32 | 20K | |
![[ ]](/icons/layout.gif) | Using+Gerunds+and+Infinitives(1).pdf | 2016-04-21 00:57 | 20K | |
![[ ]](/icons/layout.gif) | Using+Gerunds+and+Infinitives(1)(2).pdf | 2016-04-22 01:24 | 20K | |
![[ ]](/icons/unknown.gif) | Gerunds Reference & Grammar Rules.docx | 2015-04-24 22:56 | 20K | |
![[ ]](/icons/unknown.gif) | Simple Present Rules 2019 Nov.docx | 2019-11-16 17:57 | 20K | |
![[ ]](/icons/unknown.gif) | RELATIVE CLAUSES.docx | 2018-02-24 17:53 | 20K | |
![[ ]](/icons/unknown.gif) | Supermarket vocabulary.docx | 2014-06-30 03:42 | 20K | |
![[ ]](/icons/unknown.gif) | LV 2 - American School 2014.docx | 2014-01-18 21:53 | 20K | |
![[ ]](/icons/unknown.gif) | Past simple Class.docx | 2015-05-26 02:19 | 20K | |
![[ ]](/icons/unknown.gif) | Simple Present Rules 2019 agst.docx | 2019-08-10 17:19 | 20K | |
![[ ]](/icons/layout.gif) | Much, many, some, any_ grammar exercise.pdf | 2019-03-02 02:20 | 20K | |
![[ ]](/icons/unknown.gif) | Exercise on Questions.docx | 2016-01-16 17:46 | 20K | |
![[ ]](/icons/unknown.gif) | WRITTEN EVALUATION-Unit 2-L2-HMC.docx | 2019-07-02 22:58 | 19K | |
![[ ]](/icons/unknown.gif) | cleft sentence is a complex sentence - Ref Doc.docx | 2015-04-18 00:32 | 19K | |
![[ ]](/icons/unknown.gif) | UNIT 5 GRAMMAR.docx | 2020-02-11 00:33 | 19K | |
![[ ]](/icons/layout.gif) | LIFE Character-Analysis-Rubric.pdf | 2018-06-11 23:39 | 19K | |
![[ ]](/icons/unknown.gif) | Common verbs followed by a GERUND or INFINITIVES.docx | 2016-05-31 02:01 | 19K | |
![[ ]](/icons/layout.gif) | test_simple_present_progressive2_en.pdf | 2018-07-21 20:57 | 19K | |
![[ ]](/icons/unknown.gif) | LIFE Oral presentation RUBRIC Level 2 (7-8).docx | 2019-08-03 21:39 | 19K | |
![[ ]](/icons/unknown.gif) | Order of Adjectives Ref Doc2.docx | 2015-01-29 18:48 | 19K | |
![[ ]](/icons/unknown.gif) | Order of Adjectives Ref Doc#2.docx | 2014-11-06 21:06 | 19K | |
![[ ]](/icons/unknown.gif) | Simple Present Rules 2020 Enero.docx | 2020-02-08 17:13 | 19K | |
![[ ]](/icons/unknown.gif) | GirlwPearl FilmCast & Com Qs GL10 155.15.docx | 2015-05-15 21:41 | 19K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST VS PERFECT.docx | 2018-08-14 02:25 | 19K | |
![[ ]](/icons/unknown.gif) | Irregular Verbs List.docx | 2014-11-05 02:00 | 19K | |
![[ ]](/icons/unknown.gif) | unit 9 L2 book 3.docx | 2020-03-05 00:21 | 19K | |
![[ ]](/icons/unknown.gif) | RELATIVE CLAUSES 3.docx | 2019-05-04 16:12 | 19K | |
![[IMG]](/icons/image2.gif) | worksheet.jpg | 2014-05-26 01:37 | 19K | |
![[ ]](/icons/unknown.gif) | Syllabus Level 3 daily.docx | 2014-01-15 00:48 | 19K | |
![[ ]](/icons/unknown.gif) | Transportation Video - Study Guide.docx | 2013-11-15 02:00 | 19K | |
![[ ]](/icons/unknown.gif) | Syllabus Level 2 daily.docx | 2014-01-15 02:09 | 19K | |
![[ ]](/icons/unknown.gif) | Phrases with DO.docx | 2016-07-18 22:06 | 19K | |
![[ ]](/icons/unknown.gif) | Rolling in the deep by Adele (level 4).docx | 2020-08-19 12:49 | 19K | |
![[ ]](/icons/unknown.gif) | EITHER NEITHER BOTH EX..docx | 2013-12-10 17:39 | 19K | |
![[ ]](/icons/unknown.gif) | LEVEL 5 QUIZ UNIT 4 TEENS NOV.13, 2013.docx | 2013-11-24 02:14 | 19K | |
![[ ]](/icons/unknown.gif) | Subject pronouns and possessive adjectives STUDENDTS SHEETS.docx | 2015-08-11 02:02 | 19K | |
![[ ]](/icons/unknown.gif) | UNIT 5 BOOK 4 GRAMMAR.docx | 2020-02-11 00:29 | 19K | |
![[ ]](/icons/unknown.gif) | Little Red Riding Hood.docx | 2015-01-30 09:55 | 19K | |
![[ ]](/icons/unknown.gif) | UNIT 11 grammar book 5.docx | 2021-09-10 01:22 | 19K | |
![[ ]](/icons/unknown.gif) | used to get used to be used to.docx | 2018-09-05 20:11 | 19K | |
![[ ]](/icons/unknown.gif) | Unit 7 book 4 grammar explanation.docx | 2020-02-22 00:46 | 19K | |
![[ ]](/icons/unknown.gif) | LEVEL 5 QUIZ UNIT 3 TEENS Nov. 16 2013.docx | 2013-11-24 02:12 | 18K | |
![[ ]](/icons/unknown.gif) | Amex L7 Synthesis Paras exercise.docx | 2015-01-14 00:19 | 18K | |
![[ ]](/icons/unknown.gif) | the Cat and the mousee.docx | 2014-06-29 17:56 | 18K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT-UNIT 2L4NE.docx | 2020-08-04 15:56 | 18K | |
![[ ]](/icons/unknown.gif) | final test juv 4.docx | 2017-09-02 17:14 | 18K | |
![[ ]](/icons/unknown.gif) | Pronunciation words level 10 week 1.docx | 2020-06-26 03:12 | 18K | |
![[ ]](/icons/unknown.gif) | Modals of Possibility and Probability for Past Situations asnwers.docx | 2019-08-29 18:39 | 18K | |
![[ ]](/icons/unknown.gif) | Unit 12 L2.docx | 2020-03-13 00:16 | 18K | |
![[ ]](/icons/unknown.gif) | American School English academy 2017.docx | 2017-08-18 00:43 | 18K | |
![[ ]](/icons/unknown.gif) | GL10 LPD1 Fri 100415.docx | 2015-04-11 00:10 | 18K | |
![[ ]](/icons/unknown.gif) | GL10 LP#D1 Fri 10.04.15.docx | 2015-04-10 23:33 | 18K | |
![[ ]](/icons/unknown.gif) | GERUNDS BEG.docx | 2019-10-26 17:50 | 18K | |
![[ ]](/icons/unknown.gif) | MODAL VERBS 2&3 - INTERMEDIATE.docx | 2018-11-07 01:14 | 18K | |
![[ ]](/icons/unknown.gif) | grammar unit 6 sat.docx | 2019-06-15 17:52 | 18K | |
![[ ]](/icons/unknown.gif) | Separable Phrasal Verbs.docx | 2015-12-04 02:08 | 18K | |
![[ ]](/icons/unknown.gif) | Life 2e Oral Presentation Level 3 4-5.docx | 2019-11-25 22:24 | 18K | |
![[ ]](/icons/unknown.gif) | LIFE-UNIT 3L4.docx | 2020-08-13 12:37 | 18K | |
![[ ]](/icons/unknown.gif) | SECOND CONDITIONAL.docx | 2018-12-01 17:15 | 18K | |
![[ ]](/icons/unknown.gif) | Written assignment-Unit 3-L4D.docx | 2018-11-12 22:58 | 18K | |
![[ ]](/icons/unknown.gif) | ABOUT THE CLASS AND RUBRIC.docx | 2024-04-14 03:43 | 18K | |
![[ ]](/icons/unknown.gif) | The True Story of the Three Little Pigs 2.docx | 2020-09-12 02:03 | 18K | |
![[ ]](/icons/unknown.gif) | Syllabus Fundamentals2014.docx | 2014-10-04 22:51 | 18K | |
![[ ]](/icons/unknown.gif) | EDITING PRACTICE PAST TENSE.docx | 2017-11-04 16:44 | 18K | |
![[ ]](/icons/unknown.gif) | Life UNIT 7 TEST.docx | 2019-10-18 20:26 | 18K | |
![[ ]](/icons/unknown.gif) | TOPICS.docx | 2018-06-11 15:49 | 18K | |
![[ ]](/icons/unknown.gif) | Life-unit5L4.docx | 2020-03-07 18:11 | 18K | |
![[ ]](/icons/unknown.gif) | Fundamentals Course Outline.docx | 2014-10-04 22:53 | 18K | |
![[ ]](/icons/unknown.gif) | INDIRECT SPEECH LEVEL 4.docx | 2014-12-02 02:31 | 18K | |
![[ ]](/icons/unknown.gif) | ORAL PRESENTATION GUIDELINES ADULTS SEMI-INTENSIVE.docx | 2020-02-14 14:51 | 18K | |
![[ ]](/icons/unknown.gif) | Diagnostic LP Gobal L8 24.14.docx | 2014-04-23 19:26 | 18K | |
![[ ]](/icons/unknown.gif) | Wk2 Course Outline.docx | 2015-04-18 00:29 | 17K | |
![[ ]](/icons/layout.gif) | Possessive adjectives worksheet.pdf | 2018-07-14 02:20 | 17K | |
![[ ]](/icons/unknown.gif) | level 5 unit2.docx | 2014-08-16 14:47 | 17K | |
![[ ]](/icons/unknown.gif) | Global L8 Wed LP#3 234.14.docx | 2014-04-23 22:50 | 17K | |
![[ ]](/icons/unknown.gif) | AMERICAN SCHOOL ENGLISH ACADEMY quiz unit 1 level 5.docx | 2013-10-19 14:27 | 17K | |
![[ ]](/icons/unknown.gif) | FIRST CONDITIONAL-intermediate.docx | 2018-11-07 01:11 | 17K | |
![[ ]](/icons/unknown.gif) | COMPARATIVE-SUPERLATIVE adj.docx | 2018-02-10 17:36 | 17K | |
![[ ]](/icons/unknown.gif) | Written Assignment-L5-Units - 10-11 docx.docx | 2020-07-01 15:47 | 17K | |
![[ ]](/icons/unknown.gif) | Wriiten Assignment Unit 10-11L3NE.docx | 2020-02-07 17:59 | 17K | |
![[ ]](/icons/unknown.gif) | LEVEL 5 UNIT 3 QUIZ SAT 31.docx | 2014-08-30 14:23 | 17K | |
![[ ]](/icons/unknown.gif) | Speech Rubric LEVEL IV.docx | 2013-11-05 02:32 | 17K | |
![[ ]](/icons/unknown.gif) | cindirella fairy tale scrip.docx | 2014-03-18 02:52 | 17K | |
![[ ]](/icons/unknown.gif) | Practice 2.docx | 2016-05-17 23:11 | 17K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT.docx | 2018-08-14 02:25 | 17K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT (1).docx | 2017-08-26 14:39 | 17K | |
![[ ]](/icons/unknown.gif) | Passive sentences (2).docx | 2019-05-30 03:23 | 17K | |
![[ ]](/icons/unknown.gif) | Exercise on Simple Present.docx | 2016-07-06 02:00 | 17K | |
![[ ]](/icons/unknown.gif) | FUN A GLOBAL INFO First day (1).docx | 2015-03-18 00:18 | 17K | |
![[ ]](/icons/unknown.gif) | phrasal verbs exercise.docx | 2015-12-04 02:58 | 17K | |
![[ ]](/icons/unknown.gif) | PAST TENSE REVIEW 1.docx | 2016-07-30 18:33 | 17K | |
![[ ]](/icons/unknown.gif) | PAST TENSE REVIEW 1 (1).docx | 2016-09-01 03:03 | 17K | |
![[ ]](/icons/unknown.gif) | simple present1 excersises Fun1.docx | 2013-11-10 22:59 | 17K | |
![[ ]](/icons/unknown.gif) | Rubric- Final Project (Grant Proposal) Level 8.docx | 2014-03-08 18:05 | 17K | |
![[ ]](/icons/unknown.gif) | GL10 Adv. Diagnostic LP#1 306.14.docx | 2014-07-07 17:21 | 17K | |
![[ ]](/icons/unknown.gif) | CAN or CAN.docx | 2018-11-03 03:45 | 17K | |
![[ ]](/icons/unknown.gif) | Wk3 Course Outline.docx | 2015-04-24 22:53 | 17K | |
![[ ]](/icons/unknown.gif) | Written Assignment-L5-Unit 7.docx | 2020-06-13 00:51 | 17K | |
![[ ]](/icons/unknown.gif) | Written Assignment-L5-Unit 4-5.docx | 2020-06-06 02:52 | 17K | |
![[ ]](/icons/unknown.gif) | L1 u10 book 2.docx | 2020-03-05 00:21 | 17K | |
![[ ]](/icons/unknown.gif) | Both.docx | 2014-12-11 00:03 | 17K | |
![[ ]](/icons/unknown.gif) | WRITTEN EVALUATION-Unit 6-L3-Dailies.docx | 2019-05-30 21:12 | 17K | |
![[ ]](/icons/unknown.gif) | AMERICAN SCHOOL ENGLISH ACADEMY QUIZ 7 LEVEL 2 ADULTOS.docx | 2014-02-08 01:21 | 17K | |
![[ ]](/icons/layout.gif) | FUTURE WITH WILL.pdf | 2018-12-01 22:13 | 17K | |
![[ ]](/icons/unknown.gif) | L8 Wed LP#4 304.14.docx | 2014-04-30 03:52 | 17K | |
![[ ]](/icons/unknown.gif) | SIMPLE vs PROGRESSIVE.docx | 2016-02-27 14:11 | 17K | |
![[ ]](/icons/unknown.gif) | UNIT 4 Grammar extra work UI.docx | 2015-05-26 04:18 | 17K | |
![[ ]](/icons/unknown.gif) | FUTURE FORMS 3.docx | 2019-05-11 17:12 | 17K | |
![[ ]](/icons/unknown.gif) | Question exercises.docx | 2015-04-18 22:08 | 17K | |
![[ ]](/icons/unknown.gif) | Speech Rubric Revised.docx | 2015-04-22 01:58 | 17K | |
![[ ]](/icons/unknown.gif) | gerund or infinitive exercises ().docx | 2015-12-05 20:35 | 17K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT UNIT 2L5-NEDIT.docx | 2020-05-17 01:28 | 17K | |
![[ ]](/icons/unknown.gif) | Rubric- Final Project (Grant Proposal).docx | 2013-11-18 03:06 | 17K | |
![[ ]](/icons/unknown.gif) | WRITTEN EVALUATION-Unit 11-12L4NEdocx.docx | 2020-06-21 18:21 | 17K | |
![[ ]](/icons/unknown.gif) | THE THREE LITTLE PIGS 2.docx | 2015-12-03 00:44 | 17K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT UNIT 7-Book 2.docx | 2019-04-17 15:47 | 17K | |
![[ ]](/icons/unknown.gif) | Exercise present perfect.docx | 2014-02-21 14:34 | 17K | |
![[ ]](/icons/unknown.gif) | Verb Lists (gerunds and infinitives).docx | 2014-09-07 16:41 | 17K | |
![[ ]](/icons/unknown.gif) | Regular verbs pronunciation.docx | 2014-02-18 17:54 | 17K | |
![[ ]](/icons/unknown.gif) | UNIT 11 grammar.docx | 2020-09-18 01:49 | 17K | |
![[ ]](/icons/unknown.gif) | COUNT AND UNCOUNT NOUNS 3.docx | 2019-05-22 02:46 | 17K | |
![[ ]](/icons/unknown.gif) | PRESENT TENSE OF VERB TO BE.docx | 2018-06-12 01:49 | 17K | |
![[ ]](/icons/unknown.gif) | LEVEL 1 u 12.docx | 2020-03-13 00:15 | 17K | |
![[ ]](/icons/unknown.gif) | Course Plan Wk 4.docx | 2015-05-15 20:29 | 17K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT EXERCISE 1.docx | 2024-02-06 02:56 | 17K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT EXERCISE 1 (3).docx | 2023-03-08 02:52 | 17K | |
![[ ]](/icons/unknown.gif) | Course Outline Wk6.docx | 2015-05-29 15:48 | 17K | |
![[ ]](/icons/layout.gif) | GLOBAL-Movie Review.pdf | 2015-05-04 17:38 | 17K | |
![[ ]](/icons/unknown.gif) | Unit 6 grammar explanation.docx | 2020-02-15 00:04 | 17K | |
![[ ]](/icons/unknown.gif) | Oral Assessment Criteria AMEX BW 2013.docx | 2015-04-11 00:12 | 17K | |
![[ ]](/icons/unknown.gif) | Verb form passive card.docx | 2015-01-22 05:34 | 17K | |
![[ ]](/icons/unknown.gif) | THIRD CONDITIONAL EXERCISE 2.docx | 2015-05-21 03:03 | 16K | |
![[ ]](/icons/unknown.gif) | RELATIVE CLAUSES EXERCISE 1.docx | 2024-02-10 18:04 | 16K | |
![[ ]](/icons/unknown.gif) | Unit 8 grammar book 4.docx | 2020-02-28 02:40 | 16K | |
![[ ]](/icons/unknown.gif) | Written Assignment-L5-Unit 8.docx | 2020-06-16 20:57 | 16K | |
![[ ]](/icons/unknown.gif) | Simple Present and Present Continuous 2.docx | 2016-10-15 20:42 | 16K | |
![[ ]](/icons/unknown.gif) | ADJECTIVES.docx | 2017-10-14 14:50 | 16K | |
![[ ]](/icons/unknown.gif) | ADJECTIVES (2).docx | 2016-10-05 02:55 | 16K | |
![[ ]](/icons/unknown.gif) | ADJECTIVES (1).docx | 2017-09-30 01:13 | 16K | |
![[ ]](/icons/unknown.gif) | ADJECTIVES (1) (1).docx | 2017-07-08 17:28 | 16K | |
![[ ]](/icons/unknown.gif) | Report Guidelines.docx | 2019-06-06 19:12 | 16K | |
![[ ]](/icons/unknown.gif) | Inseparable Phrasal Verbs.docx | 2016-02-03 00:12 | 16K | |
![[ ]](/icons/unknown.gif) | STATIVE VERBS EXERCISE..docx | 2020-03-23 00:59 | 16K | |
![[ ]](/icons/unknown.gif) | PREPOSITIONS new.docx | 2017-07-08 17:30 | 16K | |
![[ ]](/icons/unknown.gif) | Fundamentals II Unit 7 Assessment.docx | 2022-02-01 19:36 | 16K | |
![[ ]](/icons/unknown.gif) | PREPOSITIONS OF TIME new.docx | 2018-05-12 17:41 | 16K | |
![[ ]](/icons/unknown.gif) | WK5 Course Outline.docx | 2015-05-29 15:43 | 16K | |
![[ ]](/icons/unknown.gif) | Course Plan Wk#5.docx | 2015-05-20 17:32 | 16K | |
![[ ]](/icons/unknown.gif) | Adjective Order.docx | 2016-01-23 17:11 | 16K | |
![[ ]](/icons/unknown.gif) | Adjectives Ending with.docx | 2016-06-03 00:49 | 16K | |
![[ ]](/icons/unknown.gif) | Fill the gaps with the correct pronouns.docx | 2015-08-01 19:06 | 16K | |
![[ ]](/icons/unknown.gif) | FIRST CONDITIONAL when as soon as.docx | 2019-11-08 02:15 | 16K | |
![[ ]](/icons/unknown.gif) | gerund and infi, Pre.p,Pre.p.p exercises.docx | 2020-02-25 03:50 | 16K | |
![[ ]](/icons/unknown.gif) | Tenses in the passive voice meaning time exp and example (1).docx | 2015-04-14 01:40 | 16K | |
![[ ]](/icons/unknown.gif) | Tenses in the passive voice meaning time exp and example.docx | 2015-01-22 05:32 | 16K | |
![[ ]](/icons/unknown.gif) | study guide final quiz.docx | 2016-09-30 02:11 | 16K | |
![[ ]](/icons/unknown.gif) | simple present HW fun 1 2015.docx | 2016-05-28 17:30 | 16K | |
![[ ]](/icons/unknown.gif) | Delirium Tremens.docx | 2014-06-12 23:00 | 16K | |
![[ ]](/icons/unknown.gif) | HReading.docx | 2015-04-23 02:47 | 16K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST EXERCISE.docx | 2019-05-25 17:01 | 16K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST EXERCISE (1).docx | 2017-08-05 02:58 | 16K | |
![[ ]](/icons/unknown.gif) | GERUNDS.docx | 2018-07-23 20:38 | 16K | |
![[ ]](/icons/unknown.gif) | MODAL VERBS 1 - intermediate.docx | 2018-11-07 01:11 | 16K | |
![[ ]](/icons/unknown.gif) | ADVERBS of FREQUENCY new exercise.docx | 2019-09-28 17:27 | 16K | |
![[ ]](/icons/unknown.gif) | REALATIVE CLAUSES 2.docx | 2019-02-02 18:05 | 16K | |
![[ ]](/icons/unknown.gif) | FUNDAMENTALS VERB TO BE.docx | 2015-01-20 23:58 | 16K | |
![[ ]](/icons/unknown.gif) | READ COMP-SUP.docx | 2019-06-08 17:45 | 16K | |
![[ ]](/icons/unknown.gif) | The Simpsons video report.docx | 2014-09-02 06:20 | 16K | |
![[ ]](/icons/unknown.gif) | FUTURE with WILL.docx | 2015-03-25 04:24 | 16K | |
![[ ]](/icons/unknown.gif) | COMPARATIVE-SUPERLATIVE 2A.docx | 2018-05-12 17:48 | 16K | |
![[ ]](/icons/unknown.gif) | FIRST CONDITIONAL- intermediate.docx | 2018-11-07 01:06 | 16K | |
![[ ]](/icons/unknown.gif) | can-could ex1.docx | 2016-04-30 17:47 | 16K | |
![[ ]](/icons/unknown.gif) | a and an plus verb to be fun 1.docx | 2015-10-03 16:21 | 16K | |
![[ ]](/icons/unknown.gif) | Call This a Party (no one someone ...) saturday.docx | 2014-07-09 17:51 | 16K | |
![[ ]](/icons/unknown.gif) | Written Assignment-L5-Unit 9 docx.docx | 2020-06-21 18:51 | 16K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT UNIT 4-L7-SAT.docx | 2020-02-29 17:39 | 16K | |
![[ ]](/icons/unknown.gif) | Reading_comprehension_SIMPLE_P.docx | 2016-07-25 23:49 | 16K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST VS PAST PROGRESSIVE.docx | 2018-02-03 17:30 | 16K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST AND PAST PROGRESSIVE 2.docx | 2018-02-24 18:03 | 16K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT - PROGRESSIVE EX1.docx | 2019-07-13 17:45 | 16K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST VS PERFECT 2.docx | 2019-07-13 17:55 | 16K | |
![[ ]](/icons/unknown.gif) | Prepositions of time (2).docx | 2016-10-05 02:54 | 16K | |
![[ ]](/icons/unknown.gif) | Prepositions of time (1).docx | 2017-08-05 17:11 | 16K | |
![[ ]](/icons/unknown.gif) | WRITTEN EVALUATION-Unit 9-10L4NEdocx.docx | 2020-09-20 13:22 | 16K | |
![[ ]](/icons/unknown.gif) | Gerunds and Infinitives2.docx | 2018-10-13 17:52 | 16K | |
![[ ]](/icons/unknown.gif) | Wriiten Assignment Unit 9-10L6SAT.docx | 2019-03-05 00:31 | 16K | |
![[ ]](/icons/unknown.gif) | Extra work on Causative Passive exercises.docx | 2015-10-03 18:03 | 16K | |
![[ ]](/icons/unknown.gif) | CLASS (1).docx | 2022-10-11 03:01 | 16K | |
![[ ]](/icons/unknown.gif) | simple present Erika 2018 americana.docx | 2018-08-09 14:49 | 16K | |
![[ ]](/icons/unknown.gif) | Written Assignment units 10-11L4.docx | 2019-12-14 02:52 | 16K | |
![[ ]](/icons/layout.gif) | WorksheetWorks_Many_and_Much_1.pdf | 2016-08-20 22:44 | 16K | |
![[ ]](/icons/unknown.gif) | reading comprehension1.docx | 2015-07-11 16:23 | 16K | |
![[ ]](/icons/unknown.gif) | Separable and inseparable phrasal verbs.docx | 2019-09-11 21:17 | 16K | |
![[ ]](/icons/unknown.gif) | PHRASAL VERBS.docx | 2015-05-08 01:22 | 16K | |
![[ ]](/icons/unknown.gif) | Written Assignment -unit 10L6.SAT-NED.docx | 2020-11-21 17:16 | 16K | |
![[ ]](/icons/unknown.gif) | simple past vs. progressive new.docx | 2019-07-23 02:32 | 16K | |
![[ ]](/icons/unknown.gif) | ORAL PRESENTATION My Biography and a Famous person.docx | 2024-04-02 15:04 | 16K | |
![[ ]](/icons/unknown.gif) | Past Simple and Present Perfect 2.docx | 2019-10-12 17:54 | 16K | |
![[ ]](/icons/unknown.gif) | Past Simple and Present Perfect 2 (3).docx | 2017-06-16 02:31 | 16K | |
![[ ]](/icons/unknown.gif) | Past Simple and Present Perfect 2 (2).docx | 2017-08-26 14:39 | 16K | |
![[ ]](/icons/unknown.gif) | ORDER OF ADJECTIVES.docx | 2016-07-02 18:12 | 16K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT 2.docx | 2018-04-17 01:50 | 16K | |
![[ ]](/icons/unknown.gif) | simple present erika May 2019.docx | 2019-05-25 17:27 | 16K | |
![[ ]](/icons/unknown.gif) | PERSONALITY ADJECTIVES.docx | 2016-04-16 18:18 | 16K | |
![[ ]](/icons/unknown.gif) | spirit.docx | 2015-12-03 00:42 | 16K | |
![[ ]](/icons/unknown.gif) | Unit 7 - Time Zones Quiz.docx | 2018-05-15 02:47 | 16K | |
![[ ]](/icons/unknown.gif) | Stop.docx | 2018-02-16 03:04 | 16K | |
![[ ]](/icons/unknown.gif) | READTHEORY 1.docx | 2014-01-25 02:24 | 16K | |
![[ ]](/icons/unknown.gif) | ORAL PRESENTATION Compare Modes of Transport.docx | 2024-06-08 03:37 | 16K | |
![[ ]](/icons/unknown.gif) | ORAL PRESENTATION My Favorite Sport Rules.docx | 2024-05-25 02:31 | 16K | |
![[ ]](/icons/unknown.gif) | CLASS.docx | 2022-10-01 18:12 | 16K | |
![[ ]](/icons/unknown.gif) | Modals of Possibility and Probability.docx | 2020-02-12 22:03 | 16K | |
![[ ]](/icons/unknown.gif) | WRITTEN EVALUATION-Unit 10-1L4NEdocx.docx | 2020-09-06 17:09 | 16K | |
![[ ]](/icons/unknown.gif) | ARTICLES2.docx | 2016-06-29 23:58 | 16K | |
![[ ]](/icons/unknown.gif) | Complete the conditional sentences.docx | 2014-11-25 01:03 | 16K | |
![[ ]](/icons/unknown.gif) | was were.docx | 2017-11-09 01:11 | 16K | |
![[ ]](/icons/unknown.gif) | Write passive sentences.docx | 2014-03-07 22:46 | 16K | |
![[ ]](/icons/unknown.gif) | PHRASAL VERBS DEF&USAGE.docx | 2018-06-16 16:43 | 16K | |
![[ ]](/icons/unknown.gif) | COMPARATIVE-superlative 2.docx | 2018-10-29 23:58 | 15K | |
![[ ]](/icons/unknown.gif) | GERUND OR INFINITIVE.docx | 2018-07-25 23:27 | 15K | |
![[ ]](/icons/unknown.gif) | Wriiten Assignment Unit 2-L7 Sat.docx | 2019-05-14 22:59 | 15K | |
![[ ]](/icons/unknown.gif) | possessives (1).docx | 2019-04-10 00:58 | 15K | |
![[ ]](/icons/unknown.gif) | LEVEL1.COMPREHENSION.docx | 2013-10-17 02:48 | 15K | |
![[ ]](/icons/unknown.gif) | PAIR WORK MY FUTURE VACATIONS.docx | 2023-12-15 00:30 | 15K | |
![[ ]](/icons/unknown.gif) | Exercise on Questions 2.docx | 2017-01-28 02:25 | 15K | |
![[ ]](/icons/unknown.gif) | Expressing purpose unit 6 grammar book 4.docx | 2020-02-18 01:02 | 15K | |
![[ ]](/icons/unknown.gif) | LEVEL 5-Unit1NGNE.docx | 2020-05-07 03:01 | 15K | |
![[ ]](/icons/unknown.gif) | READING COMPREHENSION was-were.docx | 2016-05-14 17:52 | 15K | |
![[ ]](/icons/unknown.gif) | WRITTEN EVALUATION-Unit 10L4NEdocx.docx | 2020-06-09 14:48 | 15K | |
![[ ]](/icons/unknown.gif) | Exercises on adverbs of frequency.docx | 2017-02-02 02:33 | 15K | |
![[ ]](/icons/unknown.gif) | Written Assignment Unit 2-L4Dailies7-9 WB (1).docx | 2020-01-30 22:31 | 15K | |
![[ ]](/icons/unknown.gif) | SIMPLE FUTURE WILL.docx | 2016-06-04 18:11 | 15K | |
![[ ]](/icons/unknown.gif) | Verb Lists (verbs followed by infinitives).docx | 2016-07-19 23:50 | 15K | |
![[ ]](/icons/unknown.gif) | Written Evaluation-Units 7-8.docx | 2020-09-10 16:07 | 15K | |
![[ ]](/icons/unknown.gif) | PRESENT SIMPLE TENSE CORRECTION.docx | 2017-10-28 18:01 | 15K | |
![[ ]](/icons/unknown.gif) | general review.docx | 2015-12-05 18:42 | 15K | |
![[ ]](/icons/unknown.gif) | Adverbs.docx | 2015-10-29 00:45 | 15K | |
![[ ]](/icons/unknown.gif) | ORAL PRESENTATION MY FAVORITE PODCAST.docx | 2024-04-30 23:09 | 15K | |
![[ ]](/icons/unknown.gif) | CLASS (2).docx | 2023-01-24 02:56 | 15K | |
![[ ]](/icons/unknown.gif) | Life-Unit 9L3Dail.docx | 2019-08-20 22:10 | 15K | |
![[ ]](/icons/unknown.gif) | PREPOSITIONS OF TIME.docx | 2016-01-21 01:19 | 15K | |
![[ ]](/icons/unknown.gif) | PREPOSITIONS OF TIME (4).docx | 2016-04-30 17:51 | 15K | |
![[ ]](/icons/unknown.gif) | Complete the sentences with will or won.docx | 2016-06-14 00:01 | 15K | |
![[ ]](/icons/unknown.gif) | CONJUNCTIONS.docx | 2016-03-05 17:41 | 15K | |
![[ ]](/icons/unknown.gif) | Frequency Adverbas.docx | 2015-06-06 17:53 | 15K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST MIXED.docx | 2019-05-25 17:01 | 15K | |
![[ ]](/icons/unknown.gif) | simple present erika 2019.docx | 2019-03-02 16:19 | 15K | |
![[ ]](/icons/unknown.gif) | guidelines of book presentation.docx | 2015-06-17 19:15 | 15K | |
![[ ]](/icons/unknown.gif) | adjectives ed ing.docx | 2014-08-23 16:23 | 15K | |
![[ ]](/icons/unknown.gif) | Possessive Adjectives fun A 2014.docx | 2014-02-01 16:49 | 15K | |
![[ ]](/icons/unknown.gif) | GERUND-INFINITIVE LEVEL 3.docx | 2019-01-19 17:52 | 15K | |
![[ ]](/icons/unknown.gif) | ORAL PRESENTATION My Favorite Weird Sport.docx | 2023-06-01 22:11 | 15K | |
![[ ]](/icons/unknown.gif) | MAKE OR DO.docx | 2019-01-19 17:35 | 15K | |
![[ ]](/icons/unknown.gif) | WRITTEN EVALUATION-Unit 9L4NEdocx.docx | 2020-08-30 16:39 | 15K | |
![[ ]](/icons/unknown.gif) | conditionals 1,2,and 3.docx | 2020-03-13 20:53 | 15K | |
![[ ]](/icons/unknown.gif) | Gary Snyder Interview Comp Qs.docx | 2014-11-15 00:56 | 15K | |
![[ ]](/icons/unknown.gif) | simple vs. progressive2.docx | 2015-11-07 17:44 | 15K | |
![[ ]](/icons/unknown.gif) | PRESENT SIMPLE AND PROGRESSIVE.docx | 2017-12-07 20:36 | 15K | |
![[ ]](/icons/unknown.gif) | PRESENT SIMPLE AND PROGRESSIVE (2).docx | 2017-06-02 01:17 | 15K | |
![[ ]](/icons/unknown.gif) | PRESENT SIMPLE AND PROGRESSIVE (1).docx | 2017-08-19 18:06 | 15K | |
![[ ]](/icons/unknown.gif) | PAST TENSE REVIEW.docx | 2015-05-26 02:29 | 15K | |
![[ ]](/icons/unknown.gif) | comparative or superlative.docx | 2018-02-17 18:06 | 15K | |
![[ ]](/icons/unknown.gif) | Pair Work Healthy Living.docx | 2024-04-30 22:57 | 15K | |
![[ ]](/icons/unknown.gif) | WISH SENTENCES.docx | 2016-02-19 00:28 | 15K | |
![[ ]](/icons/unknown.gif) | The American English Academy Level 7.docx | 2017-12-05 01:14 | 15K | |
![[ ]](/icons/unknown.gif) | gerund and infinitives only.docx | 2020-02-26 19:54 | 15K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT UNIT 6L3-NEDIT.docx | 2019-08-27 15:17 | 15K | |
![[ ]](/icons/unknown.gif) | Modals of Possibility and Probability for Past Situations.docx | 2019-08-15 01:00 | 15K | |
![[ ]](/icons/unknown.gif) | Past Simple-progressive-perfect.docx | 2019-10-26 17:33 | 15K | |
![[ ]](/icons/unknown.gif) | Wriiten Assignment Unit 10L4NE.docx | 2019-09-14 16:18 | 15K | |
![[ ]](/icons/unknown.gif) | Passive Voice Inventions.docx | 2016-11-10 17:51 | 15K | |
![[ ]](/icons/unknown.gif) | Gerunds or infinitives.docx | 2016-10-18 23:53 | 15K | |
![[ ]](/icons/unknown.gif) | simple present Erika 2017.docx | 2017-02-25 17:41 | 15K | |
![[ ]](/icons/unknown.gif) | Practice some conditionals before your written test.docx | 2017-04-19 16:46 | 15K | |
![[ ]](/icons/unknown.gif) | PAST TENSE QUESTIONs.docx | 2014-05-13 00:41 | 15K | |
![[ ]](/icons/unknown.gif) | COUNT AND NONCOUNT NOUNs.docx | 2017-06-10 18:22 | 15K | |
![[ ]](/icons/unknown.gif) | PAIR WORK My Daily Routines.docx | 2024-02-15 17:06 | 15K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENTL4UNIT7CORP..docx | 2018-11-30 02:46 | 15K | |
![[ ]](/icons/unknown.gif) | comprehension level 1.docx | 2014-09-26 23:35 | 15K | |
![[ ]](/icons/unknown.gif) | Indirect speech and tell say.docx | 2016-08-31 02:09 | 15K | |
![[ ]](/icons/unknown.gif) | CAN OR CANT.docx | 2015-11-21 18:10 | 15K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT UNIT 11.docx | 2019-09-17 17:36 | 15K | |
![[ ]](/icons/unknown.gif) | The expository essay.docx | 2018-06-18 14:59 | 15K | |
![[ ]](/icons/unknown.gif) | ADVERBS OF FREQUENCY.docx | 2015-05-06 01:09 | 15K | |
![[ ]](/icons/unknown.gif) | all about conditionals.docx | 2015-11-10 18:21 | 15K | |
![[ ]](/icons/unknown.gif) | UNITS OF MEASUREMENT.docx | 2017-10-28 18:04 | 15K | |
![[ ]](/icons/unknown.gif) | level 7 unit 2.docx | 2014-08-16 22:09 | 15K | |
![[ ]](/icons/unknown.gif) | quixz unit 8.docx | 2016-04-02 15:43 | 15K | |
![[ ]](/icons/unknown.gif) | COUNT AND NONCOUNT NOUNS 2.docx | 2017-11-27 18:03 | 15K | |
![[ ]](/icons/unknown.gif) | MODAL VERBS.docx | 2014-07-10 22:46 | 15K | |
![[ ]](/icons/unknown.gif) | Project unit 4 level 3.docx | 2018-10-13 20:25 | 15K | |
![[ ]](/icons/unknown.gif) | READING COMPREHENSION past tense.docx | 2017-11-04 16:44 | 15K | |
![[ ]](/icons/unknown.gif) | simple present Erika 2017 C.docx | 2017-05-20 16:02 | 15K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT-Unit 9Level 4.docx | 2019-12-10 23:03 | 15K | |
![[ ]](/icons/unknown.gif) | ORAL PRESENTATION MY FAVORITE MOVIE.docx | 2024-03-19 16:10 | 15K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT.- Unit 9-L3 HMC.docx | 2020-01-25 01:53 | 15K | |
![[ ]](/icons/unknown.gif) | Individual work Describing a Famous Person.docx | 2024-03-06 02:46 | 15K | |
![[ ]](/icons/unknown.gif) | READING COMPREHENSION the body.docx | 2016-11-12 18:16 | 15K | |
![[ ]](/icons/unknown.gif) | Passive V. PP,PPP.docx | 2020-01-23 20:37 | 15K | |
![[ ]](/icons/unknown.gif) | PASSIVE VOICE EXERCISE 2.docx | 2015-04-18 15:47 | 15K | |
![[ ]](/icons/unknown.gif) | ORAL PRESENTATION DESCRIBING A FAMILY MEMBER.docx | 2024-02-09 02:27 | 15K | |
![[ ]](/icons/unknown.gif) | Questions in past.docx | 2015-02-21 16:49 | 15K | |
![[ ]](/icons/unknown.gif) | ORAL PRESENTATION ENDANGERED ANIMALS.docx | 2023-11-17 03:17 | 15K | |
![[ ]](/icons/unknown.gif) | Written Assignment Unit 2-L3Dailies WB.docx | 2019-07-25 02:55 | 15K | |
![[ ]](/icons/unknown.gif) | PAIR WORK My Favorite Recipe.docx | 2024-02-28 00:34 | 15K | |
![[ ]](/icons/unknown.gif) | Copy of Unit 9 Level 2.docx | 2022-06-30 22:08 | 15K | |
![[ ]](/icons/unknown.gif) | The Good Thief Comp Qs Week 9 Writ Eval L6.docx | 2013-11-28 00:42 | 15K | |
![[ ]](/icons/unknown.gif) | Take home quiz 1.docx | 2015-05-11 23:23 | 15K | |
![[ ]](/icons/unknown.gif) | present simple third person.docx | 2017-02-11 17:40 | 15K | |
![[ ]](/icons/unknown.gif) | Written Assignment -unit 7L3-NEDIT.docx | 2020-10-18 17:21 | 15K | |
![[ ]](/icons/unknown.gif) | TEST UNITS 11 AND 12 LEVEL 2.docx | 2020-03-10 16:13 | 15K | |
![[ ]](/icons/unknown.gif) | at_in_on (1).docx | 2016-04-25 23:44 | 15K | |
![[ ]](/icons/unknown.gif) | Written Assignment unit 7-L3D.docx | 2019-01-21 22:28 | 15K | |
![[ ]](/icons/unknown.gif) | Written Assignment-L5-Unit 3.docx | 2020-05-24 00:43 | 15K | |
![[ ]](/icons/unknown.gif) | Passive voice excersises.docx | 2016-08-02 17:25 | 15K | |
![[ ]](/icons/unknown.gif) | UNIT 1 TEST.docx | 2014-07-17 01:45 | 15K | |
![[ ]](/icons/unknown.gif) | Oral skills Practice.docx | 2024-04-04 02:47 | 15K | |
![[ ]](/icons/unknown.gif) | Passive sentences.docx | 2023-03-29 02:58 | 15K | |
![[ ]](/icons/unknown.gif) | CAN OR CANT2.docx | 2017-04-29 17:51 | 15K | |
![[ ]](/icons/unknown.gif) | present perfect(this).docx | 2015-05-05 20:18 | 15K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT UNIT 1L4docx.docx | 2020-07-22 12:36 | 15K | |
![[ ]](/icons/unknown.gif) | Written Assignment -Unit 7b-L8.SAT-NED.docx | 2020-08-08 17:49 | 15K | |
![[ ]](/icons/unknown.gif) | Written Evaluation-Unit6-L4NEDIT.docx | 2019-08-27 00:16 | 15K | |
![[ ]](/icons/unknown.gif) | Verbs with Prepositions followed by the Gerund.docx | 2015-11-20 01:44 | 15K | |
![[ ]](/icons/unknown.gif) | WRITTEN EVALUATION-Unit 8L4NEdocx (4).docx | 2020-04-26 13:45 | 15K | |
![[ ]](/icons/unknown.gif) | Much, many, little, few.docx | 2014-10-07 03:48 | 15K | |
![[ ]](/icons/unknown.gif) | English IV INFO First day IN HOUSE.docx | 2015-04-18 00:24 | 15K | |
![[ ]](/icons/unknown.gif) | British Council Oral Presentation Guidelines.docx | 2017-10-09 00:04 | 15K | |
![[ ]](/icons/unknown.gif) | WRITTEN EVALUATION-Unit 8L4NEdocx.docx | 2020-03-10 16:37 | 15K | |
![[ ]](/icons/unknown.gif) | WRITTEN EVALUATION-Unit 8L4NEdocx (4) (1).docx | 2020-05-24 22:29 | 15K | |
![[ ]](/icons/unknown.gif) | simple present erika unit 6.docx | 2018-03-03 17:29 | 15K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT REVIEW 2.docx | 2020-01-16 01:03 | 15K | |
![[ ]](/icons/unknown.gif) | PAST MODALS EXERCISE 2..docx | 2015-11-13 02:57 | 15K | |
![[ ]](/icons/unknown.gif) | Individual Work Describing an Appliance.docx | 2024-02-09 00:40 | 15K | |
![[ ]](/icons/unknown.gif) | Reported Speech 2.docx | 2016-06-09 00:37 | 15K | |
![[ ]](/icons/unknown.gif) | PAIR WORK AMAZING ANIMALS.docx | 2024-03-10 02:56 | 15K | |
![[ ]](/icons/unknown.gif) | Assignment # 4.docx | 2014-05-19 05:57 | 15K | |
![[ ]](/icons/unknown.gif) | PARTICIPLE ADJECTIVES.docx | 2017-05-30 01:18 | 15K | |
![[ ]](/icons/unknown.gif) | PARTICIPLE ADJECTIVES (1).docx | 2017-02-25 02:51 | 15K | |
![[ ]](/icons/unknown.gif) | quiz unit 9.docx | 2016-12-07 20:07 | 15K | |
![[ ]](/icons/unknown.gif) | Past Perfect or Past Simple.docx | 2016-11-02 02:12 | 15K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENTUnit 3L4 7-9.docx | 2019-11-12 22:54 | 15K | |
![[ ]](/icons/unknown.gif) | Presentation Unit 2 or 3.docx | 2014-03-08 16:35 | 15K | |
![[ ]](/icons/unknown.gif) | Perfect Ed Sheeran (lyrics).docx | 2020-07-08 20:21 | 15K | |
![[ ]](/icons/unknown.gif) | Past Simple and Present Perfect 2 (1).docx | 2017-06-10 18:06 | 15K | |
![[ ]](/icons/unknown.gif) | quantifiers exercises.docx | 2017-02-10 02:26 | 15K | |
![[ ]](/icons/unknown.gif) | List of regular verbs.docx | 2016-01-19 02:24 | 15K | |
![[ ]](/icons/unknown.gif) | ENG IV Upper Inter. Syllabus 8 weeks.docx | 2015-04-18 00:01 | 15K | |
![[ ]](/icons/unknown.gif) | Passive sentences all verb tenses.docx | 2020-02-15 15:11 | 15K | |
![[ ]](/icons/unknown.gif) | WAS-WERE.docx | 2017-08-05 02:57 | 15K | |
![[ ]](/icons/unknown.gif) | MUCH MANY .......docx | 2017-03-14 00:39 | 15K | |
![[ ]](/icons/unknown.gif) | not a hair out of place.docx | 2014-04-26 00:49 | 15K | |
![[ ]](/icons/unknown.gif) | Grammar quiz 1.docx | 2015-02-14 03:22 | 15K | |
![[ ]](/icons/unknown.gif) | present simple vrs continuous in context.docx | 2018-06-02 00:34 | 15K | |
![[ ]](/icons/unknown.gif) | MODALS OB-PERM-RECOM.docx | 2019-08-03 17:40 | 15K | |
![[ ]](/icons/unknown.gif) | passive in context.docx | 2016-08-19 00:58 | 15K | |
![[ ]](/icons/unknown.gif) | Relative Pronouns Exercise 3.docx | 2017-09-06 00:11 | 15K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT-PERFECT PROGRESSIVE.docx | 2019-02-20 00:37 | 15K | |
![[ ]](/icons/unknown.gif) | EACH-every-all.docx | 2018-11-28 00:50 | 15K | |
![[ ]](/icons/unknown.gif) | exercise gerund and infinitive.docx | 2016-01-22 00:35 | 15K | |
![[ ]](/icons/unknown.gif) | simple present positive negative.docx | 2016-05-28 17:30 | 15K | |
![[ ]](/icons/unknown.gif) | PRACTICE EXERCISES (future).docx | 2014-05-15 00:14 | 15K | |
![[ ]](/icons/unknown.gif) | UNIT 11 explanation.docx | 2019-12-11 01:25 | 15K | |
![[ ]](/icons/unknown.gif) | Written Assignment 2 Unit 10 level 4 Coorp.docx | 2019-01-26 23:32 | 15K | |
![[ ]](/icons/unknown.gif) | THIRD CONDITIONAL SENTENCES (1).docx | 2014-02-22 17:56 | 15K | |
![[ ]](/icons/unknown.gif) | Wish Exercise 1.docx | 2016-05-12 01:46 | 15K | |
![[ ]](/icons/unknown.gif) | Reported Speech, level.docx | 2020-03-13 21:18 | 15K | |
![[ ]](/icons/unknown.gif) | REPORTED SPEECH MC.docx | 2019-06-22 17:03 | 15K | |
![[ ]](/icons/unknown.gif) | prepositions 2.docx | 2020-01-18 17:32 | 15K | |
![[ ]](/icons/unknown.gif) | Modals in the Present and Past.docx | 2017-05-30 00:41 | 15K | |
![[ ]](/icons/unknown.gif) | comparison with as...as.docx | 2016-08-02 01:58 | 14K | |
![[ ]](/icons/unknown.gif) | COMMON SUFFIXES IN ENGLISH - Level 9.docx | 2017-04-17 22:55 | 14K | |
![[ ]](/icons/unknown.gif) | Written Assignment -unit 7L8.SAT-NED.docx | 2020-05-06 12:22 | 14K | |
![[ ]](/icons/unknown.gif) | Kinks Lola.docx | 2015-02-07 16:24 | 14K | |
![[ ]](/icons/unknown.gif) | List of Stative Verbs.docx | 2019-11-23 00:10 | 14K | |
![[ ]](/icons/unknown.gif) | MY FREE TIME.docx | 2020-02-11 01:36 | 14K | |
![[ ]](/icons/unknown.gif) | Adjectives ending -ed -ing exercises.docx | 2013-12-03 16:01 | 14K | |
![[ ]](/icons/unknown.gif) | WILL vs GOING TO exercises.docx | 2015-04-30 00:31 | 14K | |
![[ ]](/icons/unknown.gif) | WRITTEN EVALUATION-Unit 10-HMC.docx | 2019-09-17 17:44 | 14K | |
![[ ]](/icons/unknown.gif) | PASSIVE_VOICE_ex_2.docx | 2015-01-17 15:57 | 14K | |
![[ ]](/icons/unknown.gif) | past perfect simple.docx | 2014-06-11 02:49 | 14K | |
![[ ]](/icons/unknown.gif) | Replace the personal pronouns by possessive adjectives.docx | 2015-07-06 15:28 | 14K | |
![[ ]](/icons/unknown.gif) | Rubric - Project for Unit 1 [new version].docx | 2013-10-12 15:59 | 14K | |
![[ ]](/icons/unknown.gif) | PERSUASIVE SPEECH GUIDELINE.docx | 2018-05-07 02:14 | 14K | |
![[ ]](/icons/unknown.gif) | Do_and_Does_1wendy.docx | 2015-08-07 03:45 | 14K | |
![[ ]](/icons/unknown.gif) | DRAWING_CONCLUSIONS_MUST_MIGHT (1).docx | 2024-03-08 03:00 | 14K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT VRS SIMPLE PAST1..docx | 2018-09-26 02:40 | 14K | |
![[ ]](/icons/unknown.gif) | Reading fill in the blank.docx | 2016-11-12 18:19 | 14K | |
![[ ]](/icons/layout.gif) | t27.pdf | 2017-07-07 01:49 | 14K | |
![[ ]](/icons/unknown.gif) | Written Assignment Unit 2-L9 WB.docx | 2018-11-17 01:06 | 14K | |
![[ ]](/icons/unknown.gif) | possessive adjectives.docx | 2015-09-25 01:22 | 14K | |
![[ ]](/icons/unknown.gif) | HW fun A unit 5 2014.docx | 2014-02-18 01:00 | 14K | |
![[ ]](/icons/unknown.gif) | USED TO (EXERCISES ).docx | 2019-11-18 22:24 | 14K | |
![[ ]](/icons/unknown.gif) | Present Simple Fun A unit 5 2014.docx | 2014-05-13 00:50 | 14K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST general ex.docx | 2015-05-16 16:43 | 14K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT EXERCISE 1 (2).docx | 2022-10-21 02:57 | 14K | |
![[ ]](/icons/unknown.gif) | passive reporting verbs exercises.docx | 2019-03-02 02:08 | 14K | |
![[ ]](/icons/unknown.gif) | relatives clauses.docx | 2015-06-09 23:03 | 14K | |
![[ ]](/icons/unknown.gif) | 2 Improving Oral Skills and Readiness.docx | 2024-02-23 02:33 | 14K | |
![[ ]](/icons/unknown.gif) | frequency adverbs.docx | 2015-10-23 23:25 | 14K | |
![[ ]](/icons/unknown.gif) | Written assignment-Unit 4-L3.docx | 2018-10-31 22:29 | 14K | |
![[ ]](/icons/unknown.gif) | S. PAST VS PAST PROGRESSIVE 2.docx | 2018-08-18 17:09 | 14K | |
![[ ]](/icons/unknown.gif) | COUNT AND NONCOUNT.docx | 2016-02-06 16:41 | 14K | |
![[ ]](/icons/unknown.gif) | preaent simple or presente continuous.docx | 2015-04-12 13:14 | 14K | |
![[ ]](/icons/unknown.gif) | Written assignment-Unit 4-5L3.docx | 2019-02-19 02:58 | 14K | |
![[ ]](/icons/unknown.gif) | quiz unit 5 american school level 4.docx | 2015-10-20 00:40 | 14K | |
![[ ]](/icons/unknown.gif) | The Hidden Costs of Hamburgers.docx | 2015-01-14 00:26 | 14K | |
![[ ]](/icons/unknown.gif) | Written assignment-Unit 5-L3.docx | 2018-10-27 19:03 | 14K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT L4-Unit 6.docx | 2019-11-22 23:04 | 14K | |
![[ ]](/icons/unknown.gif) | PREPOSITIONS_AFTER_VERBS_EXERCISE.docx | 2014-08-30 17:28 | 14K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT EXERCISE 1 (7).docx | 2024-01-20 18:15 | 14K | |
![[ ]](/icons/unknown.gif) | Oral Presentation Guideline about INVENTIONS.docx | 2019-07-19 01:23 | 14K | |
![[ ]](/icons/unknown.gif) | EXERCISE_1_past_progressive.docx | 2017-07-18 23:50 | 14K | |
![[ ]](/icons/unknown.gif) | WRITTEN EVALUATION Unit 2-L4Dai.docx | 2020-02-08 17:50 | 14K | |
![[ ]](/icons/unknown.gif) | PAST VS. PERFECT.docx | 2017-06-10 18:07 | 14K | |
![[ ]](/icons/unknown.gif) | READING COMPREHENSION was were.docx | 2015-04-30 02:06 | 14K | |
![[ ]](/icons/unknown.gif) | Written Assignment -Unit 8-L6-INCOM.docx | 2019-09-18 22:26 | 14K | |
![[ ]](/icons/unknown.gif) | past perfect exercises.docx | 2014-12-02 02:56 | 14K | |
![[ ]](/icons/unknown.gif) | RELATIVE_CLAUSES_EXERCISE_1.docx | 2017-12-14 00:46 | 14K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT TENSE.docx | 2015-02-07 17:42 | 14K | |
![[ ]](/icons/unknown.gif) | RELATIVE CLAUSES EXERCISE 1 (1).docx | 2017-06-03 14:51 | 14K | |
![[ ]](/icons/unknown.gif) | reported speech exercises.docx | 2014-08-28 23:47 | 14K | |
![[ ]](/icons/unknown.gif) | RELATIVE CLAUSES EXERCISE 2.docx | 2017-09-06 22:52 | 14K | |
![[ ]](/icons/unknown.gif) | Now rewrite these sentences so they mean the same thing.docx | 2013-11-13 00:27 | 14K | |
![[ ]](/icons/unknown.gif) | present negatives and questions fun.docx | 2016-05-21 15:57 | 14K | |
![[ ]](/icons/unknown.gif) | MYSTERY STORY.docx | 2015-07-25 16:02 | 14K | |
![[ ]](/icons/unknown.gif) | Both exercises.docx | 2014-12-11 00:02 | 14K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT UNIT 7a -L8 SAT.docx | 2020-07-27 18:55 | 14K | |
![[ ]](/icons/unknown.gif) | PREPOSITIONS AFTER VERBS EXERCISE.docx | 2016-06-04 16:10 | 14K | |
![[ ]](/icons/unknown.gif) | If I were a boy Beyonce.docx | 2015-04-11 00:18 | 14K | |
![[ ]](/icons/unknown.gif) | was were ex1.docx | 2013-10-26 14:13 | 14K | |
![[ ]](/icons/unknown.gif) | Unit 5 Assessment Step by Step Level 2.docx | 2023-07-04 01:49 | 14K | |
![[ ]](/icons/unknown.gif) | MUST CAN HAVE TO.docx | 2019-11-08 02:15 | 14K | |
![[ ]](/icons/unknown.gif) | WRITTEN EVALUATION Unit 2-L7Sat.docx | 2019-05-15 23:11 | 14K | |
![[ ]](/icons/unknown.gif) | Written Assignment -Unit 8-L6-SAT.docx | 2019-08-06 22:52 | 14K | |
![[ ]](/icons/unknown.gif) | ORAL PRESENTATION DESCRIBING AN APARTMENT.docx | 2023-10-31 02:17 | 14K | |
![[ ]](/icons/unknown.gif) | Make object or subject questions.docx | 2016-08-26 00:06 | 14K | |
![[ ]](/icons/unknown.gif) | ARTICLES.docx | 2019-11-23 14:18 | 14K | |
![[ ]](/icons/unknown.gif) | Used to exercises.docx | 2018-11-28 00:35 | 14K | |
![[ ]](/icons/unknown.gif) | One or ones.docx | 2015-11-21 16:44 | 14K | |
![[ ]](/icons/unknown.gif) | Verbs Followed by an Infinitive.docx | 2014-07-12 01:18 | 14K | |
![[ ]](/icons/unknown.gif) | WRITTEN EVALUATION UNITS 10-11book2.docx | 2019-05-13 18:50 | 14K | |
![[ ]](/icons/unknown.gif) | Written assignment-Uni9- L4 corp..docx | 2019-01-17 22:53 | 14K | |
![[ ]](/icons/unknown.gif) | present perfect or past simple.docx | 2016-11-22 23:40 | 14K | |
![[ ]](/icons/unknown.gif) | adverbs comparative.docx | 2019-11-20 00:27 | 14K | |
![[ ]](/icons/unknown.gif) | Oral Presentation Daily Routines.docx | 2023-12-05 14:45 | 14K | |
![[ ]](/icons/unknown.gif) | active or passive.docx | 2014-06-03 00:58 | 14K | |
![[ ]](/icons/unknown.gif) | Individual Work My Ultimate Packing List.docx | 2023-11-22 03:04 | 14K | |
![[ ]](/icons/unknown.gif) | ORAL PRESENTATION FAMOUS.docx | 2023-11-09 03:16 | 14K | |
![[ ]](/icons/unknown.gif) | FUTURE FORMS simple.docx | 2019-07-27 17:58 | 14K | |
![[ ]](/icons/unknown.gif) | My Favorite Vacation Blog.docx | 2023-10-18 00:22 | 14K | |
![[ ]](/icons/unknown.gif) | PAIR WORK My favorite Robot.docx | 2023-11-01 22:44 | 14K | |
![[ ]](/icons/unknown.gif) | Present perfect simple or present perfect continuous.docx | 2016-12-09 01:03 | 14K | |
![[ ]](/icons/unknown.gif) | To Do.docx | 2017-05-09 01:01 | 14K | |
![[ ]](/icons/unknown.gif) | MODAL VERBS -LEVEL 3.docx | 2019-05-22 02:44 | 14K | |
![[ ]](/icons/unknown.gif) | PAIR WORK My Favorite Place to live.docx | 2024-02-02 02:44 | 14K | |
![[ ]](/icons/unknown.gif) | USED TO-would.docx | 2019-08-17 17:32 | 14K | |
![[ ]](/icons/unknown.gif) | PROJECT UNIT 2 Level 3.docx | 2018-09-08 01:25 | 14K | |
![[ ]](/icons/unknown.gif) | The True Story of the Three Little Pigs by JON SCIESZKA CHARACTERS.docx | 2018-11-29 02:24 | 14K | |
![[ ]](/icons/unknown.gif) | Written Assignment Unit 1 Level 3.-Book 4.docx | 2019-04-24 22:37 | 14K | |
![[ ]](/icons/unknown.gif) | information questions -- classwork presentation unit 2 Level 1.docx | 2013-11-01 02:03 | 14K | |
![[ ]](/icons/unknown.gif) | Reported Speech.docx | 2018-03-17 17:47 | 14K | |
![[ ]](/icons/unknown.gif) | Zombie by Cranberries.docx | 2014-04-30 03:37 | 14K | |
![[ ]](/icons/unknown.gif) | PASSIVE VOICE 2.docx | 2019-11-23 14:17 | 14K | |
![[ ]](/icons/unknown.gif) | FUTURE FORMS 4.docx | 2019-11-01 00:58 | 14K | |
![[ ]](/icons/unknown.gif) | INDIVIDUAL WORK FAMOUS PERSON'S BIOGRAPHY.docx | 2023-11-29 02:51 | 14K | |
![[ ]](/icons/unknown.gif) | Assignments - Dailies 5-7 - 7-9.docx | 2017-12-04 18:39 | 14K | |
![[ ]](/icons/unknown.gif) | What Is the Perfect Aspect.docx | 2017-04-17 23:01 | 14K | |
![[ ]](/icons/unknown.gif) | Pair Work.docx | 2023-11-17 02:43 | 14K | |
![[ ]](/icons/unknown.gif) | Regular Past Tense Verb Pronunciation Practice.docx | 2015-02-08 21:15 | 14K | |
![[ ]](/icons/unknown.gif) | INDIVIDUAL WORK FAMOUS PERSON BIOGRAPHY.docx | 2023-12-01 02:55 | 14K | |
![[ ]](/icons/unknown.gif) | borrow or lend.docx | 2013-11-22 03:00 | 14K | |
![[ ]](/icons/unknown.gif) | Written Assignment Unit 1 Level 3.-Dailiies docx.docx | 2019-01-23 02:52 | 14K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT UNIT 10.Bco.MB6.docx | 2019-03-20 01:14 | 14K | |
![[ ]](/icons/unknown.gif) | U2 Sunday, Bloody, Sunday.docx | 2014-04-30 03:35 | 14K | |
![[ ]](/icons/unknown.gif) | possessive_pronouns (1).docx | 2013-10-15 02:01 | 14K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENTUNIT 12 L-3 Coorp(B4).docx | 2019-02-13 23:55 | 14K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST VS PROGRESSIVE 3.docx | 2019-08-17 17:35 | 14K | |
![[ ]](/icons/unknown.gif) | CAN COULD.docx | 2015-11-03 02:58 | 14K | |
![[ ]](/icons/unknown.gif) | COMPARATIVE AND SUPERLATIVE new.docx | 2019-11-15 02:05 | 14K | |
![[ ]](/icons/unknown.gif) | Relative Clauses (uuu).docx | 2016-08-12 00:11 | 14K | |
![[ ]](/icons/unknown.gif) | PAIR WORK MY LAST VACATIONS.docx | 2023-12-07 00:51 | 14K | |
![[ ]](/icons/unknown.gif) | Gerunds and Infinitives 1.docx | 2022-06-25 02:58 | 14K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT UNIT 4.L2-Book 2.docx | 2019-03-18 23:33 | 14K | |
![[ ]](/icons/unknown.gif) | Lend and Borrow.docx | 2017-11-10 00:58 | 14K | |
![[ ]](/icons/unknown.gif) | Extra work on present perfect, level 4.docx | 2015-07-11 01:37 | 14K | |
![[ ]](/icons/unknown.gif) | WRITE sentences in PAST SIMPLE.docx | 2019-01-21 23:22 | 14K | |
![[ ]](/icons/unknown.gif) | INDIVIDUAL WORK READING ALOUD A SHORT STORY.docx | 2023-12-09 00:52 | 14K | |
![[ ]](/icons/unknown.gif) | Use of Can.docx | 2015-03-11 23:51 | 14K | |
![[ ]](/icons/unknown.gif) | Improving Oral Skills and Readiness.docx | 2024-02-29 23:26 | 14K | |
![[ ]](/icons/unknown.gif) | homework 2 fun A simple present.docx | 2015-08-07 03:47 | 14K | |
![[ ]](/icons/unknown.gif) | causative exerc...docx | 2019-03-19 19:51 | 14K | |
![[ ]](/icons/unknown.gif) | Hadrian's wall.docx | 2019-10-18 02:36 | 14K | |
![[ ]](/icons/unknown.gif) | ORAL PRESENTATION DESCRIBING A PRODUCT.docx | 2023-11-02 02:31 | 14K | |
![[ ]](/icons/unknown.gif) | Links of unit 2.docx | 2013-10-14 17:54 | 14K | |
![[ ]](/icons/unknown.gif) | CLASS EXERCISE- THIRD PERSON SINGULAR.docx | 2014-02-28 00:05 | 14K | |
![[ ]](/icons/unknown.gif) | Evidence Darwin Had for Evolution.docx | 2017-05-10 02:40 | 14K | |
![[ ]](/icons/unknown.gif) | VERB TO BE-LEVEL 1.docx | 2017-07-05 02:39 | 14K | |
![[ ]](/icons/unknown.gif) | VERB TO BE-LEVEL 1 (1).docx | 2019-04-10 00:58 | 14K | |
![[ ]](/icons/unknown.gif) | Agreeing,disagreeing exercises.docx | 2018-08-21 18:59 | 14K | |
![[ ]](/icons/unknown.gif) | PAIR WORK MY FAVORITE APARTMENT.docx | 2023-11-23 01:02 | 14K | |
![[ ]](/icons/unknown.gif) | Stative Verbs 1.docx | 2019-07-11 00:02 | 14K | |
![[ ]](/icons/unknown.gif) | Rubric- Project for Unit 5 [level 5].docx | 2014-02-28 04:39 | 14K | |
![[ ]](/icons/unknown.gif) | SIMPLE PAST-PRES.PERFECT L3.docx | 2018-10-29 23:52 | 13K | |
![[ ]](/icons/unknown.gif) | FUTURE FORMS FROM GLOBAL.docx | 2017-05-23 00:00 | 13K | |
![[ ]](/icons/unknown.gif) | Global- Read this story to practice -ed sounds.docx | 2015-12-01 22:09 | 13K | |
![[ ]](/icons/unknown.gif) | Written Assignment Unit 1 Level 7.-Sat docx.docx | 2019-01-21 22:56 | 13K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT-corrections.docx | 2016-07-09 17:59 | 13K | |
![[ ]](/icons/unknown.gif) | CAN-HAVE TO-MUST.docx | 2019-07-23 02:54 | 13K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT MIXED.docx | 2015-07-11 16:24 | 13K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT UNIT 6-Book 2.docx | 2019-04-06 18:55 | 13K | |
![[ ]](/icons/unknown.gif) | PRESENT SIMPLE do - fundamentals.docx | 2020-01-18 17:52 | 13K | |
![[ ]](/icons/unknown.gif) | CAN-CANT.docx | 2016-07-16 02:46 | 13K | |
![[ ]](/icons/unknown.gif) | INDEFINITE PRONOUNS 2.docx | 2019-06-12 02:04 | 13K | |
![[ ]](/icons/unknown.gif) | Rubric- Project for Unit 4 [level 7].docx | 2013-11-25 05:21 | 13K | |
![[ ]](/icons/unknown.gif) | simple vs. progressive INT.docx | 2020-01-16 01:03 | 13K | |
![[ ]](/icons/unknown.gif) | Rubric- Project for Unit 4 [level 5].docx | 2013-11-20 04:34 | 13K | |
![[ ]](/icons/unknown.gif) | DRAWING CONCLUSIONS MUST MIGHT.docx | 2019-05-07 00:59 | 13K | |
![[ ]](/icons/unknown.gif) | Verbs Followed by an Infinitive or a gerund.docx | 2019-11-21 00:35 | 13K | |
![[ ]](/icons/unknown.gif) | get used to be used to.docx | 2015-10-30 23:05 | 13K | |
![[ ]](/icons/unknown.gif) | REPORTED SPEECH COMMANDS.docx | 2022-06-25 18:19 | 13K | |
![[ ]](/icons/unknown.gif) | Juveniles Level 7 Oral Presentation.docx | 2018-07-09 01:52 | 13K | |
![[ ]](/icons/unknown.gif) | Lista de Palabras de Ortografía.docx | 2013-11-01 12:45 | 13K | |
![[ ]](/icons/unknown.gif) | Exercises with the Past Simple Tense.docx | 2023-06-09 21:05 | 13K | |
![[ ]](/icons/unknown.gif) | SLAVERY LEVEL 6 ACT..docx | 2020-02-27 23:49 | 13K | |
![[ ]](/icons/unknown.gif) | BORROW AND LEND.docx | 2015-05-21 02:14 | 13K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT-Unit 1-L1 (B2).docx | 2019-02-23 00:15 | 13K | |
![[ ]](/icons/unknown.gif) | POSSESSIVE PRONOUNS Fill in.docx | 2017-01-20 01:24 | 13K | |
![[ ]](/icons/unknown.gif) | PREPOSITIONS_part_1__2 (1).docx | 2014-01-25 02:28 | 13K | |
![[ ]](/icons/unknown.gif) | 3rd Conditional.docx | 2020-03-04 01:28 | 13K | |
![[ ]](/icons/unknown.gif) | Choose the correct conditional sentence.docx | 2014-03-07 22:59 | 13K | |
![[ ]](/icons/unknown.gif) | Rubric- Project for Unit 3 [level 5].docx | 2014-02-06 08:47 | 13K | |
![[ ]](/icons/unknown.gif) | Use will going to or present continuous....docx | 2013-11-27 15:51 | 13K | |
![[ ]](/icons/unknown.gif) | Links of unit 6 Level 2.docx | 2015-05-23 02:46 | 13K | |
![[ ]](/icons/unknown.gif) | -ING Spelling.docx | 2014-05-31 16:38 | 13K | |
![[ ]](/icons/unknown.gif) | Rubric- Project for Unit 8 [level 8].docx | 2014-02-24 06:50 | 13K | |
![[ ]](/icons/unknown.gif) | Exercises.docx | 2017-04-25 02:05 | 13K | |
![[ ]](/icons/unknown.gif) | FOOD Oral Presentation Guideline.docx | 2019-07-12 17:00 | 13K | |
![[ ]](/icons/unknown.gif) | PRESENT PROGRESSIVE VS SIMPLE.docx | 2015-03-07 00:43 | 13K | |
![[ ]](/icons/unknown.gif) | PRESENT PROGRESSIVE VS SIMPLE (1).docx | 2015-03-12 01:28 | 13K | |
![[ ]](/icons/unknown.gif) | G Reading.docx | 2015-02-09 02:19 | 13K | |
![[ ]](/icons/unknown.gif) | Indirect Questions.docx | 2019-07-16 02:03 | 13K | |
![[ ]](/icons/unknown.gif) | MAKING PREDICTIONS WITH MODAL VERBS.docx | 2019-08-17 02:20 | 13K | |
![[ ]](/icons/unknown.gif) | Rubric- Project for Unit 3 [level 7].docx | 2013-11-18 03:01 | 13K | |
![[ ]](/icons/unknown.gif) | ASSIGNMENT Saturday May 26th.docx | 2018-05-22 01:34 | 13K | |
![[ ]](/icons/unknown.gif) | http.docx | 2013-10-18 01:16 | 13K | |
![[ ]](/icons/unknown.gif) | Written Assignment -Section 7-9-Dailes.docx | 2018-07-23 22:13 | 13K | |
![[ ]](/icons/unknown.gif) | MODAL VERBS EXERCISE.docx | 2017-11-02 00:48 | 13K | |
![[ ]](/icons/unknown.gif) | Rubric- Project for Unit 10 [Global level 8].docx | 2014-03-26 08:12 | 13K | |
![[ ]](/icons/unknown.gif) | Written Assignment -Section 5-7-Dailes.docx | 2018-07-23 22:10 | 13K | |
![[ ]](/icons/unknown.gif) | LINKS UNIT 1.docx | 2013-10-14 18:16 | 13K | |
![[ ]](/icons/unknown.gif) | WRITTEN ASSIGNMENT-UNIT 9L6-SAT.docx | 2020-11-10 19:39 | 13K | |
![[ ]](/icons/unknown.gif) | LINKS WISH EXERCISES.docx | 2013-11-08 01:14 | 13K | |
![[ ]](/icons/unknown.gif) | Rubric- Project for Unit 2 [level 7].docx | 2013-10-27 05:26 | 13K | |
![[ ]](/icons/unknown.gif) | Homonym Web study sites.docx | 2014-11-15 00:59 | 13K | |
![[ ]](/icons/unknown.gif) | Assessment Unit 7 Name (1).docx | 2023-07-18 01:58 | 13K | |
![[ ]](/icons/unknown.gif) | GOING TO.docx | 2019-06-20 02:00 | 13K | |
![[ ]](/icons/unknown.gif) | SIMPLE PRESENT.docx | 2016-10-29 15:27 | 13K | |
![[ ]](/icons/unknown.gif) | Past Simple Form Other Verbs.docx | 2015-03-11 23:56 | 13K | |
![[ ]](/icons/unknown.gif) | Past Simple Form Other Verbs (1).docx | 2015-03-12 01:26 | 13K | |
![[ ]](/icons/unknown.gif) | LEVEL 8 MONDAYS PROGRAM.docx | 2017-10-03 02:54 | 13K | |
![[ ]](/icons/unknown.gif) | Rubric- Project for Unit 2 [level 5] (new version).docx | 2014-01-31 09:52 | 13K | |
![[ ]](/icons/unknown.gif) | Oral Presentation Guidelines.docx | 2019-06-21 17:24 | 13K | |
![[ ]](/icons/unknown.gif) | Rubric- Project for Unit 2 [level 5].docx | 2013-10-30 03:33 | 13K | |
![[ ]](/icons/unknown.gif) | Subject-object questions.docx | 2015-01-21 01:35 | 13K | |
![[ ]](/icons/unknown.gif) | be or have fun 1 2015.docx | 2016-05-21 15:56 | 13K | |
![[ ]](/icons/unknown.gif) | PASSIVE VOICE ex 2.docx | 2023-12-02 18:08 | 13K | |
![[ ]](/icons/unknown.gif) | Glossary Unit 10 and 11.docx | 2023-06-10 14:29 | 13K | |
![[ ]](/icons/unknown.gif) | Unit 3 Assessment Step by Step.docx | 2023-02-14 01:03 | 13K | |
![[ ]](/icons/unknown.gif) | PRESENTATION STORYBOARD DECEMBER 1ST.docx | 2018-11-17 17:27 | 13K | |
![[ ]](/icons/unknown.gif) | THIRD CONDITIONAL SENTENCES.docx | 2018-08-01 02:34 | 13K | |
![[ ]](/icons/unknown.gif) | LINK STATIVE AN DYNAMIC VERBS.docx | 2022-10-14 03:03 | 13K | |
![[ ]](/icons/unknown.gif) | HW- Reporting verbs and statements.docx | 2015-04-15 02:12 | 13K | |
![[ ]](/icons/unknown.gif) | Individual Work.docx | 2021-07-07 02:42 | 13K | |
![[ ]](/icons/unknown.gif) | PASSIVE VOICE EXERCISES.docx | 2018-04-19 14:45 | 13K | |
![[ ]](/icons/unknown.gif) | going to vrs present continuos in context.docx | 2018-09-01 01:02 | 13K | |
![[ ]](/icons/unknown.gif) | WRITTEN EVALUATION UNIT 4-L4.docx | 2020-08-18 21:52 | 12K | |
![[ ]](/icons/unknown.gif) | REPORTED SPEECH 1.docx | 2023-12-09 18:07 | 12K | |
![[ ]](/icons/unknown.gif) | ELEPHANTS.docx | 2017-04-18 02:13 | 12K | |
![[ ]](/icons/unknown.gif) | Gerunds and infinitives.docx | 2017-10-10 00:54 | 12K | |
![[ ]](/icons/unknown.gif) | homework plan sat 26.docx | 2019-01-26 00:37 | 12K | |
![[ ]](/icons/unknown.gif) | SPECULATING IN PRESENT.docx | 2022-11-23 02:59 | 12K | |
![[ ]](/icons/unknown.gif) | GOING TO 2.docx | 2019-06-20 02:00 | 12K | |
![[IMG]](/icons/image2.gif) | countries.jpg | 2013-11-02 20:36 | 12K | |
![[ ]](/icons/unknown.gif) | COMPARATIVE OR SUPERLATIVE2.docx | 2019-08-03 16:48 | 12K | |
![[IMG]](/icons/image2.gif) | class objects.jpg | 2014-07-26 16:13 | 12K | |
![[ ]](/icons/unknown.gif) | Daily Routines ex 2.docx | 2024-01-23 02:56 | 12K | |
![[ ]](/icons/unknown.gif) | INFINITIVE EXERCISES.docx | 2023-08-12 03:04 | 12K | |
![[ ]](/icons/unknown.gif) | Rubric- Project for Unit 9 [Global level 8].docx | 2014-03-11 08:10 | 12K | |
![[ ]](/icons/unknown.gif) | VOCABULARY.docx | 2018-10-25 00:21 | 12K | |
![[ ]](/icons/unknown.gif) | toms diner.docx | 2018-09-26 23:08 | 12K | |
![[ ]](/icons/unknown.gif) | Rubric- Project for Unit 7 [Global level 8].docx | 2014-02-08 06:40 | 12K | |
![[ ]](/icons/unknown.gif) | GERUNDS OR INFINITIVE.docx | 2019-06-08 17:41 | 12K | |
![[ ]](/icons/unknown.gif) | Rubric- Project for Unit 6 [Global level 8].docx | 2014-01-27 02:09 | 12K | |
![[ ]](/icons/unknown.gif) | Rubric- Project for Unit 1 [level 5].docx | 2014-01-17 03:38 | 12K | |
![[ ]](/icons/unknown.gif) | Saturday.docx | 2019-05-11 21:34 | 12K | |
![[ ]](/icons/unknown.gif) | PAST SIMPLE vs PRESENT PERFECT.docx | 2018-05-22 01:49 | 12K | |
![[ ]](/icons/unknown.gif) | Object Pronouns.docx | 2023-08-26 15:06 | 12K | |
![[ ]](/icons/unknown.gif) | CAUSATIVE QUESTIONS STRUCTURES.docx | 2022-07-21 01:46 | 12K | |
![[ ]](/icons/unknown.gif) | Topics and Instructions.docx | 2017-02-25 02:58 | 12K | |
![[ ]](/icons/unknown.gif) | SECOND CONDITIONAL 2.docx | 2019-06-12 02:03 | 12K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT OR PRESENT PERFECT CONTINUOUS.docx | 2019-06-08 17:42 | 12K | |
![[ ]](/icons/unknown.gif) | Present Perfect Simple or Present Perfect Continuous (sat).docx | 2019-06-08 16:32 | 12K | |
![[ ]](/icons/unknown.gif) | Complete the exercise in the link.docx | 2023-10-24 03:17 | 12K | |
![[ ]](/icons/unknown.gif) | REPORTING VERBS.docx | 2018-03-08 03:01 | 12K | |
![[ ]](/icons/unknown.gif) | Oral Presentation.docx | 2023-05-26 03:22 | 12K | |
![[ ]](/icons/unknown.gif) | Simple Present Juvenil.docx | 2023-02-18 17:38 | 12K | |
![[ ]](/icons/unknown.gif) | Renaissance Man Questions.docx | 2013-11-15 23:29 | 12K | |
![[ ]](/icons/unknown.gif) | PRESENT PERFECT EXERCISES.docx | 2017-03-10 00:35 | 12K | |
![[IMG]](/icons/image2.gif) | worksheet1.jpg | 2014-04-27 01:13 | 12K | |
![[ ]](/icons/unknown.gif) | COMPLETE THE EXERCISE GERUNDS AND INFINITIVES.docx | 2022-08-31 03:01 | 11K | |
![[ ]](/icons/unknown.gif) | How its made.docx | 2020-03-27 01:42 | 11K | |
![[ ]](/icons/unknown.gif) | Irreversible Idioms Link.docx | 2016-07-12 02:48 | 11K | |
![[ ]](/icons/compressed.gif) | UNIT 11.zip | 2017-11-29 01:53 | 11K | |
![[IMG]](/icons/image2.gif) | colors.jpg | 2014-01-25 21:01 | 9.9K | |
![[TXT]](/icons/text.gif) | sheet001.htm | 2014-06-18 00:57 | 9.5K | |
![[IMG]](/icons/image2.gif) | FINE THANKS!.png | 2021-12-02 00:39 | 9.5K | |
![[ ]](/icons/unknown.gif) | UNIT 2 TEST.docx | 2014-05-21 23:04 | 9.2K | |
![[ ]](/icons/unknown.gif) | Unit 4 Test Level 5.docx | 2019-05-15 23:38 | 9.1K | |
![[IMG]](/icons/image2.gif) | PERSONAL PRONOUNS AST.jpg | 2022-01-26 02:56 | 8.8K | |
![[IMG]](/icons/image2.gif) | album.jpg | 2018-07-12 23:51 | 8.7K | |
![[IMG]](/icons/image2.gif) | spelling.jpg | 2013-11-19 22:24 | 8.2K | |
![[ ]](/icons/layout.gif) | review 3.pdf | 2014-03-25 02:39 | 8.0K | |
![[ ]](/icons/layout.gif) | don-t-doesn-t-in-negative-sentences-1.pdf | 2015-02-21 16:23 | 8.0K | |
![[IMG]](/icons/image2.gif) | table-of-ordinal-numbers.png | 2017-05-13 00:31 | 7.4K | |
![[ ]](/icons/layout.gif) | Adjective-order-exercise.pdf | 2018-10-12 23:14 | 6.5K | |
![[ ]](/icons/layout.gif) | third-person-endings-1.pdf | 2015-02-21 16:20 | 6.3K | |
![[ ]](/icons/unknown.gif) | SeccionesArchivosSoporteController.php | 2013-10-31 02:40 | 4.9K | |
![[IMG]](/icons/image2.gif) | logout.jpg | 2013-09-15 02:57 | 1.7K | |
![[ ]](/icons/unknown.gif) | ~$CLOTHING2.pptx | 2019-06-05 02:29 | 165 | |
![[ ]](/icons/unknown.gif) | New Microsoft Word Document.docx | 2017-05-30 00:45 | 0 | |
![[ ]](/icons/unknown.gif) | B1VGDI6K | 2019-01-21 22:19 | 0 | |
|